Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: Write IUPAC and common names for   ethers.

A: The IUPAC name of an organic compound is written on the basis of the certain rules laid down by…

Q: Give the IUPAC name for each ketone. C-CHCH,CH3 b. a.

A: A molecule or compound has many names. Different naming systems exist in the world. Among these…

Q: Draw the structures of: 8. (1R,2R)-cyclopentane-1,2-diol

A: Structure of (IR,2R)-cyclopentane-1,2-diol is

Q: Why is H3C-O-SiH3 ether a weaker base than (CH3)3O?

A: due to Pπ-Pπ back bonding

Q: What alcohol is formed when each compound is treated with NaBH4 in CH3OH?

A:

Q: Draw the products formed when each alcohol is oxidized with K 2Cr 2O 7. In some cases, no reaction…

A: Note: Since you have posted multiple independent questions in the same request, we will solve the…

Q: 3. What alcohol is formed when each alkene is treated with H2O in the presence of H2SO4 (as the…

A: What alcohol is formed when each alkene is treated with water in the presence of sulfuric acid? (a)…

Q: Provide the IUPAC and common name for the ether shown here:

A: The IUPAC name of the ether is given as alkoxyalkane where alkoxy group represents the oxygen atom…

Q: Give the IUPAC name for each alcohol HỌ CH3 (CH),CHCH,CHCH,CH3 CH̟CH,CH,OH CH,CHCH,CH,CH3 b. а. Но.…

A: Note: According to our guidelines we are supposed to answer only one question.  Kindly repost other…

Q: Why is H3C-O-SİH3 ether a weaker base than (CH3)3O?

A:

Q: Give the structure corresponding to each IUPAC name:  a) 3-methyl-3-pentanol b) 4-methyl…

A: While writing the IUPAC name first identify the parent chain and then the functional group.

Q: What products are formed when each alcohol is oxidized with K 2Cr 2O 7? In some cases, no reaction…

A: K2Cr2O7 is a potent oxidising agent like KMnO4. Potassium dichromate can oxidise alcohols and…

Q: Give a systematic (IUPAC) name for each diol. ) HO¬(CH2)8¬OH

A: First note the structure of given diol.

Q: Draw the structures of the following compound and give it's IUPAC name: a. Methyl mercaptan b.…

A: Mercaptan: The organic compounds having thiol (-SH) as a functional group is called mercaptan. IUPAC…

Q: Draw the products formed when each alcohol is dehydrated with H 2SO 4. Use the Zaitsev rule to…

A: Hello. Since your question has multiple subparts, we will solve the first three sub-parts for you.…

Q: What are the products formed when 1-butanal reacts with: NaOH/H2O CrO3, H2SO4, H2O

A: We have to write the products formed when 1-butanal reacts with: NaOH/H2O CrO3, H2SO4, H2O

Q: Give the structure corresponding to each IUPAC name. 2,4 dimethyl- 2 hexanol

A: The given compound is 2,4-dimethyl-2-hexanol.

Q: OH CH;CH,CHCHOCH,CH3 CH3

A: Applying definition of acetal and hemiacetal.

Q: Draw the products formed when each alcohol is oxidized with K 2Cr 2O 7. In some cases, no reaction…

A: Hi, since you have posted multiple subparts questions. We will answer the first three subparts for…

Q: Draw the eight constitutional isomers with molecular formula C5H120 that contain an OH group. Give…

A: The eight constitutional isomers with molecular formula C5H12O contain the OH group and the IUPAC…

Q: Draw the reaction of butane-1,2-diol with (CH3)2CO

A: Carbonyl compound (aldehyde and ketone) reacts with an alcohol to form hemiacetal in the presence of…

Q: What products are formed when benzene is treated with each alkyl chloride and AlCl3?

A: Friedel-Crafts alkylation comprises an aromatic ring's alkylation by using given alkyl halide and…

Q: 3. Which compound has the lowest boiling point? A. Octan-1-ol B. 1-Chlorohexane C. Hexan-2-one D.…

A:

Q: Give the IUPAC name for each the following compound: a. CH;CH2CH,C(CH3)2CH2COOH b.…

A:

Q: Give the IUPAC name of the following alcohols: a. CH;CH2CH2CH2CH2CH2CH2CHCH2CH3 OH b.…

A: Iupac naming of the given compounds.

