Q: Drawing the Products of the Chlorination of an Alkane Draw all the constitutional isomers formed by…
A: The isomers are as given below:
Q: 2-methyl-3-pentanone + Ethanol он он A. C. HO OH В. D.
A:
Q: Explain why CH3CH,NHCH3 has a higher boiling point than (CH3);N, even though they have the same…
A: When vapor pressure of a substance becomes equal to the atmospheric pressure then the temperature at…
Q: 8. What is the IUPAC name of CH;CH,CH2 ? CH3-CH-O-CH, CH3 Da. 1-ethoxy-1-methylbutane Ob.…
A: The IUPAC name of the compound is given in following step.
Q: How is ethyl methyl ketone prepared from 1-bromobutane?
A: Given reaction,
Q: Draw all constitutional isomers formed by monochlorination of each alkane.
A:
Q: Draw the products formed when cis- and trans-but-2-ene are treated with CHCl3 and KOC(CH3)3
A:
Q: What reagents are needed to convert 1-ethylcyclohexene into (a) 1-bromo-2-ethylcyclohexane; (b)…
A: The reagent used to convert the 1-ethylcyclohexene into 1-bromo-2-ethylcyclohexane is HBr in…
Q: 1. Which kinds of hydrocarbon are good for gasoline and diesel oil? Why is petroleum, which is rich…
A: Diesel fuel is thicker than gasoline, which means it evaporates slower. Diesel fuel also has more…
Q: 8. Name each alkyne. A. CH3CH2CH2C=CH B. CH3CH2CH2C=CCH3
A:
Q: Classify each alkene in the attached vitamins by the number of carbon substituents bonded to the…
A: The number of carbon atoms attached to the double bond gives the classification of the alkene. When…
Q: Br CH3 || H3C-CH-CH2-CH-CH2-C-OH IUPAC Br CH3 || H3C-CH-CH2-CH-CH2-C-OH
A: IUPAC is the universal name of the compound
Q: Draw ethylcyclopentane
A:
Q: HCI CH, но. CHs Solvent: Toluene H;C CH3 .CI KOC(CH 3)3 Solvent: Toluene -CH3 CH3
A:
Q: In an addition reaction to an alkene, the π bond plays the role of: A.nucleophile B.electrophile…
A: Introduction : In chemistry addition reaction are those reaction in which two or more molecule are…
Q: III II Which alkene is least stable?
A: Stability of alkene increases with the increasing number of substitutents. So, greater the number…
Q: b)
A: An alkene is carbon double bond carbon with 2 hydrogen on each carbon. A substitution replaces H…
Q: Draw a cyclic ether with molecular formula C5H10O
A: Given Molecular formula = C5H10O Structure of Cyclic ether = ?
Q: ving alcohol would be classified as: ry dary ry mary -CH₂-CH- OH ving compound would be classified…
A:
Q: Draw the structure of (Z)-but-2-ene.
A:
Q: a terminal alkene that
A:
Q: What alkenes are formed when attached alcohol is dehydrated with TsOH?Label the major product when a…
A: The alcohol group in reactant is at a carbon bearing two alkyl substituents. Hence, it is a tertiary…
Q: What reagents are needed to convert 1-ethylcyclohexene into (a) 1-bromo-2ethylcyclohexane; (b)…
A:
Q: 8. Give the IUPAC name for each alkene. CH3 CH2CH2CH3 C=C Br a.
A: The given compound consist of an double bond between two carbon atoms. Hence, it is an alkene.
Q: H2, Pd/C A C-CEC-CH в H2, Lindlar catalyst B.
A:
Q: Give a common name for each compound CH3 (е) (CH,),С—о—ҫн CH3
A: General names of ether is given by using the names of alkyl groups directly bonded to oxygen atom
Q: Is this correct? Benzene reacts with CH3CH(CH2CH2CH3)CH(Cl)CH2CH3, catalyst ALCl3
A: Friedel Crafts Reaction is a reaction in which alkyl halide or aryl halide is treated with benzene…
Q: 3. Give the IUPAC name for each alkene. a. b. Br OCH3 d. С.
