At particular temperature, 7.3 moles of A is placed into 1.0 L container and A dissociate by the reaction 2A(g) ---> 2B(g) +C(g). (---> is equilbrium sign) ... At equilibrium the concentration of B(g) is 2.0M. Calculate K for this reaction O a. 0.10 Ob. 0.28 Oc. 0.11 O d. 0.04 O e. 0.14

At particular temperature, 7.3 moles of A is placed into 1.0 L container and A dissociate by the reaction 2A(g) ---> 2B(g) +C(g). (---> is equilbrium sign) ... At equilibrium the concentration of B(g) is 2.0M. Calculate K for this reaction O a. 0.10 Ob. 0.28 Oc. 0.11 O d. 0.04 O e. 0.14

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 25E: For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular...

See similar textbooks

Related questions

Q: studying the equalibrium of Fe3+ and SCN- with FeSCN2+ Fe3+ (aq) + SCN- (aq) =FeSCN2+ (aq) a.…

A: When the net concentration change of reaction's species gets vanished and no observable decline in…

Q: An aqueous mixture of hydrocyanic acid, HCN, and ammonia, NH3, has initial concentrations of 0.100…

A: Given : Concentration of HCN(aq) = 0.100 molL-1 or M Concentration of NH3(aq) = 0.140 molL-1 or M…

Q: A gaseous mixture contains 0.29 mol CO, 0.10 mol H,, and 0.018 mol H,O, plus an unknown amount of…

A: Moles of CO = 0.29 mol Moles of H2 = 0.10 mol Moles of H2O = 0.018 mol Volume = 1L for each species…

Q: Solid BaSO4 dissolves to give its constituent ions in aqueous solution: BaSO4(s) = Ba2*(aq) +…

Q: At 613 K, K. 0.064 for the reaction Fe,O3(s) + 3H,(g) Z 2Fe(s) + 3H,O(g) a) What are the units of K,…

A: Temperature T = 613 K Equilibrium constant Kc = 0.064 Reaction is, Fe2O3 (s) + 3 H2 (g) <->…

Q: The diagram represents a 1.0 L aqueous equilibrium system of this compound at 25°C, where each…

A: Given : Different particles in a diagram. To find : percentage ionization of this compound.…

Q: A chemist is studying the following equilibirum, which has the given equilibrium constant at a…

A: Given that, an equilibrium reaction is N2g+3H2g⇔2NH3g. The equilibrium constant is Kp =1×10-6. Also,…

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: Assuming the above reaction is exothermic in the forward direction (toward the product side),…

Q: It is determined that the equilibrium concentrations of F e3+, SCN° and [F e SCN2+] are 8.20 x 10-4…

A: Since no reaction is mentioned, hence we are assuming that the complex formation reaction is…

Q: Sample.sakulatim Show your work for the following caleulations uning data from sample E a) Initial…

Q: The chemicals A and B react as follows to produce C and D: A + B ↔…

Q: A student ran the following reaction in the laboratory at 507 K: PCI,(g) + Cly(g) PC(g) When she…

A: Given: Initial moles of PCl3 = 0.172 mol Initial moles of Cl2 = 0.208 mol volume of container = 1.0…

Q: see picture!!

A: Sub-part (a): For the given reaction, the equation for equilibrium constant can be written as above.

Q: can you say about the cofipUSILIUT UI ie at equilibrium? O There will be very Neither of the abc um…

A: 1.Here, the value of equilibrium constant is less then 1. So, product concentration is less. There…

Q: Determine K for 3 0 K A + B C + B K 1.13x10 -C K 1.00x10-21.00x10 e D K = 1.00x104 1.00x10 K 1.00x10…

Q: Consider the following equilibrium maintained at a constant temperature; 2A(aq) =B(aq) In an…

A: Kc is the ratio of product of concentration of products raised to their stoichiometric coefficient…

Q: Equilibrium. (2) Write the Ke expression for the following balanced equilibrium reaction. N2 (g) + 3…

A: The reaction given is hence the equilibrium constant expression is where [H2 ] = equilibrium…

Q: 0.030 moles of a weak acid, HA, was dissolved in 2.0 L of water to form a solution. At equilibrium,…

Q: A solution of 0.28 M concentration of ammonia, has been prepared, the Kb value for ammonia is 1.8 x…

