Choose the INCORRECT statement. The energy stored in chemical bonds or generated from intermolecular forces is chemical energy. Force acting across a distance is Work done. The specific heat is the heat capacity for one gram of substance. High specific heat capacities explain why metals heat so quickly. The heat capacity is the energy needed to raise the temperature of system by a degree.

Choose the INCORRECT statement. The energy stored in chemical bonds or generated from intermolecular forces is chemical energy. Force acting across a distance is Work done. The specific heat is the heat capacity for one gram of substance. High specific heat capacities explain why metals heat so quickly. The heat capacity is the energy needed to raise the temperature of system by a degree.

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter10: Energy

Section: Chapter Questions

Problem 65A

See similar textbooks

Similar questions

Suppose heat flows into a vessel containing a gas. As the heat flows into the gas, what happens to the gas molecules? What happens to the internal energy of the gas?
Equal masses of liquid A, initially at 100C, and liquid B, initially at 50C, are combined in an insulated container. The final temperature of the mixture is 80C. All the heat flow occurs between the two liquids. The two liquids do not react with each other. Is the specific heat of liquid A larger than, equal to, or smaller than the specific heat of liquid B?
A 500.0-g sample of an element at 195C is dropped into an ice--water mixture; 109.5 g ice melts and an ice--water mixture remains. Calculate the specific heat of the element. See Exercise 131 for pertinent information.
When ethanol (grain alcohol, is burned in oxygen, approximately 1360 kJ of heat energy is released per mole of ethanol. mg src=Images/HTML_99425-10-44QAP_image002.jpg alt="" align="top"/> What quantity of heat is released for each gram of ethanol burned? i>What is for the reaction as written? How much heat is released when sufficient ethanol is burned so as to produce 1 mole of water vapor?
9.21 Which type of energy heat or work, is valued more by society? What evidence supports your judgment?
How much heat is evolved when 1255 g of water condensesto a liquid at 100°C?
Which produces more heat? Os(s)2O2(g)OsO4(s)orOs(s)2O2(g)OsO4(g) for the phase change OsO4(s)OsO4(g)H=56.4kJ
Define heat. What are its units? How does it differ from energy?
Grilling What mass of propane (C3H8) must be burnedin a barbecue grill to release 4560 kJ of heat? The Hcomb of propane is -2219 kJ/mol.
A7.50-gpiece of iron at 100.0C is dropped into 25.0g of water at 22.0C. Assuming that the heat lost by the iron equals the heat gained by the water,determine thefinal temperature of the iron/watersystem. Assume a heat capacity of water at 4.18 J/g.K and of iron at 0.452J/g.K.