A: To write the name of each structure, use the below rules. Identify the parent carbon chain in each…
Q: What are the products of each aromatic substitution reaction? H FeBr, H, H + Br2 a. H. H CH, AICI,…
A: Aromatic substitution It is the substitution reaction in which hydrogen on an aromatic ring is…
Q: .A There is no relationship between them .B equal in boiling point .C higher than the boiling point…
A: Boiling point is defined as the amount of heat required to vaporize a liquid. this depends on…
Q: a. 1-Methylcyclopentanol b. trans-2-Methylcyclopentanol
A:
Q: LOH HO. 1. Which is a chiral alcohol? 2. Which alcohol forms only one alkene product upon…
A:
Q: 2. Write the IUPAC name of each alkene. a. b.
A: (1.) Index of hydrogen deficiency ( IHD): Cyclohexene ( C6H10): IHD = Total number of H atoms in 6…
Q: (organic substances only.) a) HO acud b) Cg-cHー NaOH + CHy-CHy-C O Cy-CH-CH-E-OH City Cty LIOH one…
A: On the basis of reaction type whether it is substitution or elimination etc we will decide the…
Q: A PCC hexanal C D PCC 2-methylnonane 2-methyl-4-nonanol
A:
Q: Which compound corresponds to an unsaturated hydrocarbon? A) methoxyethane B) butanal C) propionic…
A: Welcome to bartleby! Introduction : We have to tell which compound corresponds to an unsaturated…
Q: 6. HO Classify each alkyl halide as 1°, 2°, or 3°. CH3 c. CH3-C-CHCH3 CH3 ČI F a. CH3CH,CH,CH,CH,-Br…
A: Classify the alkyl halide as primary, secondary or tertiary ?
Q: CH3CH=CHCH=CH2
A: There are 5 carbons in the chain labelled from 1 to 5. Hence the parent alkane is pentane there are…
Q: A reaction of an alkene plus H2O and excess acid.
A: Interpretation- To write a reaction of alkene which take place in presence of H2O and excess acid-…
Q: + H20 CH3- CH-C-CH3
A:
Q: Alkenes are not soluble in water because they are
A: The correct reason for alkenes not being soluble in water is to be selected- polar hydrophilic…
Q: a) b) c) hexanal a) b) c) 2- butanone
A: In the given question, the IUPAC name of the compounds has to be determined. (a)
Q: 6. Draw the correct structures for the following: a. what is the correct structure of 2-heptene?…
A: The given names are IUPAC names. So, we need to infer the structure of the organic molecules from…
Q: Give the IUPAC name for each alkene.
A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…
Q: Be sure to answer all parts. Draw the structure corresponding to each IUPAC name. a.…
A: The structure of an organic compound is written in the following steps: Determine the number of…
Q: What alkane is formed when each alkene is treated with H2 and a Pd catalyst?
A: The reduction of alkenes or alkynes to alkanes is a simple organic reaction in which hydrogen atoms…
Q: Give the IUPAC name for each nitrile.
A: a. 4-chloro-2-methylhexanenitrile b. 2,3-diethyloctanenitrile c.…
Q: Name the three alkenes using systematic names. H3C CH3 A. H3C The name of compound A is: CH2 B. CH3…
A:
Step by step
Solved in 2 steps
- a. What is the chemical structure of biphenyl, circle functional groupsdifferent than alkane, alkene, alkyne? b. Is it polar or nonpolar? _______________________ c. What is its water solubility in g/L? __________________________a. What is the chemical structure of 2,6-dichloroindophenol, circle functional groups differentthan alkane, alkene, alkyne? b. Is it polar or nonpolar? _______________________ c. What is its water solubility in g/L? ___________2. a. What is the chemical structure of naphthalene, circle functional groups different than alkane,alkene, alkyne? b. Is it polar or nonpolar? _______________________ c. What is its water solubility in g/L? _________________________
- 3. a. What is the chemical structure of benzoic acid, circle functional groups different than alkane,alkene, alkyne? b. Is it polar or nonpolar? _______________________ c. What is its water solubility in g/L? __________________________What is the name of the alkene? CH3CH=CHCH=CH2Draw the structure of (Z)-but-2-ene.
- (a) which a disubstituted cis- alkene? (b) which is the geometric isomer of D? (c) which is a tri-substituted Z- alkene? (d) which is the most stable alkene? (e) which has the highest boiling point? (f) which has the highest MP?What alkylborane is formed from hydroboration of each alkene?(a)({)-hexane-3,4-diol, draw any enantiomer.