Classify each alcohol as to 1º, 2º, or 3º1.2. CH3CH2CH(CH3)CH2OHCH33.CH2CH2CHOHCH3

Answered: Image /qna-images/answer/1981adce-1a30-4490-aaab-be1700a74011.jpg

Answered: Classify each alcohol as to 1º, 2º, or…

Science

Chemistry

Classify each alcohol as to 1º, 2º, or 30 1. OH 2. CH;CH;CH(CHa)CH2OHCH3 3. CH2CH2CHOHCH3

Introduction to General, Organic and Biochemistry

11th Edition

ISBN:9781285869759

Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Publisher:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Chapter14: Alcohols, Ethers, And Thiols

Section: Chapter Questions

Problem 14.25P: 14-25 Explain why glycerol is much thicker (more viscous) than ethylene glycol, which in turn is...

See similar textbooks

Related questions

Q: Dexamethasone is a halogen-containing steroid used to treat infl ammation in rheumatoid arthritis…

A: Alcohols are a kind of organic molecules having functional group '-OH' attached to the carbon chain.…

Q: Give both the IUPAC name and the common name for each alcohol. (CH3)2CHCH2CH2OH

A: Given, (CH3)2CHCH2CH2OH

Q: What alcohol is formed when each compound is treated with NaBH4 in CH3OH?

Q: What alkenes are formed when each alcohol is dehydrated with TsOH? Label the major product when a…

A: Hey, since there are multiple sub-part questions posted, we will answer first three questions. If…

Q: B. Give the common name for each ether. (a) H3C-0-CH2CH3 (b) H3C-0-CH3

A: The given compounds have an "ether" functional group.

Q: Draw the products formed when each alcohol is dehydrated with H2SO4. Use the Zaitsev rule to predict…

A: Alcohols on dehydration forms alkene Zaitsev rule used to predict more stable product during…

Q: Draw the products formed when each alcohol is oxidized with K 2Cr 2O 7. In some cases, no reaction…

A: Note: Since you have posted multiple independent questions in the same request, we will solve the…

Q: 3. What alcohol is formed when each alkene is treated with H2O in the presence of H2SO4 (as the…

A: What alcohol is formed when each alkene is treated with water in the presence of sulfuric acid? (a)…

Q: 1. Which alcohol has a higher boiling point? a. (i) 2-methylpropan-2-ol or (ii) butan-2-ol b. (i)…

A: Boiling point of alcohols: Instead of having a similar molecular mass alcohols having the higher…

Q: Draw the carbonyl products formed when each alcohol is oxidized with K 2Cr 2O 7.

A: Draw the carbonyl products formed when each alcohol is oxidized with K 2Cr 2O 7.

Q: Label the functional group(s) in each compound as an alcohol, ether, acetal, or hemiacetal.

A: Label the functional group(s) in each compound as an alcohol, ether, acetal, or hemiacetal. (a) (b)…

Q: Give the IUPAC name for each alcohol HỌ CH3 (CH),CHCH,CHCH,CH3 CH̟CH,CH,OH CH,CHCH,CH,CH3 b. а. Но.…

A: Note: According to our guidelines we are supposed to answer only one question. Kindly repost other…

Q: What alcohol is formed when each carbonyl compound is treated with H 2 and a Pd catalyst?

A: Reduction reaction is one the important class of organic reactions. Generally in reduction reaction,…

Q: What alcohol is formed when each compound is treated with H 2 and a Pd catalyst?

A: When alcohol or ketone reacts with H2 and Pd catalyst then alcohol reduce to primary alcohol and…

Q: BIUA co [D 12 +] I. What products are formed when each alcohol is oxidized with K,Cr,0,? a.…

A: Hello. Since your question has multiple parts, we will solve the first question for you. If you want…

Q: What carbonyl compound is needed to make each alcohol by a reduction reaction? What carbonyl…

A: Reduction of carbonyl compounds can produce alcohols. Metal hydrides (LiAlH4, NaBH4) are good…

Q: Draw the products formed when each alcohol is dehydrated with H 2SO 4.

A: Given alcohol,

Q: What products are formed when each alcohol is oxidized with K 2Cr 2O 7? In some cases, no reaction…

A: K2Cr2O7 is a potent oxidising agent like KMnO4. Potassium dichromate can oxidise alcohols and…

Q: Give a systematic (IUPAC) name for each diol. ) HO¬(CH2)8¬OH

A: First note the structure of given diol.

Q: Rank the alcohols in order of increasing reactivity when dehydrated with H2SO4.

Q: Draw the products formed when each alcohol is dehydrated with H 2SO 4. Use the Zaitsev rule to…

A: Hello. Since your question has multiple subparts, we will solve the first three sub-parts for you.…

Q: 1. Alcohols are viewed as alkyles derivatives of water Draw water and an alcohol next to it, compre…

A: Hello. Since more than one question has been posted, the first question shall only be solved in this…

Q: Give the structure corresponding to each IUPAC name. 2,4 dimethyl- 2 hexanol

A: The given compound is 2,4-dimethyl-2-hexanol.

Q: What alcohol can be oxidized to each carboxylic acid? b. (CHa),CHCOOH -COOH a. С. OH

A: Alcohols are organic molecules containing -OH group. Suffix ol is used at end of their iupac name.…

Q: Draw the products formed when each alcohol is oxidized with K 2Cr 2O 7. In some cases, no reaction…

A: Hi, since you have posted multiple subparts questions. We will answer the first three subparts for…

Q: Draw the eight constitutional isomers with molecular formula C5H120 that contain an OH group. Give…

A: The eight constitutional isomers with molecular formula C5H12O contain the OH group and the IUPAC…

Q: What product is formed when the alcohol is oxidized with K2Cr2O7? In some cases, no reaction occurs…

A: This question belong to Reagents (Oxidation-Reduction Reaction) . K2Cr2O7 are the Powerful Oxidising…

Q: Rank the alcohols in order of increasing reactivity when dehydrated with H2SO4.

A: Generally, alcohols undergo dehydration reaction in presence of strong acids like H2SO4 or…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: What products are formed when benzene is treated with each alkyl chloride and AlCl3?

A: Friedel-Crafts alkylation comprises an aromatic ring's alkylation by using given alkyl halide and…

Q: Which alcohol is the most soluble in water? A CH;CH2CHOHCH3 B CH;CH2CH2CH2OH C (CH3)2CHCH2OH D)…

Q: Rank the alcohols in order of increasing reactivity when dehydrated with H2SO4.

A: Generally, alcohols undergo dehydration reaction in presence of strong acids like H2SO4 or…

Q: ОН CH3

Q: Which structure has the highest boiling point? A or B A. Ethers B. Ketones O A. OB.

A: 18. Ketones has higher polarity as compared to ethers. Ethers are of the general form R-O-R' and…

Q: 2 CH;CH,-OH) → + HC CHs

A: Ketone on treatment with alcohol in the presence of acid catalyst produces ketal.

Q: I. What products are formed when each alcohol is oxidized with K2Cr2O7? a. CH3CH2CH2CH,CH2OH

A: Since we know that primary and secondary alcohols are oxidized by K2Cr2O7 to carboxylic acids and…

Q: ) Rank the following in order of increasing boiling point. он OH CH3 A

A: We have given three compound A = 2cyclohexylethanoic acid Boiling Point =…

Q: I. What products are formed when each alcohol is oxidized with K2Cr207? a. CH;CH,CH2CH,CH2OH ОН ОН…

A: Concept: 1) K2Cr2O7 is a powerful uncontrolled oxidizing agent. 2) primary alcohol is converted…

Q: CH3-CH-CH,-CH2-CH2-CH2 2. The correct IUPAC name for ОН ÓH is hexyl dialcohol 2,6-dihydroxyhexane a)…

Q: Give both the IUPAC name and the common name for each alcohol.(a) CH3CH2CH(OH)CH3

A: In IUPAC system, the naming of alcohol is done by adding the suffix -ol with the name of the parent…

Q: What alcohol is formed when each compound is treated with NaBH4 in CH3OH?

A: Ketones are the organic compounds which contains the carbonyl group -CO. On the reduction of…

Q: 15) 1-Methylcyclopentanol is classified as A) a primary alcohol B) a secondary alcohol C) a tertiary…

Q: CH3 HO. HBr CH3

A: This reaction is acid hydrolysis of alcohol. This reaction occurs by Sn1 mechanism. A carbocation is…

Q: Rank the alcohols in order of increasing reactivity when dehydrated with H2SO4.

A: Alcohols undergo dehydration in the presence protic acids like H2SO4. The formation of reaction…

Q: Draw the product formed when the alcohol cyclobutanol is dehydrated with H2SO4.

