Consider the following half-reactions: Half-reaction E° (V) Br2(1) + 2e → 2B1¯(aq) 1.080V Co2+(aq) + 2e → Co(s) -0.280V Cr3+(aq) + 3e Cr(s) -0.74OV (1) The strongest oxidizing agent is: enter formula (2) The weakest oxidizing agent is: (3) The weakest reducing agent is: (4) The strongest reducing agent is: (5) Will Cr3+(aq) oxidize Br"(aq) to Br2(1)? no (6) Which species can be oxidized by Co2+(aq)? If none, leave box blank.

Consider the following half-reactions: Half-reaction E° (V) Br2(1) + 2e → 2B1¯(aq) 1.080V Co2+(aq) + 2e → Co(s) -0.280V Cr3+(aq) + 3e Cr(s) -0.74OV (1) The strongest oxidizing agent is: enter formula (2) The weakest oxidizing agent is: (3) The weakest reducing agent is: (4) The strongest reducing agent is: (5) Will Cr3+(aq) oxidize Br"(aq) to Br2(1)? no (6) Which species can be oxidized by Co2+(aq)? If none, leave box blank.

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter8: Electrochemistry And Ionic Solutions

Section: Chapter Questions

Problem 8.10E: For each of the following reactions, determine the overall balanced electrochemical reaction, its...

See similar textbooks

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Use the following half-equations to write three spontaneous reactions. Justify your answers by calculating E° for the cells. 1. MnO4(aq)+8H+(aq)+5eMn2+(aq)+4H2OE=+1.512V 2. O2(g)+4H+(aq)+4e2H2OE=+1.229V 3. Co2+(aq)+2eCo(s)E=0.282V
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.