Answered: Balance this unbalanced equation H2SO4…

Science

Chemistry

Balance this unbalanced equation H2SO4 + NaOH --> Na2SO4 + H2O

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter3: Mass Relations In Chemistry; Stoichiometry

Section: Chapter Questions

Problem 47QAP: Balance the following equations: (a) CaC2(s)+H2O(l)Ca(OH)2(s)+C2H2(g) (b)...

See similar textbooks

Related questions

Q: balance the imaginary equation as you would a chemical equation ___Z + ____ W2-->____ Z2W3

A: Firstly we balance W Z + 3W2 ---> 2Z2W3

Q: Na + H2O ---> NaOH + H2 Balance the equation above. a. Na + 2H2O ---> NaOH + 2H2 b. 2Na + H2O…

A: A balanced chemical reaction is the one in which number of atoms for individual elements present in…

Q: balance the following unbalanced chemical equation showing the combustion of methane use 1 for…

A: Given that, Combustion of methane i.e., _CH4 + _ O2 ---------> _CO2 + _H2O Write balanced…

Q: Can you pls show the matrix table

Q: Balance the following chemical equation (if necessary): Li2Se(s)+SO2(g)--> SSe2(g)+Li2O(s)

A: A balanced equation is the equation in which the number of atoms of each element are equal at both…

Q: Which chemical equation below is balanced? EQUATION A: C4H8(l) + 3O2(g) ----> 4CO2(g) + 4H2O(g)…

A: Which chemical equation below is balanced?

Q: Given the unbalanced equation: C6H6 + O2 ---> H2O + CO2. When properly balanced, the coefficient…

Q: Balance the equation below ______ H3PO4 + ______ NaOH ? ______ Na3PO4 + ______ H2O

A: The equation can be balanced by the simplest of all methods that is hit and trial method:

Q: Balance the equation equalizing both atoms of the equation N2 + Cl2 --->

A: Balanced chemical equation can be defined as the equation in which number of atoms of every element…

Q: Balance the following equation and list the coefficients in order from left to right. SF4 + H20 → _…

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: Balance the following chemical equation (if necessary): ZnS(s) + AlP(s) ---> Al2S3(s) + Zn3P2(s)

Q: Which of the following reactions has the largest positive value of AS per mole of Cl2? A. H2 8) +…

A: ∆S is proportional to the change in randomness of the system.

Q: BALANCING EQUATION 3. _ MgF2 + _ Li2CO3 --> _ MgCO3 + _ LiF 4. _ Pb(OH)2 + _ HCl --> _ H2O + _ PbCl2…

A: Balanced equation means number of each atom in both side are present in equal number. Then,

Q: BALANCING EQUATION 1. _ NH3 + _ H2SO4 --> __ (NH4)2SO4 2. _ Na3PO4 + _ KOH --> _ NaOH + _ K3PO4 3. _…

A: NH3 + H2SO4 --> (NH4)2SO4 balanced equation is: 2 NH3 + H2SO4→(NH4)2SO4

Q: Balance the following equations: (d) AgNO3 + Ni ----> Ni(NO3)2 + Ag (e) Bi2S3 + HCl ----> BiCl3 +…

A: A balanced chemical equation is an appropriate representation of the chemical reaction happening…

Q: Balance each equation. (a) H2 + I2 -------> HI (b) Al + O2 -------> Al2O3 (c) Na + Cl2 ------>…

A: a) H2 + I2 → HI the balanced equation is

Q: Balance the following equation Ca(OH)2 + H3 04 ------> H20 + Ca3 (PO4)2

A: According to the law of conservation of mass, the quantity of each element does not change in a…

Q: Balance the reaction as follows TeO32- + N2O4 + H2O -> Te + NO3- + H+

Q: elow is a balanced equation of a combustion reaction: C;Hg + 502 - 3CO2 + 4H20 1 mol H,0 4 mol C,H,…

A: Mole ratio is the ratio is the ratio between the amounts in moles of any two compounds involved in a…

Q: Wnich of the following statements about chemical equations is (are) /true? 1type='a'> When…

A: The question is based on chemical equation. we have to identify the correct statements out of the…

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: Law of conservation of matter says that matter can neither be created nor be destroyed. A chemical…

Q: What is the sum of ALL coefficients when the following equation is balanced, using the smallest…

A: To find the sum of all the coefficient in the following equation , first we have to balance the…

Q: Balancing chemical equations 1. Al + F2 --> AlF3 2. Ca + H2O -->Ca(OH)2 + H2 3. CaCl2 + Na3PO4…

A: Inorder to balance a chemical reaction, we have to make the number of atoms on both sides equal.…

Q: What coefficients balance the following chemical equation? ___C2H2 + ___O2 ---> ___CO2 + ___H2O

A: The given reaction is, C2H2 + O2 ---> CO2 + H2O

Q: Fe• Oz-> Fe O3

Q: Balance the following equation C4H4BrNO2 + C4H6O2S ----> C4h7BrO3S + C4H5NO2

A: The reaction given is C4H4BrNO2 + C4H6O2S --------> C4H7BrSO3 + C4H5NO2

Q: Balance the reaction: ___ C6H14 (l) + ___ O2 (g) → ___ CO2 (g) + ___ H2O (g) Then give the…

A: A balanced chemical equation states that the number of elements in the reactant side is equal to the…

Q: Consider this unbalanced equation for the combustion of octane in gasoline: _C2Ho+ O2 --> ____CO2 +…

Q: 16. After balancing the following chemical equation, what is the balancing coefficients of KCIO, and…

A: Dear student this question is related to general chemistry.

Q: Balance the following equation using the smallest whole number coefficients: H3PO4 + HCl ==> PCl5 +…

A: H3PO4 + HCl ==> PCl5 + H2O When phosphoric acid is treated with the hydrochloric acid then it…

Q: Balance the equation si2h3(s)+o(g)-->sio2(g)+h2o(g)

A: Recall the given reaction, Si2H3 s + O2 g → SiO2 g + H2O gWe…

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: The correct answer is given below

Q: Balance the following reaction ____B2O3 + ____H2O --> ____H3BO3

A: We need to balance the equation so that the law of conservation of the mass is obeyed. We can…

Q: Balance this chemical equation: Ca(C2H3O2)2 + Na2CO3 ---> CaCO3 + NaC2H3O2

A: Chemical equation is the equation in which reactants are on left hand side and products are on right…

Q: Balance these chemical equations (Use the lowest possible whole number coefficients, and enter 1 if…

A: We have to predict the balance chemical reaction

Q: Balance the following chemical reaction. C3H8O + O2 -->…

A: To balance the chemical equation, we will balance each type of atoms on both sides of the equation…

Q: Balance the following reaction: H2O + CO2 = C12H22O11 + O2

A: The reaction given is, => H2O + CO2 → C12H22O11 + O2

Q: Balancing equations Rewrite the following equations as balanced equ. 1. K+ H,O- KOH + + H2 2. HCI +…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3 sub-parts. Please resubmit the…

Q: Balance each equation by inserting coefficients as needed. P4O10+H2O-->H3PO4

A: Balance Equation: The reaction in which Number of atom of each element in reactant side is equal…

Q: Balance each of the following skeletal equations. Li(s) + H2O(l) ------> LiOH(aq) + H2(g)

A: Balance each of the following skeletal equations. Li(s) + H2O(l) ------> LiOH(aq) + H2(g)

Q: Balance the following equation using the smallest whole number coefficients: C3H8O + O2 --> CO2…

A: A chemical equation is the symbolic representation of a chemical reaction in the form of symbols and…

Q: After balancing the following chemical equation, what is the balancing coefficients of KClO3 and O2…

A: In Balanced chemical equation number of atoms of each species are equal on both reactant and…

Q: NH3+02----->NO+H2O Balance the Equation

Q: balance equation H2S + O2-----> SO2 +H2O

Q: The equation, Fe:Os + HNOS ---> Fe(NOs)s + H2O is balanced if the coefficients are:

A: ANSWER

Q: Balance the equation equalizing both atoms of the equation Mg + H2 SO4--->

Q: balance the chemical equation for each reaction C02 + H20 -----> C6H1206 + 02

A: A balanced chemical equation is an equation in which the atoms or charge on the reactant side are…

Q: NH3(g) + O2(g)→_ N2(g) + H,0(g) - - When the reaction above is completely balanced, the coefficient…

A: The reaction given is, => NH3 (g) + O2 (g) → N2 (g) + H2O (g)

Question

Balance this unbalanced equation

H₂SO₄ + NaOH --> Na₂SO₄ + H₂O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Balance the following equations: (a) CaC2(s)+H2O(l)Ca(OH)2(s)+C2H2(g) (b) (NH4)2Cr2O7(s)Cr2O3(s)+N2(g)+H2O(f) (c) CH3NH2(g)+O2(g)CO2(g)+N2(g)+H2O(g)
Ten mL of concentrated H3PO4 (91.7% by mass, d=1.69g/mL) was accidentally poured into a beaker containing 20.0 g of NaOH. Not all the NaOH was consumed. How many grams of NaOH were left unreacted? The equation for the reaction is H3PO4(aq)+3OH(aq)3H2O+PO43(aq)
It sodium peroxide is added to water, elemental oxygen gas is generated: :math>Na2O2(s)+H2O(l)NaOH(aq)+O2(g) ppose 3.25 g of sodium peroxide is added to a large excess of water. What mass of oxygen gas will be produced?
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
Gold metal will dissolve only in aqua regia, a mixture of concentrated hydrochloric acid and concentrated nitric acid in a 3:1 volume ratio. The products of the reaction between gold and the concentrated acids are AuCl4-(aq), NO(g), and H2O. The equation for this reaction where HNO3 and HCl are strong acids is Au(s)+4Cl(aq)+4H+(aq)+NO3(aq)AuCl4(aq)+NO(g)+2H2O(a) What stoichiometric ratio of hydrochloric acid to nitric acid should be used? (b) What volumes of 12 M HCl and 16 M are HNO3 required to furnish the Cl- and NO3- ions to react with 25.0 g of gold?
Many over-the-counter antacid tablets are now formulated using calcium carbonate as die active ingredient, which enables such tablets to also be used as dietary calcium supplements. As an antacid for gastric hyperacidity, calcium carbonate reacts by combining with hydrochloric acid found in the stomach, producing a solution of calcium chloride, converting die stomach acid to water, and releasing carbon dioxide gas (which the person suffering from stomach problems may feel as a burp). Write die balanced chemical equation for this process.
On Easter Sunday, April 3, 1983, nitric acid spilled from a tank car near downtown Denver, Colorado. The spill was neutralized with sodium carbonate: 2HNO3(aq)+Na2CO3(aq)2NaNO3(aq)+H2O(l)+CO2(g) a. Calculate H for this reaction. Approximately 2.0 104 gal nitric acid was spilled. Assume that the acid was an aqueous solution containing 70.0% HNO3 by mass with a density of 1.42 glcm3. What mass of sodium carbonate was required for complete neutralization of the spill, and what quantity of heat was evolved? (Hf for NaNO3(aq) = 467 kJ/mol) b. According to The Denver Post for April 4, 1983, authorities feared that dangerous air pollution might occur during the neutralization. Considering the magnitude of H, what was their major concern?
A chemist prepared a compound that she thought had the formula FeI3. When the compound was analyzed, it contained 18.0% Fe and 82.0% I. Calculate the mass percentage composition expected for FeI3 and compare the result with that found in the analysis. Is this the correct formula of the compound?
When yeast is added to a solution of glucose or fructose, the sugars are said to undergo fermentation, and ethyl alcohol is produced. :math>C6H12O6(aq)2C2H5OH(aq)+2CO2(g) is is the reaction by which wines arc produced from grape juice. Calculate the mass of ethyl alcohol, C2H5OH. Produced when 5.25 g of glucose, C6H12O6, undergoes this reaction.
3.93 Adipic acid is used in the production of nylon, so it is manufactured in large quantities. The most common method for the preparation of adipic acid is the reaction of cyclohexane with oxygen. Balance the skeleton equation shown be1ow.
When steel wool (iron) is heated in pure oxygen gas, the steel wool bursts into flame and a fine powder consisting of a mixture of iron oxides ( FeO and Fe2O3 ) forms. Write separate unbalanced equations for the reaction of iron with oxygen to give each of these products.
Consider reacting copper(II) sulfate with iron. Two possible reactions can occur, as represented by the following equations. copper(II)sulfate(aq)+iron(s)copper(s)+iron(II)sulfate(aq)copper(II)sulfate(aq)+iron(s)copper(s)+iron(III)sulfate(aq) You place 87.7 mL of a 0.500-M solution of copper(II) sulfate in a beaker. You then add 2.00 g of iron filings tu the copper(II) sulfate solution. After one of the above reactions occurs, you isolate 2.27 g of copper. Which equation above describes the reaction that occurred? Support your answer.