Calcium nitrate and ammonium fluoride react to form calcium fluoride, dinitrogen monoxide, and water vapor. What mass of each substance is present after 10.71g of calcium nitrate and 11.16 g of ammonium fluoride react completely? g calcium nitrate g ammonium fluoride g calcium fluoride g dinitrogen monoxide g water

Calcium nitrate and ammonium fluoride react to form calcium fluoride, dinitrogen monoxide, and water vapor. What mass of each substance is present after 10.71g of calcium nitrate and 11.16 g of ammonium fluoride react completely? g calcium nitrate g ammonium fluoride g calcium fluoride g dinitrogen monoxide g water

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section: Chapter Questions

Problem 99A: Fertilizer The compound calcium cyanamide (CaNCN) is used as a nitrogen source for crops. To obtain...

See similar textbooks

Similar questions

When solid phosphorus (P4) reacts with oxygen gas, diphosphorus pentoxide is formed. Initially 2.87 mol of phosphorus and 3.86 mol of oxygen are combined. (Assume 100% yield.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) How many moles of excess reactant remain after the reaction is complete?
Solid copper can be produced by passing gaseous ammonia over solid copper (II) oxide al high temperatures. mg src=Images/HTML_99425-9-66QAP_image001.jpg alt="" align="top"/> e other products of the reaction are nitrogen gas and water Vapor. The balanced equation for this reaction is: :math>2NH3(g)+3CuO(s)N2(g)+3Cu(s)+3H2O(g) at is the theoretical yield of solid copper that should form when 18.1 g of NH3, is reacted with 90.4 g of CuO? If only 45.3 g of copper is actually collected, what is the percent yield? mg src=Images/HTML_99425-9-66QAP_image002.jpg alt="" align="top"/>
One way to remove nitrogen oxide (NO) from smoke-stack emissions is to react it with ammonia. 4NH3(g)+6NO(g)5N2(g)+6H2O(l) Calculate (a) the mass of water produced from 0.839 mol of ammonia. (b) the mass of NO required to react with 3.402 mol of ammonia. (c) the mass of ammonia required to produce 12.0 g of nitrogen gas. (d) the mass of ammonia required to react with 115 g of NO.
Fertilizer The compound calcium cyanamide (CaNCN) is used as a nitrogen source for crops. To obtain this compound, calcium carbide is reacted with nitrogen at high temperatures. CaC2(s)+N2(g)CaNCN(s)+C(s) What mass of CaNCN can be produced if 7.50 mol of CaC2 reacts With 5.00 molOf N2 ?
itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
4.17 Phosgene is a highly toxic gas that has been used as a chemical weapon at times in the past. It is now used in the manufacture of polycarbonates, which are used to make phone cases and plastic eyeglass lenses. Phosgene is produced by the reaction, CO+Cl2COCl2 . Given an excess of carbon monoxide, what mass of chlorine gas must be reacted to form 4.5 g of phosgene?
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
For each of the following balanced chemical equations, calculate how many moles of product(s) would be produced if 0.500 mole of the first reactant were lo react completely. msp;CO2(g)+4H2(g)CH4(g)+2H2O(l) msp;BaCl2(aq)+2AgNO3(aq)2AgCl(s)+Ba(NO3)2(aq) msp;C3H8(g)+5O2(g)4H2O(l)+3CO2(g) msp;3H2SO4(aq)+2Fe(s)Fe2(SO4)3(aq)+3H2(g)
Thionyl chloride, SOCl2, is used as a very powerful drying agent in many synthetic chemistry experiments in which the presence of even small amounts of water would be detrimental. The unbalanced chemical equation is :math>SOCl2(l)+H2O(l)SO2(g)+HCl(g) lculate the mass of water consumed by complete reaction of 35.0 g of SOCl2.
When small quantities of elemental hydrogen gas are needed for laboratory work, the hydrogen is often generated by chemical reaction of a metal with acid. For example, tine reacts with hydrochloric acid, releasing gaseous elemental hydrogen: :math>Zn(s)+2HCI(aq)ZnCl2(aq)+H2(g) at mass of hydrogen gas is produced when 2.50 g of zinc is reacted with excess aqueous hydrochloride acid?