Calculate AG for the reaction given below if the partial pressure of NO₂ is 0.220 atm and the partial pressure of N₂O4 is 0.428 atm.2NO2(g) N2O4(8)AG 298 of this reaction is -5.40 kJ per mole of N₂O. T = 298K, R = 8.314 J.mol-¹.K-¹Note: Round you answer to 2 decimal places.AG=kJ mol-1Where does the system stand relative to equilibrium?The system is at equilibrium, so that the reaction will not move.O The equilibrium shifts to products.O The equilibrium shifts to reactants.

This is simple problem of chemical equilibrium where we have to determine if the reaction is in…

Calculate AG for the reaction given below if the partial pressure of NO₂ is 0.220 atm and the partial pressure of N₂O4 is 0.428 atm. 2NO2(g) = N₂O4(8) AG 298 of this reaction is -5.40 kJ per mole of N₂O. T = 298K, R = 8.314 J.mol-¹.K-1 Note: Round you answer to 2 decimal places. AG = i kJ mol-1 Where does the system stand relative to equilibrium? O The system is at equilibrium, so that the reaction will not move. O The equilibrium shifts to products. O The equilibrium shifts to reactants.

Calculate AG for the reaction given below if the partial pressure of NO₂ is 0.220 atm and the partial pressure of N₂O4 is 0.428 atm. 2NO2(g) = N₂O4(8) AG 298 of this reaction is -5.40 kJ per mole of N₂O. T = 298K, R = 8.314 J.mol-¹.K-1 Note: Round you answer to 2 decimal places. AG = i kJ mol-1 Where does the system stand relative to equilibrium? O The system is at equilibrium, so that the reaction will not move. O The equilibrium shifts to products. O The equilibrium shifts to reactants.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter21: Chemistry Of The Nonmetals

Section: Chapter Questions

Problem 53QAP: Consider the reaction 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (a) Calculate ?H° for this reaction. Is it...

See similar textbooks

Similar questions

At 298 K, G = 70.52 kJ for the reaction 2NO(g) + O2(g) 2NO2(g) (a) Calculate _G at the same temperature when PNO = 1.0 104 atm, PO2=2.0103 atm, and PNO2=0.30 atm. (b) Under the conditions in part a, in which direction is the reaction spontaneous?
Consider the reaction 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (a) Calculate ?H° for this reaction. Is it exothermic or endothermic? (b) Would you expect ?S° to be positive or negative? Calculate ?S°. (c) Is the reaction spontaneous at 25°C and 1 atm? (d) At what temperature, if any, is the reaction at equilibrium at 1 atm pressure?
One of the reactions that destroys ozone in the upper atmosphere is NO(g)+O3(g)NO2(g)+O2(g) Using data from Appendix 4, calculate G and K (at 298 K) for this reaction.
For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).
Consider the reaction N2O(g)+NO2(g)3NO(g)K=4.41019 (a) Calculate G for the reaction at 25C. (b) Calculate G f for N2O at 25C.
Calculate H and G for the following reactions at 25C, using thermodynamic data from Appendix C; interpret the signs of H and G. a Al2O3(s)+2Fe(s)Fe2O3(s)+2Al(s) b COCl2(g)+H2O(l)CO2(g)+2HCl(g)
For the reaction C2H2(g)+4F2(g)2CF4(g)+H2(g) S is equal to 358 J/K. Use this value and data from Appendix 4 to calculate the value of S for CF4(g).
The equilibrium constant for a reaction is 31015 (a) Without carrying out any calculation, discuss whether ?G° for the reaction is positive or negative. (b) Calculate ?G° for this reaction.
The equilibrium constant for a certain reaction increases by a factor of 6.67 when the temperature is increased from 300.0 K to 350.0 K. Calculate the standard change in enthalpy (H) for this reaction (assuming H is temperature-independent).
Methane can be produced from CO and H2.The process might be done in two steps, as shown below, with each step carried out in a separate reaction vessel within the production plant. Reaction 1 CO(g)+2H2(g)CH3OH(l) S = -532 J/K Reaction 2 CH3OH(l)CH4(g)+12O2(g) S= +162 J/K NOTE: You should be able to work this problem without using any additional tabulated data. (a) Calculate H for reaction 1. (b) Calculate Gf for CO(g). (c) Calculate S° for O2(g). (d) At what temperatures is reaction 1 spontaneous? (e) Suggest a reason why these two steps would need to be carried out separately. Substance Hf (kJ mol-1) Gf (kJ mol-1) S (J mol-1 K-1) CO(s) -110.5 197.674 CH3OH( l ) -238.7 -166.4 126.8 CH4(g) -74.8 186.2
Consider the decomposition of red mercury(II) oxide under standard state conditions.. 2HgO(s,red)2Hg(l)+O2(g) (a) Is the decomposition spontaneous under standard state conditions? (b) Above what temperature does the reaction become spontaneous?
Describe what you would look for in a reaction involving gases in order to predict the sign of S. Explain.