Calculate the number of ATPS generated by the complete metabolic oxidation of tripalmitin (tripalmitoylglycerol). Hydrolysis of the tri- acylglycerol occurs at the cell surface. Consider the energy yield from catabolism of glycerol, as well as from the fatty acids. Calculate the ATP yield per carbon atom oxidized, and compare it with the energy yield from glucose.
Q: Describe the fate of glycerol generated from triacylglycerolhydrolysis in adipocytes.
A: When triacylglycerols is mobilized from the fat tissue, its hydrolysis to free fatty acids and…
Q: Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods.…
A: Myristoleic acid would undergo beta-oxidation for its catabolism.
Q: Calculate the energy savings (in ATP molecules per glucose monomer) obtained by phosphorolyzing…
A: Introduction The assault of inorganic phosphate on a substance is known as phosphorolysis. The…
Q: Directions: Complete the "energy balance table" below with the products of glycolysis for each…
A: Glycolysis is the first pathway in cellular respiration in which glucose is oxidized to produce two…
Q: Account for the fractions of ATP generated by fatty acid breakdown and the citric acid based on…
A: Lipid metabolism begins in the intestine where ingested triglycerides are broken down into smaller…
Q: When fructose present in either liver or muscle undergoes glycolysis to form pyruvate, how many…
A: Glycolysis is a process in which the molecule of glucose breakdown into pyruvate and release energy…
Q: Calculate the amount of ATP generated from the complete oxidation of a triglyceride with a X, Y, and…
A: Cellular respiration is a series of metabolic reactions and processes that occur within organisms'…
Q: Suggest a name for the enzyme that catalyzes each of the following reactions. a. transfer of a…
A: Cellular respiration or cell respiration happens in the living cells. In the cellular respiration…
Q: Calculate for the following based on complete oxidation of 5 molecules of trisaccharide containing 2…
A: Complete Oxidation of carbohydrates takes place via 4 stages. They are ; 1. Glycolysis : here a…
Q: Consider a 17:0 fatty acid in a mammalian cell where propionyl CoA is completely oxidized. For each…
A: β-oxidation of fatty acid occurs in mitochondria. Before β- oxidation, activation of fatty…
Q: What will be the approximate energy yield through aerobic metabolism, of a 16-carbon fatty acid?…
A: β-oxidation of fatty acid occurs in mitochondria. Before β- oxidation activation of fatty acid…
Q: Write balanced chemical equations for each of the following: (a) anaerobic glycolysis of 1 mole of…
A: Introduction: The series of chemical reaction that takes place in the living body is known as…
Q: What are two important compounds that lie at crossroads of major metabolic pathways? Select both…
A: Metabolic pathway engineering in microbial hosts for heterologous biosynthesis of commodity…
Q: Describe the advantages of using triacylglycerols as the principal source of stored metabolic…
A: Fatty acids may form triacylglycerol's, which are also known as triglycerides, which are the most…
Q: Calculate the amount of ATP
A: Maltose is a disaccharide molecule formed from two molecule of glucose , those two molecule of…
Q: What percentage of ATP energy is produced when 9.0 moles of glucose react in the citric acid cycle?…
A: * metabolic pathways occur inorder to produce ATP . * The one mole of glucose we take then the…
Q: Calculate the energy savings (in ATP molecules per glucose monomer)achieved by breaking down…
A: Introduction Phosphorolysis is the process in which inorganic phosphate attacks a compound. This…
Q: Calculate the energy produced (in ATP molecules) achieved by complete oxidation of the hydrolysis…
A: Glycolysis is an oxidative process that is common in both aerobic and anaerobic cellular…
Q: Consider the fatty acids: (a) Arachidic acid (C20H40O2); molar mass = 312.5 g/mol) (b) Palmitoleic…
A: β-oxidation generally occurs in the mitochondria, and it is the pathway for degradation of fatty…
Q: Upon digestion of starch, isomaltose (an isomer of maltose), one of its degradation products, is…
A: Aerobic metabolism is a set of three basic metabolic processes that occur in cells to generate…
Q: If the DGo for ATP hydrolysis into ADP + inorganic phosphate is -7.3 kcal/mole, and the DGo for…
A: The delta G (dG) or change in Gibbs free energy determines whether a chemical reaction is favorable…
Q: Calculate the number of molecules of ATP produced for partial oxidation of palmitate to…
A: Beta-oxidation of Fatty acid (FA) is a cyclic process in which FA is shortened by acycl-CoAs. Two…
Q: How many molecules of ATP are produced from the complete metabolism of 2.12g of triacylglycerol…
A: Introduction: Triacylglycerols are a rich source of energy. One gram of triacylglycerol contains…
Q: Write the equation for the final step in the catabolism of any fatty acid with an even number of…
A: Fatty acid catabolism is the breakdown of fatty acid to acetyl-CoA molecule through a process called…
Q: If the DGo for ATP hydrolysis into ADP + inorganic phosphate is -7.3 kcal/mole, and the DGo for…
A: Given: ADP + Inorganic phosphate →ATP ∆G10=-7.3 kcal/mol…
Q: Which of the following is the correct summary of phase II of glycolysis for each molecule of…
A: Glycolysis is the process by which glucose is broken down to form pyruvate. The process involves…
Q: Compare the energy contents of triacylglycerols and glycogen. Explain the differences between these…
A: Triacylglycerols: The triacylglycerol r triglycerides are the simplest form of lipids that are…
Q: Consider the carbohydrate maltose. a. How many molecules of acetyl CoA are formed from its complete…
A: Maltose is a disaccharide composed of 2 glucose units. Maltase is the enzyme that transforms 1…
Q: upon digestion of starch maltose, one of its degradation products is further hydrolyzed into its…
A: When the process of cellular respiration takes place, then there is the production of three…
Q: what is the total number of pyruvate molecules produced at the end of glycolysis?
A: Two pyruvate molecules are produced at the end of glycolysis. I have attached the glycolysis cycle…
Q: Compare the ATP yield from the complete oxidation of glucose, a sixcarbon carbohydrate, and hexanoic…
A: The energy source of produce from the electron transport chain was 1 molecule of FADH2 yields 1.5…
Q: Use a flowchart to arrange the following steps in the catabolism of carbohydrates in the order by…
A: Carbohydrates are macronutrients. They are metabolized through various biochemical pathways, in…
Q: Unlike a rabbit, running all-out for a few moments to escape a predator, migratory birds require…
A: Acetyl coenzyme A is a key metabolic intermediate that is produced in a variety of methods,…
Q: Compare the ATP yields from catabolism of a stearic acid with the ATP produced from complete…
A: In the biochemical pathway of the cell, the fuel molecules are catabolized to produce energy in…
Q: Upon digestion of starch, isomaltose (an isomer of maltose), one of its degradation products, is…
A: Isomaltose is a glycosylglucose consisting of two D-glucopyranose units connected by an…
Q: Complete metabolism of which of the following fatty acids will yield the highest number of ATP…
A: Beta oxidation is a catabolic process which involves stepwise oxidation of fatty acids. Each cycle…
Q: Calculate the amount of ATP molecules generated from the complete metabolism of 1 molecule of…
A: Metabolism refers to the total amount of biochemical processes that go on in an organism's cells to…
Q: Walking consumes approximately 100 kcal/mi. In the hydrolysis of ATP (ATP → ADP + Pi), the reaction…
A: The energy currency of a living cell is called ATP. It is then hydrolyzed into ADP or AMP. The…
Q: Calculate the atp yeild from complete oxidation of the following molecules by the reaction of…
A: Introduction: maltose is a disaccharide while fructose and sucrose are the monosaccharides. the…
Q: Explain why one more ATP is produced when glucose is obtained from glycogen than when it is directly…
A: Glucose is the most abundant monosaccharide made by plants and most algae during photosynthesis from…
Q: Calculate the ATP yield from full oxidation of the fatty acids from a triglyceride with 3, 22 carbon…
A: Fatty acids are released in the digestion of triglycerides. These fatty acids undergo beta oxidation…
Q: Write down the beta oxidation pathway of fatty acid metabolism.
A: Beta oxidation is a catabolic process of fatty acid molecules break down to produce energy. The long…
Q: Write the balanced equation for the sequential conversion of glucose to pyruvate and of pyruvate to…
A: Glycolysis is the metabolic pathway that converts glucose into pyruvate.
Q: Use the following graph that shows "the effect of ATP on the allosteric enzyme PFK-1" for questions…
A: PFK-1 is the enzyme of glycolysis and it converts fructose-6-phosphate to fructose-1,6-bisphosphate.…
Q: Which of the following is a correct ranking of molecules with respect to their energy value in…
A: Cellular respiration is a bunch of metabolic responses and cycles that happen in the cells of living…
Q: Write balanced chemical equations for each of the following: (a) anaerobic glycolysis of 1 mole of…
A: Glucose is the metabolic pathway in which glucose is converted to pyruvate and hydrogen ion. Free…
Q: Calculate the total amount of ATP’s that can be produced by the Krebs cycle and the resultant…
A: Krebs cycle: a series of enzymatic reactions which utilizes oxidative metabolism of acetyl units and…
Q: Calculate the net number of ATPs produced when one 10-carbon fatty acid is activated, enters the…
A: Fatty acids are the building blocks of fat in both our body and our meals. The body breaks down…
Q: CHOOSE THE CORRECT LETTER. Which of the following reactions require ATP in glycolysis? A.…
A: - There are two steps in Glycolysis where ATP is consumed. First, conversion of glucose to…
Q: When glycogen is synthesized in both the liver and muscle,
A: When glycogen is synthesized in both the liver and muscle,all the following are true, EXCEPT option…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps
- Calculate the ATP yield from full oxidation of the fatty acids from a triglyceride with 3, 22 carbon fatty acid moleculesWhat will be the approximate energy yield through aerobic metabolism, of a 16-carbon fatty acid? Describe each of the major major reactions involved. Identify the important molecules produced by each reaction, and how the total energy yield is determined.Calculate the ATP yield from complete oxidation of maltose by the reaction of glycolysis, citric acid cycle, electron transport chain and oxidative phosphorylation.
- Calculate the number of ATPs generated by the complete metabolic oxidation of tripalmitin (tripalmitoylglycerol). Hydrolysis of the triacylglycerol occurs at the cell surface. Consider the energy yield from catabolism of glycerol, as well as from the fatty acids. Calculate the ATP yield per carbon atom oxidized, and compare it with the energy yield from glucose.Calculate the atp yeild from complete oxidation of the following molecules by the reaction of glycolysis citric acid cycle, electron transport chain and oxidative phosphorylation. Maltose Fructose Secrotose .How much ATP will be produced from the Beta-oxidation of lauric acid a C 12 saturated fatty acid? Calculate the energy yield per gram of lauric acid.
- Calculate the amount of ATP molecules generated from the complete metabolism of 1 molecule of maltose, assuming all electrons of cytosolic NADH are transferred through the dihydroxyacetone phosphate/glycerol 3-phosphate shuttleCompare the ATP yield from the complete oxidation of glucose, a sixcarbon carbohydrate, and hexanoic acid, a six-carbon fatty acid. Hexanoic acid is also called caprioic acid and is responsible for the “aroma” of goats. Why are fats better fuels than carbohydrates?Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATP
- Account for the fractions of ATP generated by fatty acid breakdown and the citric acid based on palmitic acid. (please do the math)Calculate the amount of ATP generated from the complete oxidation of a triglyceride with a X, Y, and Z acyl chain of carbons; Compare the ratio of ATP:C to that achieved by the complete oxidation of glucose muscle cells.Calculate the energy savings (in ATP molecules per glucose monomer) obtained by phosphorolyzing glycogen rather than hydrolyzing it to start the glycolysis process.