Calculate the enthalpy of the reaction:2C2H2 (g) + 5O2 (g) 2H2O(g) + 4CO2 (g) Use the enthalpy of formation data in the table to calculate the enthalpy of the reactions below:H2O1) H2O(g)OHH3PO4 (aq) PO4CH4 (2)-3H2CO3 (aq) CO2 (aq)CO2 ( CO(g)C2H6 (g) C2H4 (g) C,H2 (g)Substance(aq)(aq)AH° (kJ/mole) -285.83 -241.82 -229.90-1277.40-1277.40-699.65-413.82 -393.51 -110.53 -74.81-84.68+52.26 +226.73

The standard enthalpy of reaction for a chemical reaction is the difference between total reactant…

Answered: Calculate the enthalpy of the reaction:…

Science

Chemistry

Calculate the enthalpy of the reaction: 2C2H2 (g) + 5O2 (g) 2H2O(g) + 4CO2 (g)

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 77E: Give the definition of the standard enthalpy of formation for a substance. Write separate reactions...

See similar textbooks

Related questions

Q: A scientist measures the standard enthalpy change for the following reaction to be -171.6 kJ :…

A: Given;

Q: 2. For which of the following is the enthalpy of the reaction the same as the enthalpy of formation?…

A: The standard enthalpy of formation is the reaction enthalpy when the formation of one mole of a…

Q: Calculate the enthalpy of the reaction 2NO(g) + O2(g)→2NO2(g) given the following reactions and…

A: According to Hess law if a chemical equation can be written as sum of two or more chemical…

Q: Use standard enthalpies of formation to calculate ΔH∘rxn for the following reaction:…

A: ∆H°rxn = ∑np ∆H°f (products) - ∑np ∆H°f (reactants)

Q: Using the provided table, determine the enthalpy for the reaction: C₃H₈(g) + 5O₂(g) → 3CO₂(g) +…

A: Given information, ΔH0 C3H8 = −108.4 kJ/mol ΔH0 O2 = 0 kJ/mol ΔH0 CO2 = −393.5 kJ/mol ΔH0…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Given reaction, 2CO(g) + O2(g) ----->2CO2(g) we know that, Enthalpy change ie; ∆H° = ∆H° of…

Q: Use standard enthalpies of formation to determine ΔHorxn for: 2C2H2(g) + 5O2(g) → 4CO2(g) + 2H2O(l)…

A: Standard enthalpy of formation ΔH for C2H2, O2, CO2 and H2O are given.

Q: A scientist measures the standard enthalpy change for the following reaction to be 14.5 kJ: 2CO2(g)…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: A scientist measures the standard enthalpy change for the following reaction to be -132.2 kJ :…

A: Given chemical reaction is 4HCl(g) + O2(g) ---> 2H2O(g) + 2 Cl2(g) Standard Enthalpy change of…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1142.2 kJ:…

Q: The Martian In the motion picture The Martian, a stranded astronaut uses hydrazine, N,H4, to produce…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: The enthalpy of a reaction is the amount of heat released or absorbed during the course of a…

Q: A scientist measures the standard enthalpy change for the following reaction to be -111.2 kJ :…

Q: Given the following reactions: N2(g) + 2 O2(g) → 2 NO2(g) ΔH = 66.36 kJ…

A: The enthalpy of the reaction is considered as the state function that is it depends only on the…

Q: Given the thermochemical equations below, calculate the standard enthalpy change for the following…

A: EXPLANATION: Standard enthalpy change is defined as the change in enthalpy of compound when there is…

Q: If 20.0 g of CH4 reacts with excess oxygen, what is the change in enthalpy for the reaction?…

A: The reaction considered is the combustion of methane and it is exothermic.

Q: Calculate the change of enthalpy for the reaction CH4 (g) + NH3 (g) - -> HCN (g) +3H2 (g) from the…

A: Given reactions N2 (g) + 3H2(g) -----------> 2NH3(g) ∆H=-91.8kJ/mol. _____(1) C(s,graphite)…

Q: Calculate the change in enthalpy: 2H2O2(l) → 2H2O(l) + O2(g)

A: Given:Chemical reaction:H2O2(l) → 2H2O(l) + O2(g)

Q: Image attached

A: Consider the desired equation is as follows: 2NO2g→N2O4g Consider the given reactions as follows:…

Q: The standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because…

A: (a).

Q: For the chemical reaction H2 (g) + F2 (g) →2 HF (g) AH° = -79.2 kJ/mol. What is the enthalpy for the…

A: The enthalpy of a reaction is dependant on the stoichiometric coefficients of reactants and products…

Q: calculate the standard enthalpy change for the following reaction.

Q: For the chemical reaction H2 (g) + F2 (g) → 2 HF (g) AH° = -79.2 kJ/mol. What is the enthalpy for…

A: Heat of formation, also called standard heat of formation, enthalpy of formation, or standard…

Q: A scientist measures the standard enthalpy change for the following reaction to be -819.0 kJ :CH4(g)…

A: The given reaction is, Standard enthalpy of formation of CH4(g), O2(g) and H2O(g) is given below,

Q: Use standard enthalpies of formation to calculate the standard enthalpy of reaction for the…

A: Given 2H2S (g) + 3O2 (g) →2H2O (l) + 2SO2 (g)

Q: Methanol is known to be the simplest alcohol, and is used as an antifreeze agent, a solvent, a fuel…

A: From standard data

Q: A scientist measures the standard enthalpy change for the following reaction to be 80.1 kJ:…

A: Solution- ∆Hreaction=2∆HofFe2O4+∆Hof(H2O)- 3∆HofFe2O4+∆Hof(H2)∆Hreaction=2∆HofFe2O4+(-241.818kJ)-…

Q: What is the standard enthalpy change for the reaction:3NO2(g) + H2 O(l) ⟶ 2HNO3(aq) + NO(g)…

A: The standard enthalpy of formation is called the heat of formation or the standard heat of…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Given; Note: for standard enthalpy of formation, values are taken from the standard books.