Q: What product is formed when the alcohol is oxidized with K2Cr2O7? In some cases, no reaction occurs…

Q: Name each aldehyde or ketone. b. CH3-CH;-CH;-C-CH-CH; ČH3

A: Interpretation: Name of the given compound is to be determined.

Q: List the products of each alcohol reaction. CH3 a. CH,-C-OH CH, NazCrO b. CH3-CH-CH;-CH2-OH c.…

A: The objective of the question is to write the products of the given reactions.

Q: Label each ether and alcohol in brevenal, a marine natural product. Classify each alcohol as 1°, 2°,…

A: Ether is group where oxygen atom is attached to alkyl group R-O-R. Oxygen is a functional group…

Q: List the products of each alcohol reaction. CH3 H,SO4 a. CH,-C-OH CH, NazCr0, b. CH3-CH-CH,-CH;-OH…

A: Alcohols are the functional group which contains one or more hydroxyl group in it. Alcohols are…

Question

Classify each alcohol as to 1º, 2º, or 3º
1.
2. CH3CH2CH(CH3)CH2OHCH3
3.
CH2CH2CHOHCH3

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

General Physical Properties of Organic Compounds

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which member in each pair of liquids has the lowervaporpressure at a given temperature? Explain.(a) HOCH₂CH₂OH or CH₃ CH₂CH₂OH(b) CH₃ COOH or (CH₃ )₂C=O(c) HF or HCl
O2 HF CF4 CCl4 Which compound has the highest solubility in water? Which compound has the strongest LDF? CH3CCl3 CaO HOCH2CH2OH CH3OCH3 Which compound has the highest vapor pressure? Which compound has the lowest vapor pressure?
explain why methanethiol, CH3SH, has a lower boiling point (6°C) than methanol, CH3OH (65°C), even though methanethiol has a higher molecular weight
Based on the following boiling point information, what compound has the weakest intermolecular force? Substance Boiling Point Acetaldehyde CH₃CHO 20.8 Heptane 98.4 Cyclohexane 80.7 Ethanol 79 Hexane 68.7 Acetaldehyde Heptane Cyclohexane Ethanol Hexane
Consider the following alcohol, rank them from the least soluble to the most soluble. Isobutyl alcohol 10.0% Sec-butyl alcohol 7.7% Tert-butyl alcohol N-butyl alcohol 9.1%
Molecule Type Boiling point (°C) CH3CH2CH3 Alkane -42 CH3CHO Aldehyde +21 CH3CH2OH Alcohol +78 i. Why is the boiling point of the aldehyde greater than that of the alkane?ii. Why is the boiling point of alcohol the highest?iii. Explain why the solubility of aldehydes and alcohols falls as the molecules get bigger.
Use the following options to determine which compound will be more soluble in pentane (CH3CH2CH2CH2CH3). CH3OH or CH3Cl A) Both insoluble B) CH3OH C) CH3Cl CH3CH3 (ethane) or CH3CHCH3CH3 (isobutane) A) Both insoluble B) Ethane C) Isobutane Glucose or chlosterol A) Both insoluble B) Glucose C) Chlosterol Na2O or Li2O A) Both insoluble B) Na2O C) Li2O
1. (a) Which compound would have the highest boiling point? CH3CH2CH2OH CH3CH2CH2Cl CH3CH2CH2CH3 CH3CH2OCH3 2. (b) Which compound is expected to be most soluble in water? CH3CH2CH2CH2OH CH3CH2CH2CH2SH CH3CH2CH2CH2Cl CH3CH2CH2CH2CH3
positive and negative impact of alcohol chemistry in socitey
Based on the following boiling point information, what compound has the strongest intermolecular force? Substance Boiling Point Acetaldehyde CH₃CHO 20.8 Heptane 98.4 Cyclohexane 80.7 Ethanol 79 Hexane 68.7 Acetaldehyde Heptane Cyclohexane Ethanol Hexane
Which one is more soluble in octane, C8H18: Propane CH3-CH2-CH3 or 1-Propanol, CH3-CH2-CH2-OH. Why ? A. 1-propanol because it has strong dispersion forces. B. 1-propanol because it is polar C. 1-propanol because it can hydrogen bond D. Propane because it has only dispersion forces
1. About what volume does 0.15 mol of 2-methylcyclohexanol occupy at room temperature? 15.0 mL 18.5 mL 20.0 mL