Answered: Al(s) + Cl2 (g)→AlCl3 (s) Express your…

Science

Chemistry

Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in your answer.

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter10: Liquids And Solids

Section: Chapter Questions

Problem 20E: The density of liquid NH3 is 0.64 g/mL; the density of gaseous NH3 at STP is 0.0007 g/mL. Explain...

See similar textbooks

Related questions

Q: 16) 1-butanethiol, one of the compounds giving skunks their distinctive odor, freezes at -115.7°C…

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :- ZnO(s) + ∆ → Zn(l) + O2(g) To balance :- Given equation

Q: Pb(NO3)2(aq) + 2KCl(aq) Express your answer as a balanced chemical equation. Identify all of the…

A: Given,

Q: How many phases are present in the following systems? Also define each of the erminologies…

A: Phases They are the homogeneous and distinct of a system without the visible boundary. Phase diagram…

Q: A pharmaceutical company develops a new drug and collects data about its phases. Given the following…

A: Given: At atmospheric pressure its melting point is 75°C and its boiling point is 157°C Its triple…

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: АСTIVITY 2 - а3 Interpreting a Phase Diagram Refer to the following phase diagram of a certain…

A: We are authorized to answer the first three subparts of a question at a time. Since you have not…

Q: F. 150 135 120 105 90 75 C 60 45 30YA 15 Heat (kJ) Created by E. Lee for Virtual Virginia (2021)…

A: This curve is the example of heating curve. This is because in y direction temperature is increasing…

Q: When benzene is at its melting point, two processes occur simultaneously and balance each other.…

A: Melting of benzene means a conversion of solid forms to liquid form

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: Qs2. You are given two similar looking white, organic crystalline solids and determine their melting…

A: Given information:The two organic compounds are similar in nature and melting points of first and…

Q: HF(aq)HF(aq) and Ba(OH)2(aq)Ba(OH)2(aq) Express your answer as a balanced chemical equation.…

A: Given, HF(aq) and Ba(OH)2(aq)

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 77.15 g/mol and…

A: A crystal lattice comprises of several init cells. The number of atoms in simple cubic unit cell is…

Q: Question attached

A: Acid react with a base to form salt and water.

Q: Calculate the surface tension of ethanol at 0 and 70 °C. Let the critical temperature of ethanol be…

A: Surface tension of the concerned liquid can be calculated from Eotvos equation.

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 61.8 g/mol and…

A: Atomic radius (a) = 0.163 nm =1.63 x 10-8 cm Atomic Weight = 61.8 g/mol

Q: Consider a 75 g sample of H2O (g) at 125 degrees Celsius. What phase or phases are present when 215…

A: Given data,Mass of water=75gTemperature of water=125oCEnergy removed=215kJ

Q: Given the following data, what is the boiling point of CCI4 in °C? Round to the nearest integer (no…

A: The thermodynamic data given is,

Q: A sample of water at 23 degrees Celsius required an input of 1.69 times 10 to the fourth power J of…

Q: 2. During a phase change, what properties change? Mass Volume Temperature Heat

A: There are three phases of matter. The phase of matter can be interchanged by changing the…

Q: HCl(aq)+Ba(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

Q: Q.6: In given diagram, explain Tg and Tm for different materials? Liquid Glass Semicrystalline solid…

A: The given plots in the question clearly discusses about the phase change behaviour of several…

Q: How long (in seconds) would it take a 50.0 watt (1 watt = 1 J/s) heater to melt 10.02 g of Au(s)…

A: Given : Mass of gold = 10.02 g Initial temperature of gold = melting point temperature = 1064 oC…

Q: The liquid phase is represented by which of the following letters A) T B) x C) w D) y

A: x is the area that represent liquid phase.

