Barium oxide reacts with sulfuric acid as follows:Bao(s) + H2SO4(I) → Baso4(s) + H,0(1)Calculate A,H° for this reaction. The following thermochemical equations can be used:so;(g) + H20(1)→ H2SO4(1)A,Hô = -78.2 k) mol-1A,Hô = -213 kJmol-1Ba0(s) + SO3(g) → BasO4(s)H2S04(1) → So;(g) + H20(1)kJBa0(s) + SO3(g) → Baso4(s)4,48 .kJBa0(s) + H2SO4(1) → Baso4(s) + H20(1)%3DkJ

Answered: Image /qna-images/answer/19754049-d424-46ae-8004-d24f2ab151b7.jpg

Barium oxide reacts with sulfuric acid as follows: Bao(s) + H2SO4(1) → Baso4(s) + H20(1) Calculate A,H for this reaction. The following thermochemical equations can be used: so;(9) + H20(1)→ H2SO4(1) A,H8 - -78.2 k) mol-1 Bao(s) + SO3(g) → Baso4(s) A,Hô = -213 kJmol-1 H2SO4(1) → SO3(9) + H2O(I) Bao(s) + SO3(9) → BasO4(s) kJ Bao(s) + H2SO4(1) → BasO4(s) + H2O(1) kJ

Barium oxide reacts with sulfuric acid as follows: Bao(s) + H2SO4(1) → Baso4(s) + H20(1) Calculate A,H for this reaction. The following thermochemical equations can be used: so;(9) + H20(1)→ H2SO4(1) A,H8 - -78.2 k) mol-1 Bao(s) + SO3(g) → Baso4(s) A,Hô = -213 kJmol-1 H2SO4(1) → SO3(9) + H2O(I) Bao(s) + SO3(9) → BasO4(s) kJ Bao(s) + H2SO4(1) → BasO4(s) + H2O(1) kJ

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter8: Thermochemistry

Section: Chapter Questions

Problem 49QAP: Chlorine trifluoride is a toxic, intensely reactive gas. It was used in World War II to make...

See similar textbooks

Similar questions

Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
9.91 You want to heat the air in your house with natural gas (CH4). Assume your house has 275 m2(ahout 2800 ft2) of floor area and that the ceilings are 2.50 m from the floors. The air in the house has a molar heat capacity of 29.1 J mol-l K-l. (The number of moles of air in the house may he found by assuming that the average molar mass of air is 28.9 g/mol and that the density of air at these temperatures is 1.22 g/L.) What mass of methane do you have to burn to heat the air from 15.0 to 22.0°C?
A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
Benzoic acid, C6H5COOH, is a common standard used in bomb calorimeters, which maintain a constant volume. If 1.20 g of benzoic acid gives off 31, 723 J of energy when burned in the presence of excess oxygen and in a water bath having a temperature of 24.6 C, calculate q, w, H, and U for the reaction.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.