Consider the standard reduction potential of the following reactions: Fe2+(aq) + 2e → Fe(s) ɛ° = -0.447 V Zn2+(aq) + 2e → Zn(s) E° = -0.762 V Calculate the Ecell (in V) for a voltaic cell made of a strip of metallic Zn dipped into 0.400 M Zn(NO32(aq) and a strip of metallic Fe dipped into 0.150 M Fe(NO3)2(aq) at 298 K. Assume all other cell components such as the salt bridge and the external wire (voltmeter) are in place. Link to Physical Constants Link to the Periodic Table

Consider the standard reduction potential of the following reactions: Fe2+(aq) + 2e → Fe(s) ɛ° = -0.447 V Zn2+(aq) + 2e → Zn(s) E° = -0.762 V Calculate the Ecell (in V) for a voltaic cell made of a strip of metallic Zn dipped into 0.400 M Zn(NO32(aq) and a strip of metallic Fe dipped into 0.150 M Fe(NO3)2(aq) at 298 K. Assume all other cell components such as the salt bridge and the external wire (voltmeter) are in place. Link to Physical Constants Link to the Periodic Table

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 135CWP: Consider a galvanic cell based on the following half-reactions: a. What is the expected cell...

See similar textbooks

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Consider the voltaic cell 2 Ag+(aq) + Cd(s) 2 Ag(s) + Cd2+(aq) operating at 298 K. (a) Calculate the Ecell for this cell. (b) If (cone. Cd2+) = 2.0 M and (cone. Ag+) = 0.25 M, calculate Ecell. (c) If Ecell = 1.25 V and (cone. Cd2+) = 0.100 M, calculate(cone. Ag+).
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The half-cells Fe2+(aq) | Fe(s) and O2(g) | H2O (in and solution) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the _______ electrode to the _____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the ______ half-cell.
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.
Consider a voltaic cell with the reaction H2(g) + Sn4+(aq) 2 H+(aq) + Sn2+(aq) operating at 298 K. (a) Calculate the Ecell for this cell. (b) Calculate the Ecell for PH2 = 1.0 bar, (cone. Sn2+) = 6.0 104M, (cone. Sn4+) = 5.0 104M, and pH = 3.60.