CaSO4(s) Ca²+ (aq) + SO3- (aq) K = [Ca ²+ ][SO²-] K= 3.2 x 10-5 R CaSO4(s) Ca2+(aq) + SO² (aq) I (M) SOLID 0 0 C (M) SOLID +X +X E(M) SOLID X X What is the concentration of the SO42- ion when the system reaches equilibrium? [SO²-] = [? ] × 10¹¹¹ M X Coefficient (green) Exponent (yellow) Enter

CaSO4(s) Ca²+ (aq) + SO3- (aq) K = [Ca ²+ ][SO²-] K= 3.2 x 10-5 R CaSO4(s) Ca2+(aq) + SO² (aq) I (M) SOLID 0 0 C (M) SOLID +X +X E(M) SOLID X X What is the concentration of the SO42- ion when the system reaches equilibrium? [SO²-] = [? ] × 10¹¹¹ M X Coefficient (green) Exponent (yellow) Enter

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.ACP

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
The ore cinnabar (HgS) is an important source of mercury. Cinnabar is a red solid whose solubility in water is 5.5 X 10-2 mol L-1. Calculate its \p. What is its solubility' in grams per 100 g of water?
Write the expression for the equilibrium constant and calculate the partial pressure of CO2(g), given that Kp is 0.25 (at 427 C) for NaHCO3(s) NaOH(s) + CO2(g)
In a solution with carbon tetrachloride as the solvent, the compound VCl4. undergoes dimerization: 2VCl4V2Cl8 When 6.6834 g VCl4. is dissolved in 100.0 g carbon tetrachloride, the freezing point is lowered by 5.97C. Calculate the value of the equilibrium constant for the dimerization of VCl4 at this temperature. (The density of the equilibrium mixture is 1.696 g/cm3, and Kf = 29.8C kg/mol for CCl4.)
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
A Boric acid and glycerin form a complex B(OH)3(aq) + glycerin(aq) B(OH)3 glycerin(aq) with an equilibrium constant of 0.90. If the concentration of boric acid is 0.10 M, how much glycerin should be added, per liter, so that 60.% of the boric acid is in the form of the complex?
. The solubility product of iron(III) hydroxide is very small: Ksp=41038at 25 °C. A classical method of analysis for unknown samples containing iron is to add NaOH or NH3. This precipitates Fe(OH)3, which can then be filtered and weighed. To demonstrate that the concentration of iron remaining in solution in such a sample is very small, calculate the solubility of Fe(OH)3in moles per liter and in grams per liter.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
What is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.