a. H2C=CH2 b. (CH3)2C=CH2 c. CH3CH=CHCH3

Q: Geometry of CH3+

A: The arrangement of atoms around the central atom is called the geometry of the atom. The number of…

Q: OCH3 CH3 CH3

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)

Q: h) CH3-CH2-CH2-CH2- ċ=ċ-CH3 i) CH3 -CH3 CH3 CH3-CH,–ĊH ČH3 HIC

A:

Q: 3. Give the COMMON NAME of the following compound CH3 CH3-CH-CH2-CH2-CH3 4. Give the COMMON NAME of…

A:

Q: Which substance has the lower boiling point? Explain.

A: There are many factors that affect the boiling point of the molecule such as molecular mass, surface…

Q: Part A CH3-CH-CH3 CH3

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: 1. ВН+ THF (с) CH,=CH-CH2 -Ĉ-CH3 2. НО, Н.О2, Н20 CH3 1.Hg(OАC),, Нн,О, THF 2. NABH4 (d)…

A:

Q: Please name       (a)  CH3-CH2-CH2-CH-CH3                                 (b) CH3

A: Alkanes are saturated hydrocarbons. If an alkane has a missing hydrogen atom, then the group is…

Q: OH H3C-CH- -CH-CH2- -CH2-CH3 H2C-CH3 g. IUPAC || h. H3C-CH2-C-CH3 IUPAC || H;C-CH2-C--CH3 Derived

A:

Q: CH3-CH2-CH-CH2-CH2-CH2-CH3 ČH2-CH2-CH3 The name for this branch is

A: A question based on the nomenclature, which is to be accomplished.

Q: is CH;CH2 -C-H An isomer of CH;CH, CH3-C-H CH3-C-CH3 O CH3-O-CH2CH3 O CH3CH2CH2-OH

A:

Q: PAC OR common name for the compound CH3 - CH2 - CH2-O- CH2 - CH3 is

A:

Q: CI H20 CH3-CH=CH-CH3 + Cl2 CH3-CH-CH-CH3 ÓH

A: Given : We have to determine the product for the following reaction.

Q: a. b. CH3 c. CH3

A: Since you have posted a question with multiple sub-parts,we will solve first three sub-parts for…

Q: Name and classify each compound CH,CHNHCH CH, 1. CH,CH,NCH.CH, CH, 2. 3. CH3CH₂CH₂CH₂NH₂

A:

Q: 1. Use the IUPAC rues to namne the folkowing structures. CH CH =CHCHCH, b. CH3 a. CH3 CH2 CH3…

A:

Q: Name: CH 3 H3C- CH – CH 2- CEN

A: For naming of a compound,  1st numbering the compound so that substituent gets least numbering.…

Q: a) ? -CI ? b) с-он -CH2OH с) ? -C-H С-он d) ? CH3CH2CH2C-OH CH,CH,CH2C-ONa

A:

Q: What is an i somer of CH =C? CH3 CH's CH3

A: Given:  To find: isomer of the given compound.

Q: ÇH3 CH3 HCI (U) H3C HC ÓH ÇH3 SOC, CHONA ? ? (V) Ph Ру DMF HSO4, A H3C Он (W)

A:

Q: (а) Вк, CH3 (b) Br. CH3 CH2CH3 (с) Вr, CH2CH2OH (а) Cн CH2OH CH(CH3)2 CH3

A: ->When most preferential group attached to double bonded carbon atoms are on same side then it is…

Q: а. CH2=CH–CH2–CH3 CH3 | b. CH;-C=C-CH2-CH2-CH–CH3 с.

A:

Q: IUPAC: CH;CHCH,CH3 CH2 F CH-CHCHCH,CHСНСH-0C(CH,); CHỊCHCH, IUPAC:

A: The IUPAC name of the compound can be written on the basis of the main carbon chain, functional…

Q: Which is a stronger base?

A: A molecule or an ion that is capable of donating a proton or accepting an electron pair in a…

Q: а. H3C-CH-CH2-CH3 ÓCH3 Common: b. H3C-NH-ÇH -CH3 CH3 Common:

A: Nomenclature of organic compounds.

Q: ÇI CH3 0 IUPAC CI CH3 O HO Common Name || H3C-0-CH2-CH2-CH2-c-OH IUPAC

A:

Q: CH3 d. H2C=CH -CEN H2C=CH-Ć=CH2 +

A: The question (d) involves a diene and a dienophile. It is an example of diels alder reaction. The…

Q: b) H3PO4 HOCH3 CH3

A: First of all alkene react with acid (H3PO3) and carbocation formed then if rearrangement possible…

Q: Propose a mechanism for the following reaction

A: Given reaction,

Q: An isomer of CH3CH=CHCH2_OH is

A:

Q: ÇI j. Br-C-CH2-ĆH-CH3 Туре of functional group CI Br- CH,-CH-CH, IUPAC CI Br-C-CH2-CH-CH3 Common…

A: The question is based on the concept of IUPAC naming and common naming. there are certain rules to…

Q: 1.) CH:CH2CH=CHCH3 2.) CH:CH2C=CHCH3 | CH3 3.) CH=CCH2CH=CH2

A: NOTE ; Since you've posted multiple sub-parts,we'll solve only first three sub-parts for you. To get…

Q: IUPAC name for CH3-CH2-C=C-CH3

A: IUPAC is the International Union of Pure and Applied Chemistry. Names of the chemical compounds are…

Q: Which species in each of the pairs  is the stronger base?

A: The presence of electron density on the specific atom decides its basicity.

Q: 2. CH3C CH2 CH3 + CH3OH OH

A: The given reaction is between butan-2-one (a ketone) with methanol, which results in the formation…

Q: Name the compound. * H3C-CH2-CH-CH3 H3C-CH CH3

A:

Q: UIPAC NAME (CH3),C=CH2 UIPAC NAME CH3 CH;-CH2-CH2-CH2-CH2-CH2-CH3 CH3-CH2-CH3 COMMON NAME

A:

Q: Write the IUPAC name of CH3CH2CH(OH)CH(NO2)CH(CH3)CHO.

A: Aldehyde functional group is given more priority as compared to the alcohol functional group.

Q: (CH3CO)20 Br2 a.) H2N- CH3 pyridine FeBr3 1. LIAIH4, ether 2. Но b.) NaN3 Br c.) H2/Ni + -NH2

A: Here we are required to predict the product of reaction.

Q: Draw CH3CN

A: Solution - There are a total of 16 valence electrons in the CH3CN Lewis structure. The CH3CN…

Q: + HCI CH:- CH-CI + CH3

A: substitution reaction are reaction in which one functional group which is good leaving group is…

Q: Arrangement of more stable ? CH3 CH3 CH

A: Concept is based on carbocations

Q: CHS CH3 CH2CH2 CH3 b. CH;CHCH a.

A: Isomers: Compounds having same molecular formula but differ in their chemical structure. Isomerism…

Q: What compound is CH3-CH(CH3)-CH2-CH2-CHO ?

A: The organic compounds are the ones which contain carbon in it. Organic compounds also have…

Q: a OH CH2CNHCH3 CH₂ с d OH CHCHNHCH₂ CH3

A: Here we have to determine the starting material and the reagents to get the given intermediate and…

Q: ه S CH3-CH₂ CH3 شد

A: Rules for naming an IUPAC compound • Select the longest continuous carbon chain. If the compound is…

Q: ОН CH3 | CHCH3 + HCl

A:

Q: Name the compounds. CH,CH3 CI compound B CH2CH3 compound A name of compound A: name of compound B:

A: From given  Two organic structures name of those nomenclature is given along with suitable…

Electronic Effects

The effect of electrons that are located in the chemical bonds within the atoms of the molecule is termed an electronic effect. The electronic effect is also explained as the effect through which the reactivity of the compound in one portion is controlled by the electron repulsion or attraction producing in another portion of the molecule.

Drawing Resonance Forms

In organic chemistry, resonance may be a mental exercise that illustrates the delocalization of electrons inside molecules within the valence bond theory of octet bonding. It entails creating several Lewis structures that, when combined, reflect the molecule's entire electronic structure. One Lewis diagram cannot explain the bonding (lone pair, double bond, octet) elaborately. A hybrid describes a combination of possible resonance structures that represents the entire delocalization of electrons within the molecule.

Using Molecular Structure To Predict Equilibrium

Equilibrium does not always imply an equal presence of reactants and products. This signifies that the reaction reaches a point when reactant and product quantities remain constant as the rate of forward and backward reaction is the same. Molecular structures of various compounds can help in predicting equilibrium.