Q: Some hypothetical metal has a simple cubic crystal structure. If its atomic weight is 68.73 g/mol…

A: r = 0.153nm In simple cubic, a=2r a= 2×0.153 =0.306nm Or a= 3.06 × 10-8cm a3 = 28.65 ×…

Q: The following defined relationships describe an antiquated set of British liquid units: 1 hogshead =…

A: Given : value in hogshead = 144 The relationships given are 1) 1 hogshead = 7 firkin 2) 1 firkin =…

Q: NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation.…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 77.78 g/mol and…

Q: After performing an experiment to know if the ice cubes will sink or float in two separate jars…

A: An experiment was performed to know wheather the ice cubes will sink or float in two separate jars…

Q: H,SO, (ag) and KOH(og) Express your answer as a chemical equation. Identify all of the phases in…

A: H2SO4 is acid while KOH is base so this is a type of neutralisation reaction . Generally these all…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Write a balanced equation for the complete combustion of table sugar (sucrose, C12 H22O11). Use…

Q: help

A: Moon phases or Lunar phases changes over a period of time in approximately one month. The shape of…

Q: If the length of the column of mercury is (6 cm) in the triple point. What is its length at(-125)…

Q: HClO4(aq)+NaOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

A: The acid react with base to form salt and water , called as neutralization reaction.

Q: Write a balanced equation for the complete combustion of solid palmitic acid. Use H2 O(1) in the…

A: A balanced chemical is equation has equal numbers of atoms for each element involved in the reaction…

Q: Describe the relative densities of the phases for most substances. density of gas phase density of…

A: The relative densities of solid, liquid and gas can be explained on the basis of packing of…

Q: Organic molecules change phases above 300°C. O True O False

A: Organic molecule chnges phases

Q: Some hypothetical metal has simple cubic crystal structure. If its atomic weight is 68.21 g/mol and…

Q: Fe(s)+S8(s)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your…

A: The given unbalanced equation is : Fe(s) + S8(s) → Fe2S3(s)

Q: Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

Q: Ca(s)+Br2(l)⟶CaBr2(s) Express your answer as a chemical equation. Identify all of the phases in…

A: The equation is already balanced, so the answer is:Ca(s)+Br2(l)⟶CaBr2(s) As the number of atoms are…

Q: C3H6(g)+O2(g)→CO2(g)+H2O(g)C3H6(g)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: A combustion reaction is a reaction in which a substance reacts with oxygen to give carbon dioxide…

Q: Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation…

A: Given, Human cells obtain energy from a reaction called cellular respiration. The skeletal equation…

Q: Mg(s) + Br2 (1) → MgBr2 (s) Express your answer as a chemical equation. Identify all of the phases…

A: The given reaction is,

Q: Na(s)+H2O(l)→NaOH(aq)+H2(g)Na(s)+H2O(l)→NaOH(aq)+H2(g) Express your answer as a chemical equation.…

Concept explainers

Solutions

Solutions can be considered as homogeneous mixtures which contain two or more than two chemical substances. The chemical substance which is the greater part is defined as solvent. And the chemical substance that is dissolved in a solvent is referred to as solute. Solution chemistry plays an important role in chemistry since it supports many commercial applications of solutions.

Question

Al(s) + Cl2 (g)→AlCl3 (s)
Express your answer as a chemical equation.
Identify all of the phases in your answer.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

HNO3(aq)+Mg(OH)2(s)→HNO3(aq)+Mg(OH)2(s)→ Express your answer as a chemical equation. Identify all of the phases in your answer.
NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
N2H4(l)→NH3(g)+N2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. (Please type answer no wright by hend)
Fe(s)+S(l)→Fe2S3(s)Fe(s)+S(l)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Balance each chemical equation.
Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation for cellular respiration. C6H12O6(aq)+ O2(g)= CO2(g) +H2O(I) express your answer as a chemical equation. Identify all of the phases in your
a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a chemical equation. Identify all of the phases in your answer. b)For C5H5NH+, write an equation that shows how the cation acts as an acid. Express your answer as a chemical equation. Identify all of the phases in your answer.
H3PO4 (aq) + NaOH(aq) → Express your answer as a chemical equation. Identify all of the phases in your answer.
A stopper is removed from a partially filled bottle containing liquid acetic acid. A vinegar-like odor is detected. How many phases are present in the bottle? a) 0 b) 1 c) 2 d) 3
Cu₂O(s) + O2(g) → CuO(s) Express your answer as a chemical equation. Identify all of the phases in your answer.
(aq) # Al(s) -+ Mn?+ (ag) + Af# (ag) Express your answer as a chemical equation. Identify all of the phases in your answer.
Write the net ionic equation for 3HNO3(aq)+Al(OH)3(S) = Al(NO3)3(aq)+3H2O(l) Express your answer as a balanced net ionic equation. Identify all of the phases in your answer.
K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s)K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Keep the order of compounds as in the original equation.