A: Ammonia dissociation presence of water and produce ammonium ion and OH - ion

Q: Hello, I'm working on equilibriums, I'm not quite sure how to do this type of question with finding…

A: Given that, an equilibrium reaction is CO(g) + H2O(g) ↔CO2(g) + H2(g). Also, the equilibrium…

Q: 3. For the equilibrium: 0.600 mol IBr is placed in a liter container. 2 IBr (g) + I2 (g) + Brz (g),…

Q: Mg3(PO4)2 (s) Mg2*(aq) + _ PO43- (aq) Mg2*(aq) PO43 (aq) lo initial change eqm At a certain…

A: First, we have to balance the equation. While balancing a chemical equation we make sure that both…

Q: Find the equilibrium contentration of Cu* (mol/L) wbun Ecell = 0.48 V. use this regult along with…

A: Equilibrium constant of a reaction is defined as the ratio of product of molar concentration of…

Q: Consider the following hypothetical reaction, where R is some element. N2OH + HR $ NaR + H20 1 mole…

Q: This is A study of how stressing a second equilibrium can affect an equilibrium when we added…

A: A chemical reaction is symbolic representation of the conversion of substances to new substances. In…

Q: Suppose a 250. mL flask is filled with 0.40 mol of OCl,, 1.6 mol of BrOCl and 1.8 mol of BrCl. The…

A: Any reaction's "equilibrium constant" tends to exhibit relationship among species reacting as well…

Q: A student ran the following reaction in the laboratory at 642 K: 2HI(g) H2(g) + I2(g) When she…

A: Let us first calculate the initial concentration of HI, [HI] =…

Q: In an aqueous solution of a weak acid, HA, the assumption is often made that [HA]equilibrium =…

A: Let the initial concentration of HA be x. Then equilibrium concentration of HA is: 100-9.98100x…

Q: Calculating equilibrium composition from an equilibrium constant Suppose a 250. mL flask is filled…

Q: For the reaction at equlibrlum: 3Fe(s) + 4H2O(g) = Fe3O4ls) + 4H>(g), removing some of the product.…

A: At equilibrium, the rate of the forward and the reverse reaction is the same and the concentration…

Q: 10. For the equilibrium system PCls PCl, + Cl2 , Kg 35. If the concentrations of PCI, and PC, are…

A: Equilibrium constant( Keq) :- The equilibrium constant of a chemical reaction provides the…

Q: At a certain temperature, the equilibrium constant, ?c, for this reaction is 53.3.…

Q: Suppose a 250. mL flask is filled with 0.10 mol of Br,, 1.7 mol of OCl, and 0.20 mol of BrCl. The…

A: GIVEN: Volume of the flask= 250 mL Moles of Br2=0.10 mol Moles of OCl2 =1.7 mol Moles of BrCl = 0.20…

Q: Steam reforming of methane ( CH, ) produces "synthesis gas," a mixture of carbon monoxide gas and…

Q: A chemist is studying the following equilibirum, which has the given equilibrium constant at a…

A: The given chemical equilibrium is as follows: 3O2(g) ⇌ 2O3(g) Kp=7×10-6 The initial…

Q: The K for Al(OH)= 2.010at 25.0 C. How many grams of aluminum hydroxide will dissolve in 1.00 L of…

A: Grams of aluminium hydroxide can be calculated as follows

Q: Suppose a 500. mL flask IS TIlled with 0.70 mol or Br2, 1.8 mol or BroCi and 1.1 moi or BrCI. The…

A: The question is based on the concept of chemical equilibrium. we have to calculate equilibrium…

Q: At a certain temperature, the equilibrium constant, ?c, for this reaction is 53.3.…

A: First find the concentration of H2 and I2. The equilibrium constant, Kc for the reaction is 53.3.

