A hydrogen electrode is immersed in a 2.7 M solution of acetic acid at 25 degrees Celcius. This electrode is connected to another consisting of an iron nail dipping into 2.7 M FeCl2.What will be the measured potential of this cell?Assume Ph2=1.00 urrent AttemptA hydrogen electrode is immersed in a 2.7 M solution of acetic acid at 25 °C. This electrode is connected to another consisting of airon nail dipping into 2.7 M FeCl2.What will be the measured potential of this cell?Assume PH2 = 1.00 atm.Ecell -

Answered: Image /qna-images/answer/fbc8820e-c25f-4970-9f94-bfe8c354b0bc.jpg

A hydrogen electrode is immersed in a 2.7 M solution of acetic acid at 25 degrees Celcius. This electrode is connected to another consisting of an iron nail dipping into 2.7 M FeCl2. What will be the measured potential of this cell? Assume Ph2=1.00

A hydrogen electrode is immersed in a 2.7 M solution of acetic acid at 25 degrees Celcius. This electrode is connected to another consisting of an iron nail dipping into 2.7 M FeCl2. What will be the measured potential of this cell? Assume Ph2=1.00

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter21: Potentiometry

Section: Chapter Questions

Problem 21.15QAP

See similar textbooks

Related questions

Q: Consider the following cell reaction: Co(s)+2 H (? M) Co2*(1.00 M)+ H2(g)(1.00 atm) If the cell…

A: The pH of the acid solution is less than 7 and while of the base is greater than 7. The pH and…

Q: A galvanic cell consists of a cathode with a cadmium electrode in a 0.252 M solution of Cd(NO3)2 and…

A: The concentration of cadmium ions at anode is equal to the concentration of cadmium nitrate solution…

Q: The equilibrium constant, K, was found to be 3.8 x108 at 25°C for the following reaction, 2X(s) +…

A: For the given reaction: 2X(s) + 3Y2+(aq) →2X3+ + 3Y(s) As the charges are equal on both sides.…

Q: Using the information from the table below, calculate the Nernst Potential for Na+, K+, Ca+2, Cl-.…

Q: Use the tabulated electrode potentials to calculate K for the oxidation of iron by H++ (at 25°C):…

Q: A constant current of 0.912 A is passed through an electrolytic cell containing molten MgCl2 for…

A: According to the Faraday's first law of electrolysis, the amount of any substance deposited at the…

Q: Calculate the potential of the following cells: a. a galvanic cell consisting of lead electrode…

Q: 10. Calculate the potential of the following cells: a) a galvanic cell consisting of a lead…

A: Given: Pb2+ =0.0848 MZn2+=0.1364 M TiO2+ =0.00146 M Ti3+ =0.02723

Q: A galvanic cell consists of a cathode with a nickel electrode in a 0.186 M solution of Ni(NO3)2 and…

Q: standard potential for the reaction

Q: A concentration cell similar to the one shown is composed of two Mn electrodes and solutions of…

A: Concentration cells use same electrode but the concentration of electrolytic solution varies. They…

Q: Consider the following electrochemical cell in which the volume of solution in each half-cell is 100…

A: The Nernst equation is shown below: Ecell = electrode potential at any condition E0cell = standard…

Q: 5. Calculate the standard cell potential, E cell, for each electrochemical cell at 298K if Keg=1.38…

A: Given data contains, Temperature is 298K. Keq=1.38×10-5n=2

Q: The following cell was used for the determination of pCrO4: SCE||CrO,-(xM),Ag,CrO,(sat'd)|Ag…

Q: Calculate the potential of an electrode at normal conditions in contact with a solution that is…

A: Using Nernst equation we can calculate unknown electrode’s potential.

Q: A. If the measured cell potential is 1.800V, what is the concentration of Au3+? B. How long will it…

A: Here we have to determine the concentration of Au+3 of the galvanic cell and mass of gold…

Q: Consider the following cell reaction: Fe(s) + 2 H*(? M) Fe2*(1.00 M) + H2(g)(1.00 atm) If the cell…

A: By applying formula Ecell = E•cell - 0.0591/2 . Log[Fe2+]| [H+]2 At 25 degree Celsius

Q: Given that the standard electrode potentials (E°) of metals are :K+/K = -2.93 V, Ag+/Ag = 0.80 V,…

A: Lower the value of reduction potential, stronger the reducing agent and higher the value of…

Q: The following cell Ag | Ag+(0.10M) || Ag+(1.0M) | Ag is a concentration cell and is capable of…

Q: A fuel cell is constructed in which both electrodes make use of the oxidation of methane. The…

A: (a)

Q: Consider a battery made from one half-cell that consists of a copper electrode in 1 M CuSO4 solution…

A: Every battery can be considered as voltaic cell. At anode, oxidation takes place and at cathode,…

Q: Consider the following cell reaction: Mn(s) + 2 H+(? M) Mn2+(1.00 M) + H2(g)(1.00 atm) If the cell…

A: Given data : Mn(s) + 2 H+(_____M) gives Mn2+(1.00 M) + H2(g)(1.00 atm)the cell potential (E cell…

Q: What is the electrode potential of an electrode consisting of Zinc metal in a solution in which the…

A: Given, The electrode potential of an electrode consisting of Zinc metal in a solution in which the…

Q: The galvanic cell made up of cobalt, copper, and their M2+ ions, has a standard cell potential of…

Q: a galvanic cell is constructed from a standard hydrogen electrode and from another hydrogen…

A: Given, A galvanic cell is constructed from a standard hydrogen electrode and from another hydrogen…