Q: sodium 2-butoxide 2-butanol

A: The given alkyl halide on reaction with sodium 2-butoxide undergoes elimination reaction to give…

Q: What is the IUPAC name of the following compound? CH;CH=CCH,CH,OH A 5-Hydroxy-3-phenylpent-2-ene B…

A:

Q: I. What products are formed when each alcohol is oxidized with K2Cr207? a. CH;CH,CH2CH,CH2OH ОН ОН…

A: Concept: 1) K2Cr2O7 is a powerful uncontrolled oxidizing agent.  2) primary alcohol is converted…

Q: g. 2-pentanol h. benzene i. 2-butanol 2-cyano-2-pentanol benzyl alcohol 2-butanone-semicarbazone

A:

Q: Which of the following is an acetal? H;C H;C но CH3 CH3 H;C- H3C H3C H3C OH C A and C B and D O A O…

A:

Q: a. 1-Methylcyclopentanol b. trans-2-Methylcyclopentanol

A:

Q: 2. IUPAC name of the structure CH3CH2C o- is: a. isopropyl cyclooctanoate. b. cyclooctyl propanoate.…

A: In the naming of esters, the parent chain is taken as the chain containing carbon with double bond…

Q: which compound has the highest boiling point: hexan-2-ol or hexane-1,5-diol?

A: Boiling point of a substance is influenced by the intermolecular forces of attraction present in the…

Q: Name each ether, epoxide, thiol, and sulfide.

A: According to the Q&A guidelines, I am allowed to answer the first three sub-parts. So I am…

Q: 1. Name the following ether. 2. Name the following thiol. C C-C-C-C-0-C-C C d C-C-C-C-C-S-H C-C-C-C…

A: Here we have to write the IUPAC name of the following compounds.

Q: Tell whether the given compound is an alcohol, a phenol or an ether. Give the IUPAC name of each a.…

A:

Q: A -NH2 NAOCH3 D Nacl

A:

Q: Alcohols undergo dehydration reactions in the presence of an acid catalyst. Which of the following…

A:

Q: b. (2E)-but-2-enal c. Ortho-bromobenzaldehyde d. 2-ethylhexan-3-ol e. (3Z)-4-hydroxypent-3-enoic…

A: Since you have posted multiple questions, we will solve the first question for you. To get remaining…

Q: When bromoethane is refluxed with KOH in an alcoholic medium, compound Y is formedl. Give the…

A: Solution:- It is asked about reaction of bromoethane is refluxed with alcoholic KOH. KOH is a strong…

Q: Use the following reagent table for the reaction of: cyclohexanol + H2 SO4 → cyclohexene

A: For the given reaction, we have to find mmol of reactants used and determine percentage yield of…

Q: Give the IUPAC name for each aldehyde. CH, CH;CHCH-č-H CH,CH;CH;-C-CH;CH; сно b. c.…

A: a. 2,3-dimethylbutanal b. 2-ethylpentanal c. 3-methylbutanal d. 3,3,4,4-tetramethylpentanal

Q: Write IUPAC and common names for   ethers.

A: Ethers are compounds containing an oxygen atom bonded to two carbon atoms via single covalent bonds.…

Q: 1. Give the IUPAC names for the following alcohols. (а) ОН OH (Ь) ОН (с) НО CH3CHCH2CHCHCH3…

A: Rules for IUPAC nomenclature:  1) select the longest carbon chain as parent chain. 2) identify the…

Q: Define the Reaction of Ethers with Strong Acid ?

A: Ethers have molecular formula  R-O-R' where R and R' is any alkyl or aryl group. Strong acid can…

Q: Name the following compound. CH;-CH;-CH,-ċ-o-CH;-CH; A) ethyl propyl ether B) ethyl propanoate C)…

A:

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH

A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…

Q: 1. Write the IUPAC name of the following а. CH3-CH-O-CH2-CH3 CH3 b. CНЗ-СH-CH2-SH CH3 c.…

A: 1. a. The above molecule is an ether. For the Iupac nomenclature the general name is alkoxy alkane.…

Q: Write IUPAC and common names for   ethers.

A: