please see the attached image Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride(NaCl) and liquid water (H,0). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 gof sodium hydroxide, calculate the percent yield of water.Round your answer to 2 significant figures.

he reaction will be as follows: NaOH + HCl -----------> NaCl +H2O. The actual yield of H2O =…

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H,O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water. Round your answer to 2 significant figures.

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H,O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water. Round your answer to 2 significant figures.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

You react nitrogen and hydrogen in a container to produce ammonia, NH3(g). The following figure depicts the contents of the container after the reaction is complete. a Write a balanced chemical equation for the reaction. b What is the limiting reactant? c How many molecules of the limiting reactant would you need to add to the container in order to have a complete reaction (convert all reactants to products)?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
Propane, C3H8, is the fuel of choice in a gas barbecue. When burning, the balanced equation is C3H8+5O23CO2+4H2O a What is the limiting reactant in cooking with a gas grill? b If the grill will not light and you know that you have an ample flow of propane to the burner, what is the limiting reactant? c When using a gas grill you can sometimes turn the gas up to the point at which the flame becomes yellow and smokey. In terms of the chemical reaction, what is happening?
The following reaction, depicted using molecular models, is used to make carbon tetrachloride, CCl4, a solvent and starting material for the manufacture of fluorocarbon refrigerants and aerosol propellants. Calculate the number of grams of carbon disulfide, CS2, needed for a laboratory-scale reaction with 62.7 g of chlorine, Cl2.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
3.105 Nitric acid is often sold and transported as a concentrated 16 M aqueous solution. How many gallons of such a solution would be needed to contain the roughly 2.1109 pounds of HNO3 produced annually in the United States?
The principal constituent of natural gas is methane, which burns in air according to the reaction CH4+2O2CO2+2H2O How many grams of O2 are needed to produce 3.50 g of CO2?
Hydrogen cyanide, HCN, can be made by a two-step process. First, ammonia is reacted with O2 to give nitric oxide, NO. 4NH3(g)+5O2(g)4NO(g)+6H2O(g) Then nitric oxide is reacted with methane, CH4. 2NO(g)+2CH4(g)2HCN(g)+2H2O(g)+H2(g) When 24.2 g of ammonia and 25.1 g of methane are used, how many grams of hydrogen cyanide can be produced?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?