Q: For the following reaction, K = 0.538 at 313 K. N2O4 (g) = 2NO2 (g) If a reaction vessel…

Q: It is determined that the equilibrium concentrations of F e3+, SCN- and [F e SCN2+] are 5.00 x 10-4…

Q: Suppose a 250. mL flask is filled with 1.2 mol of Br,, 1.4 mol of OCl, and 1.1 mol of BrCl. The…

Q: Which of the following statements about the reaction quotient, Q, is false? O a. If Q > Kc, the…

Q: Consider the following system at equilibrium where AH° =-111 kJ/mol, and K. = 0.159 , at 723 K. N2…

A: The equilibrium reaction can be given as follows: N2(g)+3H2(g)↔2NH3(g) The values of enthalpy change…

Q: Sulfur dioxide and oxygen react to form sultur triaxide dunng one of the key steps in sulfunc acid…

A: Given moles of sulfur dioxide (SO2) = 6.4 moles moles of oxygen (O2) = 30 moles equilibrium moles of…

Q: ong will have a higher K value. bases will have a higher percent ionization [OH ] equilib B initial…

A: Given: The given concentration of NH3=0.44 M Kb=1.8×10-5 If an aqueous solution of NH3 is made then…

Q: A student determines that an aqueous solution that contains 0.254 M sodium acetate and 0.417 M…

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Question

meral Chemistry -Spring21
Time let
ion
At particular temperature, 7.3 moles of A is placed into 1.0 L container and A dissociate by the reaction
2A(g) ---> 2B(g) +C(g). (---> is equilbrium sign)
At equilibrium the concentration of B(g) is 2.0 M. Calculate K for this reaction
ut of
O a. 0.10
Ob. 0.28
Oc. 0,11
O d. 0.04
Oe.0.14
NEXTAG
EVIOUS PAGE

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.
Iodine chloride decomposes at high temperatures to iodine and chlorine gases. 2ICl(g)I2(g)+Cl2(g)Equilibrium is established at a certain temperature when the partial pressures of ICl, I2, and Cl2 are (in atm) 0.43, 0.16, and 0.27, respectively. (a) Calculate K. (b) If enough iodine condenses to decrease its partial pressure to 0.10 atm, in which direction will the reaction proceed? What is the partial pressure of iodine when equilibrium is reestablished?
Red phosphorus is formed by heating white phosphorus. Calculate the temperature at which the two forms are at equilibrium, given white P: H f =0.00 kJ/mol; S =41.09 J/mol K red P: H f =17.6 kJ/mol; S =22.80 J/mol K
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
For the system PCl5(g)PCl3(g)+Cl2(g)K is 26 at 300C. In a 1.0-L flask at 300C, a gaseous mixture consists of all three gases with the following partial pressures: PPCl5=0.026atm,PPCl3=0.65atmPPCl2=0.33atm (a) Is the system at equilibrium? Explain. (b) If the system is not at equilibrium, in which direction will the system move to reach equilibrium?
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
Consider the decomposition equilibrium for dinitrogen pentoxide: 2N2O5(g)4NO2(g)+O2(g) At a certain temperature and a total pressure of 1.00 atm, the N2O5 is 0.50% decomposed (by moles) at equilibrium. a. If the volume is increased by a factor of 10.0. will the mole percent of N2O5 decomposed at equilibrium be greater than, less than. or equal to 0.50%? Explain your answer. b. Calculate the mole percent of N2O5 that will be decomposed at equilibrium if the volume is increased by a factor of 10.0.
Consider the following hypothetical reaction: X2(g)+R(s)X2R(g) R has a molar mass of 73 g/mol. When equilibrium is established, a 2.5-L reaction vessel at 125C contains 15.0 g of R, 4.3 atm of X2, and 0.98 atm of X2R. (a) Calculate K for the reaction at 125C. (b) The mass of R is doubled. What are the partial pressures of X2 and X2R when equilibrium is reestablished? (c) The partial pressure of X2 is decreased to 2.0 atm. What are the partial pressures of X2 and X2R when equilibrium is reestablished?
Lexan is a plastic used to make compact discs, eyeglass lenses, and bulletproof glass. One of the compounds used to make Lexan is phosgene (COCI2), an extremely poisonous gas. Phosgene decomposes by the reaction COCl2(g)CO(g)+Cl2(g) for which KP = 6.8 109 at 100C. If pure phosgene at an initial pressure of 1.0 atm decomposes, calculate the equilibrium pressures of all species.
At 2000 K, experiments show that the equilibrium constant for the formation of water is 1.6 1010. 2H2(g) + O2(g) 2H2O(g) Calculate the equilibrium constant at the same temperature for H2(g)+12O2(g) H2O(g)
The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?