Consider the synthesis of sulphur trioxide from its elements at 25°C:+ 302(g) → 2SO3 (g)Calculate ArGo , using only Gibbs energyvalues.

The given chemical reaction is as follows: 14S8(s) + 3O2(g) → 2SO3(g) The ∆rG° of the reaction can…

Answered: Consider the synthesis of sulphur…

Consider the synthesis of sulphur trioxide from its elements at 25°C: S8(s) + 302(8) → 2SO3 (g) Calculate ArGo , using only Gibbs energy values.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.107QE: Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is...

See similar textbooks

Related questions

Q: The molar entropy of argon (Ar) is given by Sm= 36.4 + 20.8 In T (in SI units). Calculate the change…

Q: The molar entropy of argon (Ar) is given by Sm = 36.4 + 20.8 ln T (in SI units). Calculate the…

Q: Is change in Gibbs free energy for the melting of ice greater or less than zero? A>0 C.-0 D. It…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: Consider the reaction: C(s,graphite) + O2(g) (6)*00 Using standard absolute entropies at 298K,…

Q: Look up the boiling point of benzene. Then calculate the change in Gibbs Free Energy for che…

Q: At 373.15 K and 1.000 atm, the Gibbs energy change of vaporization of water is equal to zero, and…

Q: What is the difference in entropy between 25 g of N2 at standard conditions and 25 g of N2 at 400oC…

A: We have given that What is the difference in entropy between 25 g of N2 at standard conditions and…

Q: Calculate the change in entropy associated with the Haber process to produce ammonia from nitrogen…

A: N2 (g)+3H2 (g)⇌2NH3(g) So(H2) = 130.6 J/mol K So(N2) = 191.50 J/mol K So(NH3) = 192.5 J/mol K

Q: Calculate the Gibbs free energy change at 298 K for a mixture containing 1.5 atm H,º (g), 2(g), 2. 0…

A: We would use thermodynamics relation to calculate the value of change in Gibbs free energy ( ∆G ) .

Q: At 25 °C, the equilibrium partial pressures for the reaction A(g) + 2 B(g) 4 C(g)+D(g) were found to…

A: Given data :

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 3 B(g) = C(g) + 3 D(g) were…

A: We will. Calculate∆G°

Q: PE6.2 Calculate the standard molar Gibbs free energy change (AGran) at 298 K and at 400 K for the…

A: Standard molar Gibbs free energy change, is the change in free energy which occurs when one mole of…

Q: For a certain chemical reaction, the equilibrium constant K = ×1.410−6 at 10.0 °C .…

A: Given :- equilibrium constant (K) = 1.4 × 10-6 temperature (T) = 10.0 °C To be calculated :-…

Q: Calculate the change in the standard entropy of the system, ΔS°, for the synthesis of ammonia from…

Q: The absolute molar entropies of oxygon gas and nitrogen gas are 205 J mol-1 K-1 and 192 J mol-1 K-1…

A: Given : Molar entropy of N2 = 192 J/mol.K Molar entropy of O2 = 205 J/mol.K Moles of N2 = 9.2 mol…

Q: The entropy of argon is given to a good approximation by the expression Sm (in J/K•mole) = 36.36 +…

A: Solution - = -3891.32 J/mol = -3891.32*10^-3kJ/mol Answer = -3.89 kJ/mol

Q: In a particular biokgikal reaction taking place in the body at 37 C, the change in enthalpy was -125…

A: The change in Gibbs free energy is given by,∆G=∆H-T∆Sthe total entropy change for universe will be…

Q: At 25 °C, the equilibrium partial pressures for the reaction 2 A(g) + 4 B(g) =2C(g) + D(g) were…

Q: Calculate the change in entropy when 15.9 grams of argon (Ar) undergo isothermal compression from…

Q: hat is AG for the reaction ATP + H2O + ADP + P¡ in which the concentrations are ATP = x2 M, ADP = x…

Q: CALCULATE THE CHANGE OF ENTROPY OF GAS WHEN 16.08g of N2 nitrogen expands isothermally from 0.82L to…

A: Given information, Mass of nitrogen (m) = 16.08 g Temperature (T) = 290.7 K Initial Volume (V1) =…

Q: In the following image of a plot of Gibbs energy vs. Temperature, the intercept x is equal to what?…

A: The plot of Gibbs free energy v/s temperature is given as,

Q: Question attached

A: Given: Temperature=298K Formula: The standard entropy of the reaction can be calculated by using the…

Q: For a certain chemical reaction, the equilibrium constant K = 2.8 × 10° at 25.0 °C. Calculate the…

A: Answer:- This question is answered by using the simple concept of calculation od standard Gibbs free…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is 83.4 kJ. Calculate…

A: Given that, ∆G°= 83.4 KJ = 83400 J K= 2.4×10-15 T = ?

