Determine K for3 0A + BC + BK1.13x10-C K 1.00x10-21.00x10- D K = 1.00x104 1.00x10K 1.00x10C.%3DA + 2 BK, forG HBrD2 Fe 6 Br+3H.OH'OMSOH HCIIf at equilibrium [D] = 1.00 M, what is the concentrationof A and B?e RtOL1.00Mlo00X10 00x40=(00X10HC K1

Answered: Image /qna-images/answer/555bed01-e2e1-4402-aee6-79ad8b70c607.jpg

Determine K for 3 0 K A + B C + B K 1.13x10 -C K 1.00x10-21.00x10 e D K = 1.00x104 1.00x10 K 1.00x10 C. A + 2 B K, for G HBr D 2 Fe G Br+3H.O H'O MSOH HCI If at equilibrium [D] = 1.00 M, what is the concentration of A and B?e RtOL 1.00M [A] lo00 X10 00X0 HC K 1

Determine K for 3 0 K A + B C + B K 1.13x10 -C K 1.00x10-21.00x10 e D K = 1.00x104 1.00x10 K 1.00x10 C. A + 2 B K, for G HBr D 2 Fe G Br+3H.O H'O MSOH HCI If at equilibrium [D] = 1.00 M, what is the concentration of A and B?e RtOL 1.00M [A] lo00 X10 00X0 HC K 1

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 14.89QE

See similar textbooks

Similar questions

What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of CI2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm? Cl2(g)+Br2(g)2BrCl(g)KP=4.7102
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
What is the minimum mass of CaCO3 required to establish equilibrium at a certain temperature in a 6.50-L container if the equilibrium constant (Kc) is 0.050 for the decomposition reaction of CaCO3 at that temperature? CaCO3(s)CaO(s)+CO2(g)
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?