Consider the reaction HCI(g) + NH3(g)—NH4Cl(s) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 2.34 moles of HCI(g) react at standard conditions. ASO surroundings = J/K

Consider the reaction HCI(g) + NH3(g)—NH4Cl(s) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 2.34 moles of HCI(g) react at standard conditions. ASO surroundings = J/K

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter15: Energy And Chemical Change

Section: Chapter Questions

Problem 95A

See similar textbooks

Related questions

Q: Measurement of the reaction kinetics (kx/kH) for the following transformation gave the value of p =…

A: We have to write the reaction mechanism for the given organic reaction:

Q: Br Br^

A: To assign the pro-R and pro-S of any prochiral centre. The two same atoms/same groups of prochiral…

Q: Drag conversion units onto the boxes in the equation to make conversions. Some boxes can be left…

Q: 5. Provide reagents/conditions to accomplish the following syntheses. Several steps are required in…

A: In this synthesis, we will Synthesized the final product from the starting material by using…

Q: Draw and name the thee steps of the mechanism of the bromination reaction of 1,2-diphenylethane.

A: The addition of bromine to an alkene in a nonpolar solvent produces vicinal dibromo alkane.

Q: Question: 1. What is the wavelength of one ultraviolet (uv) photon if the frequency is 1.50 x 1015…

A: We have find out the answer.

Q: If you have 6.68 g of caffeine dissolved in 66.64 mL of water and the extraction coefficient between…

Q: When 17.6 g of a metal is placed in a graduated cylinder container 10.0 ml of water, the water level…

A: Given, mass of metal = 17.6 g Initially water level mark = 10.0 mL Final water level mark = 12.2 mL…

Q: From the following data, C (graphite) + O₂(g) → CO₂ (g) H₂(g) + O₂(g) → H₂0 (1) CH₂(g) + 20₂(g) →…

Q: Predict the product(s) for the following reaction. CH3 ОН "OCH₂CH3 ОН CH3CH₂OH/H₂SO4 CH3 "OCH₂CH3…

A: The organic reaction of ether in the presence of acidic medium is given and we have to find out the…

Q: Green plants use light from the Sun to drive photosynthesis, a chemical reaction in which liquid…

Q: Which of the sequences below would accomplish the following transformation? -CH₂OH- 1. PBr 2. Mg,…

A: Please note- As per our company guidelines we are supposed to answer only one question. Kindly…

Q: Explain, using the electron configurations of the elements and ions, why iron is a transition metal…

A: d block elements have either completely or incompletely filled d orbitals where as transition…

Q: Identify the unknown compound and its molecular weight.Also mention the class to which this compound…

A: Mass spectrometry is an important tool for the determination of the molecular mass of the compound…

Q: Calculate the energy of attraction between a cation with a valence of +1 and an anion with a valence…

A: Energy of attraction is given by: PE = k*q1*q2/d

Q: 59 Which of the following compounds can exist as cis-trans isomers? For each that can, draw both…

A: -> In cis form similar groups are on same side and in trans form similar groups are on opposite…

Q: What is the frequency of electromagnetic radiation with a wavelength of 420 nm? 7.14 x 1014 hz 4.6…

Q: What is the IUPAC name for the compound shown? CH3 H3 C-C CH–CH2–CH2CH3 CH3 CH₂ CH3

Q: What is the pressure in a 6.00 L tank with 10.0 grams of nitrogen gas at 385 K?

Q: Ice at 0.0 °C is placed in a Styrofoam cup containing 372. g of a soft drink at 15.4 °C. The…

A: Mass of soft drink (m1) =372 g change in temperature(T) = 15.4 O C specific heat capacity (c) =…

Q: Which compound would be more basic or weaker, a compound with a pka of -3.5 or a compound with a…

A: Which compound would be more basic or weaker, a compound with a pka of -3.5 or a compound with a pka…

Q: 12. Order the following compounds from the most polar to the least polar. C-H C-Br O-H

A: To order the following compounds from the most polar to the least polar. C-H, C-Br, O-H

Q: Thank you, but why was 0.0135 multiplied by 2?

A: Answer: For most of the reaction on increasing the temperature rate of reaction increases because…

Q: Citrus fruits are rich in citric acid, a compound with three COOH groups. Explain why the pK, (for…

A: R2R'CH2COOH = H+ + R2R'CHCOO- Ka = [H+] [R2R'CHCOO-]/[R2R'CH2COOH] pKa = - logKa Higher the…

Q: Draw a mechanism and predict the major product for the following reaction: NaBH MeOH ?