Q: Consider the reaction: СН (8) + H,0(g) →CH;CH,OH(g) Using standard absolute entropies at 298K,…

A: Given reaction is as follows,

Q: Calculate the standard reaction entropy at 298 K when 1 mol N2O(g) is formed from its elements in…

A: The involved chemical equation would be: N2 (g) + ½ O2 (g) → N2O (g)

Q: In the expression, S = k ln W, W is called the number of microstates. Explain clearly the meaning of…

A: There is a constant redistribution of energy among the particles in a system. At one instance,…

Q: Consider the reaction: 4HCI(g) + 02(g)–→2H,0(g) + 2C½(g) Using standard absolute entropies at 298K,…

A: Given- Moles of HCl = 1.92 mole Reaction = 4HCl (g) + O2 (g) →2H2O (g) + 2Cl2 (g) Temperature =…

Q: Water is heated from 25 °C to 35 °C. By how much does its chemical potential change? The standard…

A: Chemical potential (μi) It is called as partial molar Gibb's free energy. It is the change in Gibb's…

Q: In the expression, S = k In W, W is caled the number of microstates. Explain clearly the meaning of…

A: The system can exist in a discrete (but possibly infinite) set of microstates. A microstate defines…

Q: Calculate the standard entropy of formation of liquid ethanol at 25°C. [S°(Cgraphite) =…

A: If the standard entropies of formation of each substance are known, then the standard entropy change…

Q: Imagine that you want to work at constant pressure; Among the following options, which thermodynamic…

Q: What is the chemical significance of a positive Gibbs free energy change and what is the chemical…

A: The amount of energy available for doing some useful work is termed as free energy or Gibbs free…

Q: For a process that occurs at a constant temperature, does the change in Gibbs free energy depend on…

A: The Gibbs energy change can be defined by the expression as- ∆G=∆H−T∆S where ΔG: Gibbs Free Change…

Q: The standard molar entropy of benzene is 173.3 J K-1 mol-1. Calculate the change in its standard…

A: The given data contains, Standard molar entropy of benzene= 173.3 J/K.mol Temperature T1= 25°C=298 K…

Q: If the normal boiling point of a liquid is 67 °C, and the standard molar entropy change for the…

A: Standard molar enthalpy change can be expressed in terms of standard molar entropy change and…

Q: Calculate the standard reaction entropy of: H2 (g) + 1/2 02(g) - H2O(1) At 25 degrees Celsius.

Q: Considering perfect gases, which state function is zero when two substances are mixed? Entropy Gibbs…

Q: Calculate the measurable change in entropy (for the system) when the state of 2.00 mol of diatomic…

A: Change in entropy of system : VfVi = Tf × PiTi × Pf = 408 × 1.50298 × 7.00 = 0.2934 Cv = Cp - R =…

Q: At 25 ∘C25 ∘C, the equilibrium partial pressures for the reaction 3A(g)+4B(g)↽−−⇀2C(g)+3D(g)…

A: The reaction given is 3 A (g) + 4 B (g) ------> 2 C (g) + 3 D (g) Given : equilibrium partial…

Q: Recall that for a monoatornic ideal gas, CV = (3/2) *R . If an equal number of moles of any three…

A: For monoatomic ideal gas CV = (3/2)R Change in entropy is given as follows ∆S = -R [n1lnx1 +…

Q: Calculate the change in Gibbs free energy for each of the following sets of ΔH∘rxn , ΔS∘rxn , and T.…

A: ΔG∘ = ΔH∘ - TΔS∘

Q: Considering perfect gases, which state function is zero when two substances are mixed?…

Q: What would the entropy be for a system with 6.05E+1 microstates, in J/mol-K?

A: The relationship between number of micro-states with entropy is given as follows:

Q: 3) When 1mol of solid carbon reacts with 1mol of diatomic oxygen to produce 1mol o carbon dioxide,…

Q: Consider the reaction: H,(g) + C¿H4(g) →C¿H(g) Using standard absolute entropies at 298K, calculate…

A: Solution - According to the question - Given reaction - H2 (g) +C2H4 (g)--------> C2H6 (g) Given…

Q: The enthalpy of vaporization (deltaHvap) of water was experimentally determined to be 151.3 kJ for…

Q: 2.0 mol of hydrogen gas and 3.0 mol of argon gas are mixed at the same pressure and temperature,…

A: To determine the change in entropy and change in molar Gibbs free energy at 298.15K when 2.0 mol of…

Question

Consider the synthesis of sulphur trioxide from its elements at 25°C:
+ 302(g) → 2SO3 (g)
Calculate ArGo , using only Gibbs energy
values.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Determine the entropy change for the combustion of liquid ethanol, C2H5OH, under the standard conditions to give gaseous carbon dioxide and liquid water.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the decomposition of phosgene? COCl2(g)CO(g)+Cl2(g)
Explain why absolute entropies can be measured.
The third law of thermodynamics states that the entropy of a perfect crystal at 0 K is zero. In Appendix 4, F(aq), OH(aq), and S2(aq) all have negative standard entropy values. How can S values be less than zero?
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?