Ethylamine, C2H5NH2, is a weak base. A 0.65 M  aqueous solution of ethylamine has a pH of 12.20. What is kb for ethylamine? Calculate the pH of a 0.11 M  aqueous solution of ethylamine.

Q: A 0.10 M solution of formic acid (HCOOH) is prepared in various solvents: (a) 0.10 M Ca(HCOO)2…

A: The given data contains, Molarity of HCOOH = 0.10 M Molarity of Ca(HCOO)2 =0.10 M Ka = 1.78 X 10-4

Q: The Kb of dimethylamine [(CH3)2NH] is 5.90×10-4 at 25°C. Calculate the pH of a 1.15×10-3 M  solution…

A: [H+] [OH-]  =  10-14 PH + POH  = 14 [OH-]  = 10-14/ [H+] [H+]  =  10-14               [ OH-]

Q: The Kb of methylamine is 4.4 x10-4.  What is the pH of a 0.35 M solution of methylamine? 11.56…

A: Arrhenius theory of electrolytic dissociation assumes that a dynamic equilibrium exist between ions…

Q: A.  Determine the pH and hydrogen ion concentration in a 0.1425M solution of ethylamine, C2H5NH2 at…

A: Note: As per the Guidelines solution of first question has been made. For the expert solution of…

Q: Using the literature Ka for theCH3NH3+ ion, calculate the theoretical pH of a 0.147 M solution of…

A: Methyl amine is a weak base. Here methylammonium chloride is used. Which is the conjugate acid salt…

Q: Calculate the pH for the following weak acid. A solution of HCOOH has 0.20 M HCOOH at equilibrium.…

A: pH : It is the negative logarithm of concentration of H+ . It is expressed by :

Q: Arsenous acid, H3AsO3, pKa2 = 7.00. What is the pH of a solution made up to have [H3ASO4) = 1.00 M…

A: In this question, we have to find out the correct answer of given problem by the help of henderson…

Q: Calculate the [H+] for (a) black coffee with a pH of 4.33 (Enter your answer as follows: 1.0E-2 for…

A: pH = -log [H+]

Q: For the following chemical equation, identify the cobjugate acid-base pairs. Acid conjugate base and…

A: Acid is HF and it's conjugate base is F-.

Q: Three (3) 0.10 M acid solutions were prepared and their pH values were recorded. Match the solution…

A: This problem is related to acidic strength. Acidic strength is the measurement of the ability of the…

Q: Consider the following data on some weak acids and weak bases: acid base K. K, name formula name…

A:

Q: The Ka value for acetic acid, CH3COOH(aq), is 1.8×10 −5. Calculate the pH of a 1.40M acetic acid…

A: Acetic acid dissociate in aqueous solution as: CH3COOH→CH3COO-+H+

Q: Consider the following data on some weak acids and weak bases: acid base K, K, name formula name…

A:

Q: Lactic acid, CH3CH(OH)COOH, has one acidic hydrogen. If a 0.209 M solution of lactic acid has a pH…

A: Concentration of lactic acid [HA] = 0.209M pH of lactic acid =2.53 Now, [H3 O+ ] = 10-2.53 =…

Q: What is the pH of 0.15 M solution of acetic acid (CH3COOH) Ka=1.75 x 10^-5 A) 2.6 x 10^-6 B) 0.0016…

A: Calculating pH of the acetic acid. CH3COOH + H2O <----------> CH3COO- + H3O+

Q: Consider the following data on some weak acids and weak bases: acid base Ka K, name formula name…

A: Given the following data on some weak acids and weak bases: We have to rank the following solutions…

Q: Consider the following data on some weak acids and weak bases: acid base K. к, olo name formula name…

A: NaCl is a salt of strong base NaOH and strong acid HCl. It has a pH of almost 7 because it is a…

Q: Consider the following data on some weak acids and weak bases: acid base Ka K, name formula name…

A: Data given: The order of increasing pH for the given solutions is ?

Q: Formic acid, HCOOH, is the substance responsible for the sting in ant bites. Write an equation…

A: Reaction of formic acid with water is as follows.