Q: what are the two ways by which an enthalpy of a reaction can be determined.

A: The change in the enthalpy of a chemical reaction is known as the enthalpy of a reaction ∆H. It is a…

Q: The complete combustion of propane in oxygen is represented by the equation C3H8(g) + 5O2(g) →…

A: To determine enthalpy of reaction , enthalpy of formation is required. Enthalpy of formation is…

Q: For which one of the following is the enthalpy of the reaction the same as the enthalpy of…

A: Answer:- The enthalpy change during a chemical reaction in which one mole of product ifs formed…

Q: What is enthalpy, and what is ΔH for a reaction, and what does it mean if ΔH is positive or…

A: Enthalpy can be defined as the total amount of heat of the system which can be represented by a…

Q: Calculate the standard enthalpy of reaction for the reaction 2Na + 2H2O——> 2NaOH+ H2. Standard…

A: The reaction is given below.

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction?…

A: Enthalpy change of a reaction is calculated by subtracting the sum of enthalpies of formation of…

Q: For the chemical reaction Ca (s) + ½ O₂ (g) → CaO (s) ∆H° = -635 kJ/mol. What is the enthalpy for…

A: To calculate enthalpy for reaction:

Q: 2. Determine the standard enthalpy of formation for the following reaction! CH3CI + C12 →CH2C12 +…

Q: Calculate the Enthalpy of Reaction 2CH3OH(I) + 302(g) → 2CO2(g) + 4H2O(1I)

A: ∆H°f (CO2(g) ) = -393kj/mole ∆H°f (H2O(l)) = -286kj/mole ∆H°f (CH3OH(l)) = -238.7kj/mole

Q: A scientist measures the standard enthalpy change for the following reaction to be 209.4 kJ : CHĄ(g)…

A: Given chemical equation: CH4g+H2Og→3H2g+COg

Q: 2CH3OH +3O2-> 2CO2 +4H20 A. What is the standard enthalpy of reaction when the equation is…

A: We have given the reaction as follow 2CH3OH + 3O2 → 2CO2(g) + 4H2O(l) And asked A. What is the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -104.0 kJ : CO(g)…

A: The given chemical reaction is as follows: CO(g) + Cl2(g) → COCl2(g) ∆rH°=-104 kJ The…

Q: Use standard enthalpies of formation to calculate ΔH∘rxn for the following reaction:…

A: Given,

Q: Use standard enthalpies of formation to calculate ΔHrxn∘ for the following reaction:…

A: The reaction given is N2O4 (g) + 4 H2 (g) → N2 (g) + 4 H2O (g) The standard enthalpies of formation…

Q: to calculate the true enthalpies of these reactions by the Hess’ law, as: ΔH°(rxn) = Σ[ν ×…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Hess,law:The enthalpy change of a reaction is calculated by subtraction of sum of standard enthalpy…

Q: enthalpy change

Q: The first step in the production of nitric acid from ammonia involves the oxidation of NH3. 4…

Q: A scientist measures the standard enthalpy change for the following reaction to be -876.3 kJ:…

A: Solution:- Balanced chemical reaction:- 2NH3(g) + 3N2O(g) → 4N2(g) + 3H2O(g) ∆Hf = -876.3 kJ…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Enthalpy can be defined as the randomness or the disorderliness of the system. It is the unuseful…

Question

Calculate the enthalpy of the reaction:

2C₂H_{2 (g)} + 5O_{2 (g)} 2H₂O_(g) + 4CO_{2 (g)}

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Calcium oxide, CaO, is prepared by heating calcium carbonate (from limestone and seashells). CaCO3(s)CaO(s)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation. The Hf of CaO(s) is 635 kJ/mol. Other values are given in Table 6.2.
Hydrogen sulfide, H2S, is a foul-smelling gas. It burns to form sulfur dioxide. 2H2S(g)+3O2(g)2SO2(g)+2H2O(g);H=1036kJ Calculate the enthalpy change to burn 27.4 g of hydrogen sulfide.
A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
The combustion of ethane, C2H6, has an enthalpy change of 2857.3 kJ for the reaction as written below. Calculate H for the combustion of 15.0 g of C2H6. 2 C2H6(g) + 7 O2(g) 4 CO2(g) + 6 H2O(g) rH=2857.3kJ/mol-rxn
In earlier times, ethyl ether was commonly used as an anesthetic. It is, however, highly flammable. When five milliliters of ethyl ether, C4H10O(l)(d=0.714g/mL), are burned in a bomb calorimeter, the temperature rises from 23.5C to 39.7C. The calorimeter contains 1.200 kg of water and has a heat capacity of 5.32 kJ/C. (a) What is qH2o? (b) What is qcal? (c) What is q for the combustion of 5.00 mL of ethyl ether? (d) What is q for the combustion of one mole of ethyl ether?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Hydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJ
Hydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJ
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
What is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?

SEE MORE QUESTIONS

Recommended textbooks for you

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781337399074

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry