Detemine the pOH of each solution and classify it as acidic, basic, or neutral. (a) [OH]= 1.5 × 10º M (b) [OH] = 7.0 × 10-5M (c) [OH¯]= 1.0 × 10-7 M (d) [OH]] = 8.8 × 10-³ M

Q: The Ksp of aluminum hydroxide, Al(OH)3, is 2 × 10−31. What pH is required to limit the Al3+…

A: Al(OH)3 (s) ------> Al3+ (aq) + 3 OH- (aq) The Ksp of the reaction is given by  Ksp = [Al3+] X…

Q: The hydroxide ion concentration, [OH-], of an aqueous solution of 0.424 M ethylamine (a weak base…

A:

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 5.3 × 10⁻⁴ M, then [OH⁻] is:

A: Given [H3O+] = 5.3*10^-4 M  Kw = [ H3O+][OH-]

Q: The hypochlorite ion, ClO-, acts as a weak base. When ClO- acts as a base, which atom, Cl or O, acts…

A: To know which is the proton acceptor we see the valancy of the Cl and the O. In O there is two…

Q: What is the pH of a 0.0810 M solution of HONH;CI (Kb of HONH2 is 1.1 x 108)?

A: Given,                HONH3Cl -----> HONH3+ + Cl-  Hydrolysis of the weak conjugate acid, HONH3+…

Q: If an acid, HA, dissociates to 0.1% when added at a final concentration of 0.05M in water, that is:…

A: 1- First calculate the H3O+ ion concentration :  [H3O+] = ( Concentration ) × ( Degree of…

Q: The hypochlorite ion, ClO-, acts as a weak base. (a) Is ClOa stronger or weaker base than…

A: (a) Since, the basic character is generated by the donation of lone pair electrons of N in…

Q: What is the pH of a 0.0520 M solution of HONH;CI (Kb of HONH2 is 1.1 x 10-8)?

A: HONH3Cl is a salt of weak base HONH2 and strong acid HCl Recall the following expression to…

Q: It Senwater has a pH of 8.45, then what is the LOH]? ot

A:

Q: What is the pH of a solution with a pOH of 6.7?

A: Given: pOH of the solution = 6.7

Q: A 0.54 M solution of chloroacetic acid, CICH2 CO2H, has a pH of 1.57. Calculate K, for the acid. %3D

A: Given: The molarity of the solution of chloroacetic acid = 0.54 M The pH of the solution = 1.57 We…

Q: You have a 0.0685 M solution of Ca(OH)2, what is the pH of your solution?

A:

Q: A solution has a proton concentration of 0.00239 M, what is its pH?

A: Given : Concentration of proton i.e H+ ions, [H+ ] = 0.00239 M

Q: calculate the pH of the solution eith an H+1 concentration of 2.90×10-12 and identify the solution…

A: Given,  The concentration of H+ = 2.90 × 10-12 M The pH of the solution is:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: Determine the pH of each of the following solutions (Ka and Kb values are given in Appendix D): (a)…

A: Given The acid-dissociation constant (Ka) for hypochlorous acid is 3.0 x10-8. The initial…

Q: In the year 1980, countries near the United States experienced an increase in acid precipi- tation.…

A: The burning of Fossil fuels produces acidic oxide like sulfur dioxide or nitrogen dioxide etc. which…

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 1.3 × 10⁻⁴ M, then [OH⁻] is:

A: [OH-] = 7.7 x 10-11 M

Q: The pOH of a basic solution is 3.91. What is [OH⁻]?

A:

Q: In an aqueous solution at 25°C, if [H3O*] = 8.0 × 10-ª M, then [OH"] is:

A:

Q: . Alcohols can act either as weak acids or as weak bases, just as water can. Show the reaction of…

A:

Q: the pH of an acid solution is 3.59. If the concentration of the acid in the solution is 0.200 mol/L,…

A: Given Concentration of the acid=0.2 mol/LpH of the acid solution=3.59Ka of thel acid=??

Q: A 0.050 M solution of a weak acid (HA) has a pH of 4.70. What is the Ka of the acid?

