A reaction where DH is positive, and DS is positive will occur only at high temperatures True False

Q: Ng t = N- ミーミ

A: Answer:- The entropy is the degree of randomness or disorderness . Higher the randomness , higher…

Q: Determine AH°rxnfor the decomposition of the following reaction: 2NOCI(g) → N,(g)+O,(g) + Cl,(g)…

A:

Q: A potential chemical reaction at 25.0 °C has a ΔHrxn of 163 kJ and a ΔSrxn of -354.3 J/K. What is…

A: Given Data:

Q: The values of delta Horxn and delta Sorxn for the reaction  2 NO(g) + O2(g) --> 2NO2(g)    are…

A:

Q: 1. For the given reaction: Calculate AG at this temperature = 298.15 K 4Fe(s) + 302 (g) → 2Fe₂O3(s)…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: Calculate ΔGrxn at 298 K under the conditions shown below for the following reaction. Please show…

A: First of all the reaction is given as: Fe2O3 (s) + 3CO(g) →2Fe(s) + 3CO2 (g)   Standard free energy…

Q: Determine the AU°reaction at 25 °C (in kJ/mol) for the following reaction: SİCI4(I) →Si(s) + 2C12(g)…

A: Internal energy (U) is  the total amount of kinetic and potential energy possessed by the molecules…

Q: For the evaporation of water at 37oC, is the value of Q negative, zero, or positive?

A: Since the temperature of water is less than the boiling point of water Hence the energy required for…

Q: Consider the generic reaction: A + 2 B -------> C + 3 D       ∆H = 155 kJ Determine the value of…

A: Given, A + 2 B -------> C + 3 D       ∆H = 155 kJ

Q: If a reaction occurs rapidly it is spontaneous. True or false

A: A spontaneous reaction is defined as the reaction that favours the formation of the products without…

Q: The value of ΔGo for the reaction, N2(g) + 3 H2(g) ⇌ 2 NH3(g) is -32.90 kJ at 298 K. Calculate the…

A:

Q: For the reaction 2CO(g)   +   O2(g)   ---------->   2CO2(g)      ΔHorxn = -566.0 kJ ΔSsys is…

A:

Q: Predict the signs of ΔH and ΔS for this reaction. Explainyour choice.

A: Given diagram,

Q: Which one of the following reactions cannot proceed spontaneously as written at any temperature?…

A: For a reaction having ∆H positive and ∆S negative can not be spontaneous.

Q: For the reactionCH4(g) + H2O(g)3H2(g) + CO(g)H° = 206 kJ and S° = 215 J/KG° for this reaction would…

A: If any reaction possesses -ve value for Delta G which reflects the value smaller than zero then the…

Q: For the chemical reaction below, determine the sign of the AS. Reaction Sign of AS (+ or -)…

A:

Q: For the evaporation of water during perspiration (process of sweating) on a hot, dry day, (In this…

A: Answer - The correct option is (A) Evaporation - Evaporation is a type of vaporization that occurs…

Q: How does probability relate to spontaneity

A: A spontaneous chemical reaction proceed like a downhill. The spontaneity of a reaction can also be…

Q: Which statement is true of a reaction in which ∆V is positive?Explain.a. ∆H = ∆E b. ∆H > ∆E c. ∆H…

A: The reaction which is carried out in more than one step then the sum of all the steps gives the…

Q: For the reaction Fe2O3(s) + 3H2(g)2Fe(s) + 3H2O(g) H° = 98.8 kJ and S° = 143 J/K G° for this…

A:

Q: Calculate ∆Go at 25 ᴼC for the reaction of which ∆Ho = +210kJ; ∆So = 32.5 J/K

A: Given, ∆H° = +210 KJ  ∆S° = 32.5 J/K

Q: 44. Calculate the AHrxn for the following reaction at 25° 2FES + 50, → 2FEO + 45O; AHxn -1118 -110.5…

A:

Q: Predict DS for the reaction below at 125 degrees Celsius  C2H5OH(g)+3O2(g)=2CO2+3H2O(g) A.negative…

A: The reaction given is C2H5OH (g) + 3 O2 (g) ------> 2 CO2 (g) + 3 H2O (g)

Q: 4. In general, AG, for dissolution reactions is at low temperatures and at high temperatures. zero,…

A: In general, heat energy is released as gas dissolves in solution, meaning the dissolution reaction…

Q: Lead(II) oxide can be reduced to form elemental lead through the reaction: PbO(s) + C(s) → Pb(s) +…

A: Interpretation -  To determine the the enthalpy of the reaction at 25oC where lead oxide can be…

Q: Consider the reaction below. Using the information provided below, calculate AG°rxn for the reaction…

A: Standard Gibbs free energy of a reaction can be used to determine the spontaneity of the reaction.…

Q: Calculate the crossover temperature at which the reaction N2(g) + 3H2(g) > 2NH3(g) becomes…

A:

Q: Hint: No calculations are required. For the reaction CO:(g) + H2(g)CO(g) + H20(g) AH° = 41.2 kJ and…

A: Dear student I have given answer to your question in the image format.

Q: Predict the sign of AS and then calculate AS for each of the following reactions. (This problem…

A: The change in entropy (ΔS) is defined as the difference between the sum of the entropies of the…

Q: For the reaction H,(g) + C,H,(g)–→C‚H6(g) AH° =-137 kJ and AS° =-121 J/K %3D AG° would be negative…

A: GivenH2(g)  +  C2H4(g)  →  C2H6(g)∆H° = -137 kJ = -137000 J∆S° = -121 J/K∆G° is given by formula∆G°…

Q: Consider the combustion of butane gas: 13 O2(g) 4CO2(g) + 5H20(g) -2 (a) Predict the signs of AS and…

A: This reaction is a combustion reaction of butane gas in presence of excess of air. Butane is a…

Q: Predict the sign of AS for each process. Drag the appropriate items to their respective bins. Help…

A: Entropy is a property of substances that indicates the randomness in the system. If entropy is…

Q: A solid sample of copper, Cu(s), is placed in a test tube containing a solution of nitric acid,…

A: Cu(s)  + 4HNO3 (aq) → Cu(NO3)2 (aq) + 2 NO2 (g) + 2H2O(l) + heat  △Hsys  is negative. Reaction is…

Q: Calculate the value at Ko for the hypothetical reaction: Q(g) + 2X(g) = M(g)

A:

Q: Compute the standard entropy change for the following reaction. N2(g) + 3H2(g) → 2NH3(g) Enter your…

A: Standard entropy of formation ΔS for N2, H2 and NH3 is given.

Q: 1. A potential chemical reaction at 25.0 °C has a ΔHrxn of 147.5 kJ and a ΔSrxn of -386.9 J/K. What…

A:

Q: Predict the sign of AS° and then calculate AS° for each of the following reactions. (This problem…

A:

Q: 2. Predict the sign of AS° for each reaction. а. АВ2(g) + A(s) —> 2AB(g) b. 2AB2(g) + B2(g) →…

A:

Q: Hint: No calculations are required. For the reaction CH4(g) + H20(g)→3H2(g) + CO(g) AH° = 206 kJ and…

A: In this question, we will Identify the temperature at which this reaction is Product favored.  You…

Q: For the following reaction predict the sign of ΔΔS.…

A: (∆S) Entropy, the measure of a system's thermal energy per unit temperature that is unavailable for…

Q: Consider the reaction described by the chemical equation shown. 3C,H,(g) → C,H,(1) AHn = -633.1 kJ…

A:

Q: Consider the combustion of butane gas: 13 C4H10(g) + -O₂(g) → 4CO₂(g) + 5H₂O(g) 2 (a) Predict the…

A:

Q: Under what temperature conditions (low T, high T, all T, nonspontaneous at all T) would this…

A: The question is based on the concept of spontaneity of the reaction. we have to identify under which…

Q: Hint: No calculations are required.For the reaction4NH3(g) + 5O2(g)4NO(g) + 6H2O(g)H° = -905 kJ and…

A:

Q: Consider the following reaction: * 4KCIO3(s) → 3KCIO4(s) + KCI(s) Determine AGosys for the process…

A: Given data set: ∆H°sys = -144.3 kJ ∆S°sys = -36.8 J/K We need to determine the value of ∆G°sys at T…

Q: 2. Lead (II) sulfide is the principle source of lead metal. To obtain the metal, the sulfide is…

A: Here we have to calculate change of enthalpy of reaction of one mole lead sulfide with oxygen and…

Q: 2Br2 (ℓ) + 2H2O(ℓ) ⇄ 4Br- (aq) + O2(g) + 4H+ (aq) Br2 (ℓ) + 2e- → 2Br- (aq)       ℰ° = 1.065V O2(g)…

A: Delta g = - nFEcell0  Ecell0  = Ecathodeo - Eanodeo      = 1.065 - 1.229 = - 0.165 V  ∆G0= -…

Q: 2. For the following reaction at 25°C, AG° is -118.4 kJ. At what pressure of O2 gas does AG = 0 at…

A:

Q: When AH is positive and AS is negative, the reaction is nonspontaneous at all temperatures True…

A: Given :-  Statement : when ∆H is positive and ∆S is negative, the reaction is nonspontaneous at all…

Q: What is the maximum work that could be obtained from 5.44 g of zinc metal in the following reaction…

A:

Photochemistry

Photochemistry is the part of chemistry that studies the various mechanisms of reactions that are triggered by the presence of light energy. It also helps to study the changes involved in a molecule that can undergo the absorption of radiation.