A: The given reaction is We have to give the structure of the major product with the mechanism.…

Q: X Incorrect. The net potential energy between two adjacent ions, EN, may be represented by EN = -…

Q: Two pollutants that form in auto exhaust are CO and NO. An environmental chemist must convert these…

Q: 4. If an object has a density of 4.05 g/cm³, what is its density in units of kg/m³? a. 4.05 x 10¹…

Q: 2. Draw the repeat unit of the following substituted polyphenol/formaldehyde polymerization:

A: A polymer is a large molecule that is formed by the repetition of small units called a monomer, and…

Q: 7. Predict the product(s) of the following reactions. Note: 18-crown-6 stabilizes cations, but for…

A: Use prevost reaction for formation of alkene to trans diol. All the mechanism step by step given…

Q: what's the difference between these two formula in structure? can you pls draw the lewis structure…

A: Compound having same molecular formula is knows as isomers but isomers are different types. Isomers…

Q: A sample of gas has a volume of 2.50 L at 761 kPa and 75.0 °C. What is the pressure (in atm) of the…

Q: If a sample of 131La goes from 450 picocuries to 100 picocuries in 185 minutes, what is its…

Q: A student performed the identical experiment to isolate Fe, NaCl, SiO2 in a mixture. They performed…

A: In this question we have to tell the mass percentage of of each component present into true(original…

Q: 8. Question: Chapter: 1 Lesson: 7 1. Based on Figure F01-7-6, what percentage of the incoming solar…

A: Solution - when we see the diagram, 6% of light is reflected by atmosphere . And 16% is absorbed by…

Q: A student mixes 0.1 L of a 1.2x10-2 mol/L solution of zinc nitrate, with a 0.1 L of a 6.0 x 10-3…

A: In this question we have to tell that , if we mix both the solution of NaOH and Zn(NO3)2 ,Will…

Q: Propose an efficient synthesis for the following transformation: OH OH The transformation above can…

A: In this question, we will identify the best reagents sequence from the starting material to the…

Q: Match the following enthalpy changes with the reactions below: enthalpy change of combustion,…

A: This question is from Chemical Thermodynamics.

Q: What is the IUPAC name for the compound shown? CH3 compound name: -CH3

Q: m[ What volume of ethanol (density = 0.7893 g/cm³) should be added to 450. mL of water in order to…

Q: Using the molecular weight of Tris base (121.14 g/mol), calculate how much Tris base you need to…

A: Since you asked multiple questions so as per Q&A guidelines of portal I solved first question…

Q: HI AGR

A: Acidic cleavage of ethe , strong acid HI or HBr used and form alcohol and alkyl halide via…

Q: How many atoms of tritium are in 1 kg of tritium water ³H₂O?

A: Number of mol = Mass/molar mass Number of atoms in 1 mol = 6.0224 x 1023

Q: A compound displays a sharp doublet at 3400 cm-1 in its IR spectrum. The mass spectrum has a…

Q: How would you prepare 250 ml of a 0.75 M solution using the following chemical compounds: a.…

Q: 3. Sulfur is applied to the skin for dandruff and itchy skin infection caused by mites (scabies). It…

A: The four quantum numbers for an electron are: 1. Principal quantum number (n) 2. Azimuthal quantum…

Q: 2SO3 -> 2SO2 -> 2SO, + 0, +02 What would cause the reaction to move in reverse. Increase the…

A: Given reaction , 2SO3 ----->2SO2 + O2 del H = 45kJ ( endothermic reaction )

Q: The electron configurations for four main-group elements are given. Match the electron configuration…

Q: 4. Draw the structural formulas for the four isomers of the butenes, C4Hs which are alkenes. Label…

A: Isomerism is the phenomenon in which more than one compounds have tha same chemical formula but…

Q: Calculate the standard enthalpy of formation for diamond, given that Reaction C (graphite) + O₂(g) →…

A: Thermodynamics is branch of chemistry in which we deal with amount of heat evolved or absorbed by…

Question

Consider the reaction
HCI(g) + NH3(g)- →NH4Cl(s)
Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 2.34 moles of HCI(g)
react at standard conditions.
ASO surroundings =
J/K

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
Under what conditions is the entropy of a substance equal to zero?
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
The standard molar entropy of iodine vapor, I2(g), is 260.7 J Kl mol-1 and the standard molar enthalpy of formation is 62.4 kJ/mol. a) Calculate the entropy change for vaporization of 1 mol of solid iodine (use data from Table 16.1 or Appendix J). b) Calculate the enthalpy change for sublimation of iodine. c) Assuming that rSdoes not change with temperature, estimate the temperature at which iodine would sublime (change directly from solid to gas).
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
Limestone is predominantly CaCO3, which can undergo the reaction CaCO3(s)CaO(s)+CO2(g). We know from experience that this reaction is not spontaneous, yet S for the reaction is positive. How can the second law of thermodynamics explain that this reaction is not spontaneous?
A key component in many chemical engineering designs is the separation of mixtures of chemicals. (a) What happens to the entropy of the system when a chemical mixture is separated? (b) Are designs for chemical separation more likely to rely on spontaneous or nonspontaneous processes?