explain why methanethiol, CH3SH, has a lower boiling point (6°C) than methanol, CH3OH (65°C), even though methanethiol has a higher molecular weight

Q: Draw the structure of a molecule that fi ts each description: a. a 2 ° alcohol of molecular formula…

A: Molecular structure describes the location of the atoms. The bonds are shown as solid lines and the…

Q: CH3 CH,CHOCH,CH, OCH ČH3 OH OH CH,CH,CHCH ОН Alcohol Phenol Ether

A: The different functional groups are those which contains - Alcohol - (R-OH group) where R =…

Q: Arrange following compounds according to increasing boiling point:   2-Methylbutane…

A:

Q: GIVE IUPAC NAMES FOR THE FOLLOWING STRUCTURES: (a) (b) CHO (c) H-C-OH CH2OH CH3

A: Since you have posted a question with multiple sub-parts, we will solve first three parts for you.…

Q: What is the circled functional group? Ha Hz CH3 H;C H2 Ether Alcohol Thiol O Ketone Ester

A: Functional group: The group of hateroatom (atoms other than carbon and hydrogen ) called the…

Q: Draw the structure of the six constitutional isomers of molecular formula C 5H 12O that contain an…

A: The structures of six constitutional isomers having molecular formula C5H12O which contains ether as…

Q: 6. Predict which compound has a higher boiling point and explain briefly why. a. CH3OH and CH,CH2OH…

A: As per our guidelines we can solve only one question at a time and first three sub-parts of the…

Q: Draw 4‑ethylphenol (p‑ethylphenol). Include all hydrogen atoms.

A: The structure of 4-ethylphenol can be drawn as,

Q: Give the IMPAC name for each compound. 1. COOH COOH 2. Br 3. CH3 CHz COOH

A: Given we know about the iupac naming rule

Q: Rank the compounds according to the * ?increase in boiling point R-NH2 < R-OH < R-COOH O R-OH<…

A: Boiling point of the substance depends upon the inter-molecular force of attraction present in the…

Q: Explain why CH3CH2NHCH3 has a higher boiling point than (CH3)3N, even though they have the same…

A: Hydrogen bonding is a special type of dipole-dipole interaction in a polar bond which has hydrogen…

Q: Draw the structure of a molecule that fi ts each description: a. a 2 ° alcohol of molecular formula…

A: Given, a. a 2 ° alcohol of molecular formula C 6H 12Ob. a cyclic ether with molecular formula C 5H…

Q: Give a systematic (IUPAC) name for each diol. ) HO¬(CH2)8¬OH

A: First note the structure of given diol.

Q: which compound has the highest boiling point: pentan-2-ol or hexane-2-ol?

A: Both compounds having same functional group, alcohol, at second position. There is difference of…

Q: Why does ethanol have a higher boiling point than dimethyl ether despite having the same molecular…

A: The boiling point of molecules having same masses can also be different due to different types of…

Q: 2.71 All of the following alcohols have the same molecular formula (C5H12O), but they have…

A: Alcohol is the functional group in organic chemistry. It is also known as hydroxyl group. They are…

Q: 6. Draw a circle around the compound in each horizontal row with the highest boiling point and draw…

A:

Q: Molecules with OH bonds tend to be soluble in water and yet octanol (C8H17OH) is not soluble in…

A: The solubility of compounds depends on different factors. The compounds having -OH group are mostly…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: Prednisolone is a corticosteroid used to treat certain types of allergies, inflammatory conditions,…

A:

Q: Which compound in the following pairs will have the higher boiling point? Explain your reasoning.…

A: Boiling point of a compound is the temperature at which a compound boils and this happens when the…

Q: CH3 OH HBr ? ether OH PBr3 ether

A: Nucleophilic- Substitution :   The mechanism for this substitution reaction has two parts. First is…

Q: OH H =H HO, A в C D E

A: Boiling temperature depends on the intermolecular forces of attraction which depends on the…

Q: 2. Lycopene is a bright red carotenoid hydrocarbon found in tomatoes and other red fruits and…

A: Answer  Carotenoids are plant pigment responsible for bright red…

Q: Diethyl ether (CH3CH2OCH2CH3) and butan-1-ol (CH3CH2CH2CH2OH) are constitutional isomers with the…

A: The boiling point of the compound depends on the intramolecular forces of the compound.

