Balance the following equations 1. H₂ + O₂ → H₂O 2. Na3PO4 +CaCl₂ → NaCl + Ca3(PO4)2 3. AS4 + 0₂ →→ AS406 4. Zn + AgNO3 → Zn(NO3)2 + Ag 5. Ba(NO3)2 + (NH4)₂SO4 6. K₂SO4 + CaS → CaSeO4 + K₂S 7. Al + 0₂ → Al203 8. H₂SO4 + Ga → H₂ + Ga₂(SO4)3 9. C3H8 + 0₂ CO,+H,O 10. CzH+0z→ CO,+H,O → BaSO4 + NH4NO3

Balance the following equations 1. H₂ + O₂ → H₂O 2. Na3PO4 +CaCl₂ → NaCl + Ca3(PO4)2 3. AS4 + 0₂ →→ AS406 4. Zn + AgNO3 → Zn(NO3)2 + Ag 5. Ba(NO3)2 + (NH4)₂SO4 6. K₂SO4 + CaS → CaSeO4 + K₂S 7. Al + 0₂ → Al203 8. H₂SO4 + Ga → H₂ + Ga₂(SO4)3 9. C3H8 + 0₂ CO,+H,O 10. CzH+0z→ CO,+H,O → BaSO4 + NH4NO3

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter3: Molecules, Moles, And Chemical Equations

Section: Chapter Questions

Problem 3.11PAE: 3.11 Balance these equations. (a) Al(s) + O2(g)( Al2O3(s) (b) N2(g) + H2(g) (NH3(g) (c) C6H6(l) +...

See similar textbooks

Similar questions

3.16 Balance the following equations. (a) reaction to produce "super-phosphate" fertilizer: Ca3(PO4)2(s)+H2SO4(aq)( Ca(H2PO4)2(aq)+CaSO4(s) (b) reaction to produce diborane, B2H6: NaBH4(s) + H2SO4(aq) ( B2H6(g) + H2(g) + Na2SO4(aq) (c) reaction to produce tungsten metal from tungsten(VI) oxide: WO3(s)+ H2(g) ( W(s) + H2O(l) (d) decomposition of ammonium dichromate: (NH4)2Cr2O7(s)(N2(g)+H2O(l)+Cr2O3(s)
3.93 Adipic acid is used in the production of nylon, so it is manufactured in large quantities. The most common method for the preparation of adipic acid is the reaction of cyclohexane with oxygen. Balance the skeleton equation shown be1ow.
4.79 Phosphoric add (H3PO4) is important in the production of both fertilizers and detergents. It is distributed commercially as a solution with a concentration of about 14.8 M. Approximately 2.1 X l09 gallons of this concentrated phosphoric acid solution is produced annually in the United States. Assuming that all of this H3PO4 is produced by the reaction below, what mass of the mineral fluoruapatite (Ca5(PO4)3F) would be required each year? Ca5( PO4)3F+5H2SO43H3PO4+5CaSO4+HF
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
4.85 In the cold vulcanization of rubber, disulfur dichloride (S2Cl2) is used as a source of sulfur atoms, and those sulfur atoms form “bridges,” or cross-links, between polymer chains. S2Cl2 can be produced by reacting molten sulfur (S8(l)) with chlorine (Cl2(g)). What is the maximum mass of S2Cl2 that can be produced by reacting 32.0 g of sulfur with 71.0 g of chlorine?
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
3.11 Balance these equations. (a) Al(s) + O2(g)( Al2O3(s) (b) N2(g) + H2(g) (NH3(g) (c) C6H6(l) + O2(g) ( H2O(l) + CO2(g)
A common method for analyzing for the nickel content of a sample is to use a precipitation reaction. Adding the organic compound dimethylgly-oxime to a solution containing Ni2+ ions precipitates a red solid. Derive the empirical formula for the red solid based on the following composition: Ni, 20.315%; C, 33.258%; H, 4.884%; 0, 22.151%; and N, 19.392%.
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
In a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.
4.59 Aluminum dissolves in HCI according to the equation written below, whereas copper does not react with HCl. 2Al( s )+6HCl( aq ) 2AlCl 3 ( aq )+ 3H 2 ( g ) A 35.0-g sample of a copper—aluminum alloy is dropped into 750 mL of 3.00 M HCl, and the reaction above proceeds as far as possible. If the ahoy contains 77.1% Al by mass, what mass of hydrogen gas would be produced?
3.92 Many chemical reactions take place in the catalytic con- verter of a car. In one of these reactions, nitric oxide (NO) reacts with ammonia (NH3) to give nitrogen (N2) and water. Write a balanced equation for this reaction.