Q: Determining volume of a gas by electrolysis. What volume of chlorine gas at standard temperature and…

A: Given information: Current = 12.4 A Time = 1.0 h Charge flown: Q = It= 12.4×60×60= 44640 C For the…

Q: A voltaic cell is constructed in which the cathode is a standard hydrogen electrode and the anode is…

A: The electrode which has less negative reduction potential will act as a cathode and will undergo…

Q: calculate the value of the electrode potential of hydrogen: a) in the 0.05 M solution of sulfuric…

A: a) Given : Concentration of sulfuric acid i.e H2SO4 = 0.05 M Since H2SO4 is a strong acid which will…

Q: ulate the potential of the following cells: a galvanic cell consisting of a lead electrode on the…

Q: Use the standard half cell potentials listed below to calculate the standard cell potential for the…

Q: Calculate the actual cell potential if you have a 1 M solution of MgSO4, but only a 0.5 M solution…

Q: Consider the following cell reaction: Fe(s) + 2 H*(? M) –→FE²*(1.00 M) + H2(g)(1.00 atm) If the cell…

Q: A current of 0.452 Amps is passed through an electrolytic cell containing molten CaCl2 for 1.50 hrs.…

Q: A cell is set up with copper and lead electrodes in contact with CuSO4(aq), and Pb(NO3)2(aq). If…

A: The electrode which has less negative reduction potential will act as a cathode and will undergo…

Q: Consider the following cell reaction: Ni(s) + 2 H+(? M) Ni2+(1.00 M) + H2(g)(1.00 atm) If the cell…

A: A numerical problem based on Nernst equation, which is to be accomplished.

Q: A voltaic cell employs the following redox reaction: 2 Fe³+ (aq) +3 Mg (s) → 2 Fe (s) +3 Mg²+ (aq)…

A: Given- 2Fe+3 (aq) + 3 Mg (s) → 2Fe (s) + 3 Mg2+(aq) Oxidation half reaction = 3 Mg (s) →3…

Q: A galvanic cell is constructed using the following half-reactions at 298 K. Given Kf = 1.0 x 10^8…

A: Given formation constant for MX42+(aq) , Kf = 1.0*108 Since Kf >> 1, formation of MX42+(aq)…

Q: Consider the following cell reaction: Mn(s) + 2 H*(? M) –→MN2*(1.00 M) + H2(g)(1.00 atm) If the cell…

Q: alculate the standard potential, ?∘, for this reaction from its Δ⁢G° value.…

A: Standard Reduction Potential - It is the difference between the reduction potential of cathode and…

Q: Consider the following cell reaction: Co(s) + 2 H*(? M) Co2+(1.00 M) + H2(g)(1.00 atm) If the cell…

A: Here we are required to find the pH of hydrogen electrode

Q: What is the potential of a concentration cell at 25.0 °C if it consists of copper electrodes dipping…

A: We have to find Ecell

Q: Copper metal (63.55 g/mol) is purified by electrolysis. How much copper metal (in grams) could be…

Q: Consider the following cell reaction: Fe(s) + 2 H*(? M) "(1.00 M) + H2(g)(1.00 atm) If the cell…

A: Since you have asked multiple question, we will solve the first question for you as per our…

Q: 18. When pH = 7, p(O,) = 100 kPa, O, + 4H" + 4e calculate the electrode potential in according to…

A: 1 bar = 100 kPa [H+] = 10-pH = 10-7 M Nernst equation: EO2/H2O = EO2/H2O° -0.05914log1PO2×H+4…

Q: Balance the following reactions. Calculate the cell potential and the Gibbs free ener these…

A: The question is based on concept of electrochemistry. we have been given a cell. We have to…

Q: A student does an experiment to determine the molar solubility of lead(II) iodide. She constructs a…

A: Write the reactions taking place at anode and cathode,

Q: a galvanic cell is constructed from a standard hydrogen electrode and from another hydrogen…

A: A numerical problem about galvanic cell constructed using two Hydrogen electrodes.

Q: At 298 K a cell reaction has a standard cell potential of+0.17 V. The equilibrium constant for the…

A: At 298 K a cell reaction has a standard cell potential of +0.17 V. The equilibrium constant for the…

Q: Consider the following cell reaction: Ni(s) + 2 H*(? M) →Ni²*(1.00 M) + H2(g)(1.00 atm) If the cell…

Question

A hydrogen electrode is immersed in a 2.7 M solution of acetic acid at 25 degrees Celcius. This electrode is connected to another consisting of an iron nail dipping into 2.7 M FeCl2.

What will be the measured potential of this cell?

Assume Ph2=1.00

urrent Attempt
A hydrogen electrode is immersed in a 2.7 M solution of acetic acid at 25 °C. This electrode is connected to another consisting of a
iron nail dipping into 2.7 M FeCl2.
What will be the measured potential of this cell?
Assume PH2 = 1.00 atm.
Ecell -

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
A metallurgist wants to gold-plate an object with a surface area of 17.21 in2. The gold plating must be 0.00200 in. thick (assume uniform thickness). (a) How many grams of gold (d=10.5g/cm3) are required? (b) How many minutes will it take to plate the object from a solution of AuCN using a current of 7.00 A? Assume 100% efficiency.
Suppose Ered for H+H2 were taken to be 0.300 V instead of 0.000 V. What would be (a) Eox for H2H+ ? (b) Ered for Br2Br ? (c) E for the cell in 34(c)? Compare your answer with that obtained in 34(c).