Answered: H3PO4(aq) + KOH(aq) → Express your…

Science

Chemistry

H3PO4(aq) + KOH(aq) → Express your answer as a chemical equation. Identify all of the phases in your answer.

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter10: Liquids And Solids

Section: Chapter Questions

Problem 20E: The density of liquid NH3 is 0.64 g/mL; the density of gaseous NH3 at STP is 0.0007 g/mL. Explain...

See similar textbooks

Related questions

Q: Which of the following phases does a sample of water exist in its triple point? gas solid none of…

A: Here we have asked for which of the following phases does a sample of water exist in its triple…

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :- ZnO(s) + ∆ → Zn(l) + O2(g) To balance :- Given equation

Q: Pb(NO3)2(aq) + 2KCl(aq) Express your answer as a balanced chemical equation. Identify all of the…

A: Given,

Q: How many phases are present in the following systems? Also define each of the erminologies…

A: Phases They are the homogeneous and distinct of a system without the visible boundary. Phase diagram…

Q: he melting point and freezing point are the same temperature. True or False

A: Melting point is the point where the solid phase changes to liquid Freezing point is the point…

Q: H[(aд) + LiOH (ag)-> Express your answer as a chemical equation. Identify all of the phases in your…

A: Given a chemical reaction as following,HI(aq)+LiOH(aq)→we are asked to complete the above reaction.

Q: Part G What is the pressure of the substance at the triple point? Express your answer using two…

A: Given : We have to tell the pressure at triple point.

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: АСTIVITY 2 - а3 Interpreting a Phase Diagram Refer to the following phase diagram of a certain…

A: We are authorized to answer the first three subparts of a question at a time. Since you have not…

Q: When potassium sulfite dissolves in water, the sulfite ion SO2−3 acts as a base. Write a balanced…

A: The equation containing identical number of species reacting as well as species produced and their…

Q: Estimate the thermal diffusivity of butter at 20 degrees Celsius

Q: 4(a) For each of the following substances describe the importance of dipole-dipole interactions and…

A: Intermolecular forces like London dispersion force (LDF), dipole-dipole interactions and hydrogen…

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: solid liquid gas 200 400 pressure (atm)

A: We are given the phase diagram of substance X,

Q: the phase diagram of CO₂ below. 72.9 atm Supercritical fluid

A: The gas temperature cannot be liquified even high pressure can be applied.

Q: HF(aq)HF(aq) and Ba(OH)2(aq)Ba(OH)2(aq) Express your answer as a balanced chemical equation.…

A: Given, HF(aq) and Ba(OH)2(aq)

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: H3PO4(aq)+Sr(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in…

A: We are given incomplete reactions we have to complete and balance the chemical reactions.

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

Q: The phase indicate by F is a critical fluid. Which of the following is the best definition of a…

A: According to guidelines we are supposed to answer one question only Supercritical fluid is formed at…

Q: What is the surface tension of water (i.e. the air--water interface) at a temperature of 25°C? (No,…

A: We need to give the value of surface tension of water (air-water interface) at a temp of 250C, to…

Q: Indicate the number of phases and components present in each of the following i) CaCO3 (s) = CaO (s)…

A: A phase is defined as a physically distinct but homogeneous part of a system that is separated from…

Q: The detachment of drops of a liquid from the mouth of a dropper refers to: Unique option. A)…

A: Surface tension and viscosity are properties of a liquid.

Q: During a phase transition (such as freezing) there is a change in temperature. O True False

Q: how many grams of table salt must be added to half a liter of water to raise its boiling point by 15…

Q: 8. Mercury thermometers have been phased out because of the toxicity of mercury vapor. A common…

A: Boiling point of isoamyl benzoate = 2620C Temperature in Kelvin = Temperature in oC +273.15…

Q: HCl(aq)+Ba(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

Q: e ph

A: The phase diagram is represented by a graph that a substance can exit in different physical states…

Q: Which of the following properties of an alcohol/water mixture is independent of temperature? (a)…

A: A multiple choice question based on temperature dependent properties, which is to be accomplished.

Q: Compute the vapor pressure of a solution (sweetening) prepared at 30 degrees celsius. A simple…

A: From given data, mass of solute (sugar)= 225 g mass of solvent (water )= 115 g Also, molar mass of…

Q: The liquid phase is represented by which of the following letters A) T B) x C) w D) y

A: x is the area that represent liquid phase.

