Ammonium Nitrate, NH,NO3, powder is used as the ice pack for sports injury. When water in the sack is broken and mixed with this solid, the solid dissolves and the pack gets cold. a) Write a chemical reaction equation for this process. The molar heat energy(enthalpy) associated with this reaction is 25.4kJ/mol. Write it on the correct side of the reaction equation.

Ammonium Nitrate, NH,NO3, powder is used as the ice pack for sports injury. When water in the sack is broken and mixed with this solid, the solid dissolves and the pack gets cold. a) Write a chemical reaction equation for this process. The molar heat energy(enthalpy) associated with this reaction is 25.4kJ/mol. Write it on the correct side of the reaction equation.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 16Q: For the reaction HgO(s)Hg(l)+12O2(g),H=+90.7kJ: a.What quantity of heat is required to produce 1...

See similar textbooks

Similar questions

The enthalpy change for the reaction CH4(g)+2O2(g)CO2(g)+2H2O(l) is 891 kJ for the reaction as written. a. What quantity of heat is released for each mole of water formed? b. What quantity of heat is released for each mole of oxygen reacted?
9.41 Under what conditions does the enthalpy change equal the heat of a process?
How much heat is produced by combustion of 125 g of methanol under standard state conditions?
How much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.
Given the following reactions, N2H4(l)+O2(g)N2(g)+2H2O(g)H=534.2kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ Calculate the heat of formation of hydrazine.
What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.
Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
What mass of carbon monoxide must be burned to produce 175 kJ of heat under standard state conditions?
The following reactions can be used to prepare samples of metals. Determine the enthalpy change under standard state conditions for each. (a) 2Ag2O(s)4Ag(s)+O2(g) (b) SnO(s)+CO(g)Sn(s)+CO2(g) (c) Cr2O3(s)+3H2(g)2Cr(s)+3H2O(l) (d) 2Al(s)+Fe2O3(s)Al2O(s)+2Fe(s)
You discover that you cannot carry out a particular reaction for which you would like the enthalpy change. Does this mean that you will be unable to obtain this enthalpy change? Explain.
The reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.