Solve all parts otherwise I will downvote.... Cryolite, Na, AIF, (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide.Balance the equation for the synthesis of cryolite.cquation: Al,0,(s) + NAOH(1) + HF(g)-Na, AlF, + H,O(g)If 12.3 kg of Al, 0,(6), 51.4 kg of NAOH(1), and 51.4 kg of HF(g) react completely, how many kilograms of cryolite willbe produced?mass of cryolite produced:kg Na, AlF,Which reactants will be in excess?O NaOHHFO Al,0,What is the total mass of the excess reactants left over after the reaction is complete?

Al2O3(s) + NaOH (l) + HF(g) ----> Na3AlF6() + H2O(g)

Cryolite, Na, AIF (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al,0,(s) + NAOH(1) + HF(g)- Na, AlF, + H,O(g) If 12.3 kg of Al, o,6), 51.4 kg of NAOH(1), and 51.4 kg of HF(g) react completely, how many kilograms of cryolite will be produced? mass of cryolite produced: kg Na, AIF, Which reactants will be in excess? NaOH HF O Al,0, What is the total mass of the excess reactants left over after the reaction is complete?

Cryolite, Na, AIF (s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al,0,(s) + NAOH(1) + HF(g)- Na, AlF, + H,O(g) If 12.3 kg of Al, o,6), 51.4 kg of NAOH(1), and 51.4 kg of HF(g) react completely, how many kilograms of cryolite will be produced? mass of cryolite produced: kg Na, AIF, Which reactants will be in excess? NaOH HF O Al,0, What is the total mass of the excess reactants left over after the reaction is complete?

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Similar questions

Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
What is the mass of fish, in kilograms, that one would have to consume to obtain a fatal dose of mercury, if the fish contains 30 parts per million of mercury by weight? (Assume that all the mercury from the fish ends up as mercury (II) chloride in the body and that a fatal dose is 0.20 g of HgCl2.) How many pounds of fish is this?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
One of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.
Chlorine exists mainly as two isotopes, 37Cl and 33Cl. Which is more abundant? How do you know?
Write a balanced equation for the reaction between (a) dihydrogen sulfide and sulfur dioxide gases to form sulfur solid and steam. (b) methane, ammonia, and oxygen gases to form hydrogen cyanide gas and steam. (c) iron(lll) oxide and hydrogen gas to form molten iron and steam. (d) uranium(IV) oxide and hydrogen fluoride gas to form uranium(IV) fluoride and steam. (e) the combustion of ethyl alcohol (C2H5OH) to give carbon dioxide and water.
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.