Q: 3. (a) The Lattice enthalpy for the solid ionic compound AgBr is +900. kJ/mole. Write the chemical…

A: Enthalpy of lattice refers to the quantity of energy needed to convert 1 mole of ionic solid to…

Q: NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation.…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: H,SO, (ag) and KOH(og) Express your answer as a chemical equation. Identify all of the phases in…

A: H2SO4 is acid while KOH is base so this is a type of neutralisation reaction . Generally these all…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Write a balanced equation for the complete combustion of table sugar (sucrose, C12 H22O11). Use…

Q: 1. Write the chemical equation for the reaction of washing soda, Na2CO3, with HCl. 2. Write the…

A: A chemical equation refers to the symbolic representation of a given chemical reaction in the form…

Q: Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in…

A: 2 Al(s) +3 Cl2 (g) -------> 2 AlCl3 (s)

Q: HClO4(aq)+NaOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

A: The acid react with base to form salt and water , called as neutralization reaction.

Q: Write a balanced equation for the complete combustion of solid palmitic acid. Use H2 O(1) in the…

A: A balanced chemical is equation has equal numbers of atoms for each element involved in the reaction…

Q: liquids exhibit all these properties except? A. definite shape B. definite volume C. very limited…

A: solid liquid and gas are the three important states of matter

Q: Organic molecules change phases above 300°C. O True O False

A: Organic molecule chnges phases

Q: Fe(s)+S8(s)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your…

A: The given unbalanced equation is : Fe(s) + S8(s) → Fe2S3(s)

Q: Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

Q: Ca(s)+Br2(l)⟶CaBr2(s) Express your answer as a chemical equation. Identify all of the phases in…

A: The equation is already balanced, so the answer is:Ca(s)+Br2(l)⟶CaBr2(s) As the number of atoms are…

Q: ind the boiling point of a solution that is made from mixing 6.50 g of vanilin (MW= 153 g/mol) in…

A: Solution is made up of two components which are solute and solvent. Solute is present in the minor…

Q: Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation…

A: Given, Human cells obtain energy from a reaction called cellular respiration. The skeletal equation…

Q: Mg(s) + Br2 (1) → MgBr2 (s) Express your answer as a chemical equation. Identify all of the phases…

A: The given reaction is,

Q: Na(s)+H2O(l)→NaOH(aq)+H2(g)Na(s)+H2O(l)→NaOH(aq)+H2(g) Express your answer as a chemical equation.…

Concept explainers

Introduction to chemistry

Chemistry is a branch of science that deals with the analysis of material and the substances that comprise it. It also manages the properties of these substances and their reactions to form new substances. It is basically centered on particles and atoms that make up components and mixtures. These chemical species will in general connect using bonds.

Question

Question attached

H3PO4(aq) + KOH(aq) →
Express your answer as a chemical equation. Identify all of the phases in your answer.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

HCl(aq)+Ba(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in your answer.
H3PO4 (aq) + NaOH(aq) → Express your answer as a chemical equation. Identify all of the phases in your answer.
a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a chemical equation. Identify all of the phases in your answer. b)For C5H5NH+, write an equation that shows how the cation acts as an acid. Express your answer as a chemical equation. Identify all of the phases in your answer.
K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
N2H4(l)→NH3(g)+N2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. (Please type answer no wright by hend)
(aq) # Al(s) -+ Mn?+ (ag) + Af# (ag) Express your answer as a chemical equation. Identify all of the phases in your answer.
Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation for cellular respiration. C6H12O6(aq)+ O2(g)= CO2(g) +H2O(I) express your answer as a chemical equation. Identify all of the phases in your
K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s)K2SO4(aq)+BaCl2(aq)⟶KCl(aq)+BaSO4(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Keep the order of compounds as in the original equation.
Fe(s)+S(l)→Fe2S3(s)Fe(s)+S(l)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Balance each chemical equation.
A stopper is removed from a partially filled bottle containing liquid acetic acid. A vinegar-like odor is detected. How many phases are present in the bottle? a) 0 b) 1 c) 2 d) 3
Mercury ions (Hg2 2+) can be removed from solution by precipitation with Cl-. Suppose that a solution contains aqueous Hg2(NO3)2. Enter a complete ionic equation to show the reaction of aqueous Hg2(NO3)2 with aqueous sodium chloride to form solid Hg2Cl2 and aqueous sodium nitrate. (Express answer as a complete ionic equation. Identify all of the phases in the answer)
What two familiar phases an Elemental carbon has ?