Answered: Consider the thermodynamic quantities…

Science

Chemistry

Consider the thermodynamic quantities E, 9, and w. Which of these quantities are state functions?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 30QRT

See similar textbooks

Related questions

Q: Explain how the internal energy and entropy of a system composed of two levels vary with…

A: SOLUTION: Step 1: Consider a two-state system in which the lower state is assigned an energy equal…

Q: How Gibbs free energy is determined by the volume of the substance ?

A: To find: relation between Gibbs free energy and volume?

Q: The variation of the Gibbs free energy of a given substance with temperature is given by G = aT + b…

Q: Explain how thermodynamic stability differes from kinetic stability. Can a substance or system be…

A: Kinetics is about how a reaction takes place, whether slow or fast.Thermodynamics is about if a…

Q: How can S be a state function when ΔS depends on q, which is not a state function?

A: Entropy of a system can be defined as the randomness or disorderness existing in the molecules of…

Q: 4. In an extensive property of a thermodynamic system (a) extensive heat is transferred (b)…

A: Extensive property of a thermodynamic system is the property which is dependent on the amount of…

Q: Provide and discuss two examples or application that shows the significance of the Second Law of…

A: Second law of thermodynamics : According to this law, heat always flows from a body at a higher…

Q: Differentiate between state and nonstate thermodynamic systems using suitable examples.

A: Thermodynamics is basically that branch of physics which deals with heat, work, and temperature.…

Q: Explain the single criterion for a physical process to be classified as spontaneous.

A: Spontaneous processes are the changes occur without work to be done on the system and it occurs…

Q: Which of (i) volume, (ii) heat, (iii) internal energy, (iv) density are state functions?

Q: What is the significance of entropy being a state function?

Q: Which thermodynamic quantities are not a state function?

A: Both path and state functions are frequently faced in thermodynamics. A thermodynamic property whose…

Q: The change in Gibbs' free energy is also considered a measure of the additional work that a system…

A: Given statement is : The change in Gibb's free energy is also considered a measure of the…

Q: why do so many thermodynamic processes happen in one direction but never the reverse?

A: There are two types of thermodynamic process based on the reversibility of the process- irreversible…

Q: What is the precise definition of entropy? What is the significance of entropy being a state…

A: Entropy is a thermodynamic state function that determines randomness in a system. When we raise…

Q: Describe the first and second laws of thermodynamics and how they relate tochemical reactions.

A: To find: The description about first and second laws of thermodynamics

Q: maximum amount of work

Q: Write any two consequences of the application of the second law of thermodynamics with suitable…

A: The universe entropy (also referred as randomness) always tend to increase in accordance with…

Q: Which of the following thermodynamic functions can be measured absolutely? A. Internal Energy B.…

A: Given : We have to tell which of the following can be measured absolutely.

Q: Under what circumstances does entropy of a system decrease for a spontaneous process

A: For any spontaneous process, the value of Gibbs free energy change i.e ΔG should be -ve And since…

Q: Define Gibbs energy.

A: Thermodynamics is the study of effects of work, heat and energy on a system. It basically tells how…

Q: what is the name of the symbol of the single thermodynamic quantity (function) which determines…

A: what is the name of the symbol of the single thermodynamic quantity (function) which determines…

Q: What thermodynamic quantity is used to determine whether a chemical reaction will proceed…

A: In the thermodynamic system we can determine which reaction is spontaneously or which reaction is…

Q: In the expression, S = k ln W, W is called the number of microstates. Explain clearly the meaning of…

A: There is a constant redistribution of energy among the particles in a system. At one instance,…

Q: 1. Given the thermodynamic equation, H =U + PV , use this and other thermodynamic equations to show…

Q: List the 3 conditions necessary for determining the standard change in a thermodynamic property,…

A: S is the entropy or the randomness of the thermodynamic system. G is the Gibbs free energy of the…

Q: What is the entropy (S) of a system with 6.4 x 1020 microstates?

A: The relation between entropy and number of microstates is given by Boltzmann's equation - S = KB ln…

Q: In the expression, S = k In W, W is caled the number of microstates. Explain clearly the meaning of…

A: The system can exist in a discrete (but possibly infinite) set of microstates. A microstate defines…

Q: Tick True or False: 1 - The basic principles of thermodynamics include the system, its limits, and…

A: Thermodynamics can be defined as the branch of chemistry that relates heat, work, energy and…

Q: Does the entropy of the surroundings increase for spontaneous processes?

A: The entropy is a measure of randomness of a system. In a spontaneous process, the entropy of the…

Q: calculate the differnce between the molar enthalpy and internal energy changes in the synthesis of…

A: ∆H = ∆E + ∆nRT Where ; ∆H = Molar enthalpy Change ∆E = internal energy Change ∆ n =Number of…

Q: Describe Gibbs' free energy and give an example of a spontaneous process.

A: The process which occur by itself without any external energy is known as spontaneous process.

Q: Define Thermodynamics ?

A: Thermodynamics is the branch of physical science which deals with the relations among heat and other…

Q: For a process that occurs at a constant temperature, does the change in Gibbs free energy depend on…

A: The Gibbs energy change can be defined by the expression as- ∆G=∆H−T∆S where ΔG: Gibbs Free Change…

Q: (1) What are the thermodynamlc quantitles of a system that affect the amount and algn of the…

A: a. i. The thermodynamic quantities that affect the amount and the sign of the internal energy change…

Q: Under what circumstance can the enthalpy of a system decrease for a spontaneous process?

A: Entropy measures the degree of randomness in the system. When a substance changes its phase solid to…

Q: Is there any connection between second law and third law of thermodynamics? Explain by giving…

A: Second law of thermodynamics states that the entropy of an isolated system always increases and…

Q: What is the entropy of a system that has only a single microstate?

A: Entropy is defined in the terms of randomness that a system possess or the disordered state. Change…

Q: Why do exothermic processes tend to be spontaneous at low temperatures?

A: Why do exothermic processes tend to be spontaneous at low temperatures?

Q: Give 3 application of first law of thermodynamics and each application give Explaination the…

A: The first law of thermodynamics is also known as the law of conservation of energy because according…

Q: Paraphrase the first and second laws of thermodynamics

A: To define: First and second law of thermodynamics.

Q: () What are the thermodynamlc quantitles of a system that affect the amount and sign of the Internal…

A: a. i. The thermodynamic quantities of a system that affect the amount and sign of the internal…

Q: The laws of thermodynamics can only be applied to a thermodynamic system; which is an open system…

Q: Thermodynamic state functions include enthalpy, entropy, and _____________.

A: Thermodynamic state function having four states, but here only two is given remaining has to be…

Question

Consider the thermodynamic quantities E, 9, and w. Which of these quantities are state functions?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

State function

VIEW

Answer

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What are the two ways that a final chemical state of a system can be more probable than its initial state?
A pot of cold water is heated on a stove, and when the water boils, a fresh egg is placed in the water to cook. Describe the events that are occurring in terms of the zeroth law of thermodynamics.
For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().
Define the term entropy, and give an example of a sample of matter that has zero entropy. What are the units of entropy? How do they differ from the units of enthalpy?
The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Explain why absolute entropies can be measured.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)