2. Write the IUPAC name of each alkene. a. b.

Q: Give the IUPAC name for each attached compound

A: IUPAC (International Union of Pure and Applied Chemistry) gives the systematic name of the chemical…

Q: From the IUPAC name of an alkane orsubstituted alkane, be able to draw thestructure

A: IUPAC nomenclature is the naming of the chemical compound as recommended by the International Union…

Q: Draw all constitutional isomers formed by monochlorination of  attached alkane ?

A: In monochlorination process, the hydrogen atom in an alkane compound is replaced by the chlorine…

Q: Write

A: Since you have asked a question with  multiple sub-parts, we will solve  first three sub-parts for…

Q: Please write the IUPAC names of each structure.

A: We have given the organic compound and we have to find the IUPAC Name of the given compound.

Q: Give the IUPAC name for each compound.

A: Rues for IUPAC nomenclature 1. Select the longest chain.  2. Give numbering in such a way that the…

Q: Give the IUPAC name for each compound.

A: (a) CH3-CH2-CH2-CH2-CH(CH3)-CH2-CH3  IUPAC name : 3-methylheptane (b)  IUPAC name :…

Q: Provide the IUPAC names for each compound.

A:

Q: Explain why A is less water soluble than B, even though both compounds have the same functional…

A: Since in molecule 1, both C=O and the OH are near to each other. Hence they will have internal H…

Q: Several factors can affect alkene stability. Explain why alkene A is more stable than alkene B even…

A: Alkene stability is decided by Saytzeff’s rule which says that more substituted alkene is more…

Q: Give the IUPAC name of each compound.

A: Rules to write the IUPAC name. 1) First locate the longest carbon chain. 2) Then locate all the…

Q: How many alkyl substituents are attached to the parent chain?

A: Alkyl substituents are also known as the side chains.

Q: 1. Give the IUPAC name for each compound. d. b.

A: All chemical compounds can be named with certain rules which are purposed by IUPAC. It purposed to…

Q: Iupac name for it

A: We know that  Basic rule of IUPAC Nominclature : 1. select longest continues chain of carbon carbon…

Q: Give the IUPAC name for each molecule depicted in the ball-and-stick models.

A: Here the molecule is  HCCCH2CH2CH2CH2CH3 HENCE THE IUPAC nomenclature for this compound is,…

Q: Draw ethylcyclopentane

A:

Q: Explain why A is less water soluble than B, even though both compounds have the same functional…

A: 3.67 Since in molecule 1, both C=O and the OH are near to each other. Hence they will have…

Q: Give the IUPAC name for each compound.

A: Please find below the IUPAC name along with the structure of the molecule. Since we have longest…

Q: Write the IUPAC name for   compound.

A: The IUPAC name of the compound gives the identification to the compound and gives precise naming of…

Q: For each structure, provide the common name (which happens to be the official IUPAC name). Spelling…

A: Given: Different organic compounds To find : Common name of these organic compounds.  Solution : As…

Q: For each alkene write the correct IUPAC name 2. 3.

A:

Q: Give the IUPAC name for each compound.

A: a). The aldehyde contains four carbon straight chain. It is a derivative of butane. Numbering from…

Q: LOH to of H removal of H₂O

A:

Q: Explain Ethers & its bonded group ?

A: There are different types of organic compounds which differs from each other by their functional…

Q: Write the IUPAC name of each compound

A: IUPAC stands for International Union for Pure and Applied Chemistry. Naming of organic compounds is…

Q: Give the IUPAC name for each compound.

A: IUPAC refers to the international union for pure and applied chemistry. It gives a specific name for…

Q: глд

A: Electrophiles are electron loving species. Nucleophiles are nucleus loving species. Electrophilic…

Q: Give the IUPAC name for each compound. a. С. b. d.

A: Steps involved in IUPA naming of cycloalkanes: Number the carbon of ring such that giving lower…

Q: Draw a structure of any alkyl halide and give IUPAC name of the compound

A:

Q: What is this compounds IUPAC name?

A: The answer is  3-Methylbutanal

Q: Provide an iupac name for each hydrocarbon

A:

Q: Why do phenols have a higher boiling point than toluene despite having similar shape? A. The higher…

A: Phenol , C6H5OH is an aromatic alcohol, in one of Hydrogen from benzene ring displaced by on…

Q: Draw the constitutional isomer formed in attached reaction.

A: Constitutional isomers are defined as the compounds that have same molecular formula but the atoms…

Q: Answer below question for A and B depicted in the ball-and-stick models. Que: What is the IUPAC name…

A: IUPAC nomenclature Identify the longest carbon chain Identify the functional groups and…

Q: Give the IUPAC name for each compound.

A: IUPAC nomenclature is followed as a standard while naming various compounds.The main chain or the…

Q: g IUPAC nomenclature a

A:

Q: Classify each carbon–carbon double bond as isolated or conjugated.

A: a. Both the double bonds are conjugated. b. Both the double bonds are conjuagted. c. a,b is…

Q: B. Give the IUPAC name for each compound. C. b. d.

A: Following are the appropriate IUPAC nomenclature of the four given organic compounds.

Q: Write the IUPAC name of each alkene

A: IUPAC is used to name the compound using some set of rules. The full form of IUPAC is International…

Q: Consider the synthesis scheme in Figure 12. Give the preferred IUPAC name of C

A:

Q: Answer each question using the ball-and-stick model of compound A. Draw a stereoisomer for A and…

A: Stereoisomers have the same composition and differ in the orientation of different groups in the…

Q: Give the IUPAC name for each alkene.

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Name of product for each reaction

A: Alcohol reacts with sulfuric acid to form alcohol or ether depending on the temperature of the…

Q: D IUPAC name? Br

A: Note: Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: Write the IUPAC name for   compound.

A: The IUPAC name of the given compound is

Q: Pristane is a high molecular weight alkane present in shark liver oil, a lipid used as a folk remedy…

A: The structure of pristane is as shown below

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.