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH;-ĊH-CH,-COOH…

A: a) b)

Q: Why CH3CH2NHCH3 has higher boiling point tha (CH3)3N even they have the same molecular weight

A: First compound CH3CH2NHCH3 is secondary amine, ethyl methyl amine while second Compound (CH3)3N is…

Q: Provide IUPAC names for the following compounds. (a) (CH3)2СHCH,СH; (b) CНз — С (CHз)2 — СH3 CH,…

A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: Explain why ethanol (CH3CH2OH) is more soluble in water than is ethane (CH3CH3 )

A: Solubility of a compound follows the rule of like dissolve like. This means polar compound are…

Q: The yeast Brettanomyces causes spoilage in wine. Brettanomyces produces 4-ethylphenol, which at high…

A: The nomenclature of the compound is given by IUPAC. This nomenclature is used to determine the…

Q: Give the IUPAC and common name for the following compounds. HO, но OH 9.

A:

Q: 0= .Et 2) 3) phenol + CO₂ 1) i + CH₂l - KOH ii-H* NaOH

A: Since you have posted a question with multiple sub-parts, we will solve the first three subparts for…

Q: n-Butyl methyl ether is an isomer of MTBE and has a boiling point of 70 oC. Explain why the boiling…

A: Boiling point of a compound depends on the intermolecular force. Higher is the intermolecular force,…

Q: why dimethyl ether (CH3OCH3) boils at -25oC

A:

Q: 1: Give at least five (5) uses of Alcohol and Phenol Name Functional Group Alcohols R-OH LOH Phenols…

A:

Q: A) Diethyl Ether + Methylene Chloride B) Diethyl Ether + Water O C) Water + Dodecanol D) Methylene…

A: The solubility of a compound depends on the nature of the solute and the solvent. If the nature of…

Q: 0. Why does ethanol have a higher boiling point than dimethyl ether despite having the same…

A:

Q: MCQ 3: The carbonyl group in aldehyde is A. C=O B. C-O C. CO D. CHO

A:

Q: OH CrO3, H2SO acetone H. YZA AZY YZA AZY

A: Since you have posted multiple unrelated questions, we are entitled to answer the first only.

Q: 1. Rank the following compounds in order of increasing boiling point: CH;CH,CH(CH3)2, CH;CH2CO2H,…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: The correct IUPAC name for this compound is It may help to draw the complete Lewis Structure. он…

A: The given compound, belongs to the alcohol family due to the presence of (OH) group. On…

Q: 3. Which of the following has the highest boiling point? The following compound: CH3 H3C° N. O The…

A: The compound which has highest boiling point has to be given.

Q: What is the major product of each of the following reactions?

A: a) nucleophilic 1,4-addition reaction takes place

Q: CH, OH CH,-CH-CH2-CH3 2-Butanol CH3 CI PH2 CH3-CH2-NH2 V CH3-CH-CH3 CH3-C-H CH3-CH-CH3 CH3-CH-CH3 II…

A:

Q: Draw 4-ethylphenol (p-ethylphenol). Include all hydrogen atoms.

A: In 4-ethylphenol , we have a phenyl ring on which -OH group is at carbon-1 and ethyl group at…

Q: No line formula please 3-methyl-2-heptanol + H2SO4

A: The given reactants are 3-methyl-2-heptanol and sulphuric acid.

Q: The C-O bond is much shorter in phenol than in ethanol. Give reason.

A: The C-O bond is much shorter in phenol than in ethanol due to resonance in phenol. In phenol lone…

Q: Dehydration of alcohols can be done by using: O Fe2O3 O Cao O all of these conc. H2SO4

A: Dehydration is the process of removing water molecule from the reacting molecule. Here the water…

Q: 1. Explain why the propane that is used as a fuel in a barbecue is a gas at room temperature,but…

A: The state of matter depends on the intermolecular forces of attraction that exist between molecules.…

Q: Which compound in each pair has the highest boiling point and why? a) b) c) HO 'N' NH2 SH HO

A: boiling point is a particular temperature at which substance boils off from liquid state to its…