A: We will have the below reaction taking place. HA ----> H+ + A- Since pH = -log[H+] where [H+] =…

Q: The compound ethylamine is a weak base like ammonia. A solution contains 0.111 M C,H5NH3* and 0.406…

A:

Q: calculate the concentration of H + in a solution of hypochlorous acid (I) of 1 mol / liter. In your…

A: Given is Solution of 1M hypochlorous acid. i.e. [HOCl] = 1 M We need to find concentration of [H+]…

Q: The pH of a 0.0492 M solution of a weak acid is 2.641. What is the Ka of the acid?

A: pH= 2.641

Q: . What is the pH of a solution that contains 0.35 mol/L of the strons base NaOH?

A:

Q: Given that the pH is 10.285 What is the: [H3O+] pOH [OH-] Is it an acid or base?

A: It is given that the pH of a solution is 10.285 and the [H3O+], the pOH and [OH-] needs to be…

Q: Which of the following reactions go to completion? (Select all that apply.) O Autoionization of…

A: The reaction in which reactant totally converts into product always goes for completion.

Q: The concentration of CH3COOH (pKa=4.75) in vinegar is about 1.0 M. With this what do you predict the…

A: pH is the negative logarithm of Hydrogen ion concentration. pH of a solution can be calculated as:…

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 6.7 × 10⁻⁴ M, then [OH⁻] is

A: In an aqueous solution [H₃O⁺] ×   [OH⁻]  = Kw

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 2.4 × 10⁻⁴ M, then [OH⁻] is:

A: we have, [H3O+] =2.4 x10-4 M To calculate the concentration of OH-, firstly calculate the PH  of the…

Q: A study of the acid shows that the pH of an acid HA O.12 MIK2.62. What is the K, of this acid?

A: Acid Dissocaition constant, Ka has to be determined for the Acid HA of 0.12 M with pH 2.26.

Q: The pH of an acidic solution is 5.75. What is [OH⁻]?

A:

Q: For  K w, the product of [H 3O +] and [OH -] is

A: Kw is the water constant and is defined as product of hydronium ion and hydroxyl ion  Kw = [H3O+]…

Q: What of the following options describes the term "pH and pOH"? O a. The negative logarithm (base 10)…

A: •pH=> it is a scale to determine the concentration of H+ ion. •pOH=>It is a scale which…

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 6.2 × 10⁻⁴ M, then [OH⁻] is:

A: pH +pOH = 14

Q: Which of the following statements is/are true? (Select all that apply) OThe higher the concentration…

A:

Q: The pOH of an aqueous solution of 0.591 M phenol (a weak acid), C,H5OH, is

A:

Q: HA and HB are both weak acids in water, and HB is a stronger acid than HA. Which of the following…

A: Given-> ->HA and HB both are weak acid . ->But HB is stronger acid than HA.

Q: weak base is 2.5 × 10-6, what is the pH of a 0.23 M solution of this base?

A: From the relation, pOH is calculated as,

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 1.1 × 10⁻⁴ M, then [OH⁻] is:

A: We know that  Kw  for water  =  10-14 at 25oC Given [H3O+] concentration is 1.1×10-4 M      [ OH-] =…

Q: The hydroxide ion concentration of an aqueous solution of 0.325 M phenol (a weak acid) , C6H5OH, is…

A:

Q: The pOH of an aqueous solution of 0.590 M phenol (a weak acid), C6H5OH, is _____

A:

Q: MgO is added to liquid ammonia as shown in the following equation: NH;() + MgO(s) –---> NH,¯(in NH,…

A: An acid is a chemical compound that donates or loses hydrogen atoms and gets converted into a…

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 2.1 × 10⁻⁴ M, then [OH⁻] is

A:

Q: f the pOH is 6.2, the pH is

A: pH = -log[H+] pOH = 14 - (-log[H+]) pOH = 14 -pH Given in the question, pOH = 6.2

Q: What substance(s) have a pH most similar to that of water (pH 7)?

A: Salt of strong acid and strong base have a pH similar to that of water i.e. pH = 7.

Q: The pOH of a basic solution is 3.67. What is pH?

A:

Q: The pH of a solution that has measured (H+) of 6.8*10^-9 M is

A: We have given that   [H+] = 6.8×10-9M  pH is measure the acidity and basicity of aqueous…

Introduction to chemistry

Chemistry is a branch of science that deals with the analysis of material and the substances that comprise it. It also manages the properties of these substances and their reactions to form new substances. It is basically centered on particles and atoms that make up components and mixtures. These chemical species will in general connect using bonds.