Q: Directions: Write the correct Lewis structure and show the step-by-step solution on how you came up…

A: The concept of covalent bond is explained Lewis. The atoms achieve stable octet configuration when…

Q: Consider the following data on some weak acids and weak bases: acid base Ka name formula name…

A:

Q: 2.2 6. (i) Define pH in words. The strong acid HClag has a pH value of 1, use the following equation…

A:

Q: Calculate the pH of a 0.0470 M aqueous solution of the weak base methylamine (CH3NH2, Kb =…

A:

Q: Determine the pH of a 0.275 M KOH solution. Give your answer to 2 decimal places in regular…

A:

Q: Calculate the pH of 0.0500 M KOH (γOH-=0.81). 1.39 12.61 1.30 12.70 13.91

A:

Q: Consider the Tollowing data on some weak acids and weaK Dases: acid base Ka name formula name…

A: 1. Salt hydrolysis of weak acid + strong base :  pH = 7 +1/2[pKa + logC]    2. Salt hydrolysis of…

Q: Determine the pH of 0.080 M NH4Cl (pKa = 9.3). Give your answer to two decimal places.

A: Note - Since you have asked multiple questions, we will solve the first question for you. If you…

Q: Calculate the pH of a 0.429 M aqueous solution of formic acid (HCOOH, Ka = 1.8 x 10-4).          pH…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Compare the conjugate bases of these three acids. Acid 1: nitrous acid , HNO2 Acid 2: carbonic acid…

A: Bronsted-Lowry acid-base theory: According to the Bronsted-Lowry acid-base theory, acid is a…

Q: Compare two solutions. One has a pH of 7 and the other has a pH 10. Complete the following statement…

A:

Q: In the laboratory, a general chemistry student measured the pH of a 0.468 M aqueous solution of…

A: Kb is the base dissociation constant. When a base B is dissolved in water,then it takes up one…

Q: If you mix 11.5 grams of HNO3 into 10.26 liters of water, what is the pH? How many grams of Acetic…

A: Given data,Mass of HNO3=11.5gVolume of water=10.26L

Q: The pH for 0.0850 M solution of C₆H₅CH₂COOH is 2.68. Determine the value of Ka for C₆H₅CH₂COOH.…

A: The acid dissociates as: C6H5CH2COOH→C6H5CH2COO-+H+

Q: Determine the ethylamine concentration of an aqueous solution that has a pH of 11.82. a)…

A: Given: pH = 11.82 Kb of ethylamine = 5.6×10-4

Q: Calculate the [H+] fo (a) black coffee with a pH of 4.57 (Enter your answer as follows: 1.0E-2…

A: a. Calculation for [H+] of black coffee: pH=-log[H+][H+]=10-pH[H+]=10-4.57[H+]=2.7×10-5=2.7E-5

Q: Consider the following data on some weak acids and weak bases: acid base K. name formula name…

A: Given,  a). 0.1 M KClO  b). 0.1 M KNO3  c). 0.1 M C2H5NH3Cl  d). 0.1 M NaF

Q: a greater concentration of hydroxide ion than hydronium ions   Part 1. A slightly in

A: Since you have posted multiple independent questions in the same request, we will solve the first…

Q: Calculate the pH of a 0.53 M HONH2 solution. Give your answer to two decimal places Kb(HONH2) = 1.0…

A:

Q: Calculate the pH of a 0.55 M solution of ammonia given that Kb= 1.8 x 10-5 for ammonia. b)What is…

A: a) The decomposition of NH3 will take place as follows:…

Q: What is the pH of a grapefruit that contains 0.007 M citric acid solution (C6H3O7)? C6H3O7(aq) +…

A:

Q: What is the pH of a 0.070 M aqueous solution of methylamine, CH3NH2? The Kb for methylamine is…

A:

Q: Using the Henderson-Hasselbach equation predict under which of the following conditions will the pH…

A: pH= Pka + log([Salt]/[Acid])  so pH > Pka when log term is greater that Zero so in that case…

Q: the laboratory, a general chemistry student measured the pH of a 0.468 M aqueous solution of formic…

A: PH= -log[H+] [H+]=√ka×C HCOOH is weak acid it will break completely in water into it's ions so use…

Q: Consider the following data on some weak acids and weak bases: acid base K, name formula name…

A: We have to predict the order of the pH.

Q: What is the pH of a 0.0253 M solution of NaOBr? (For HOBr, Ka = 2.5 × 10−9) Enter your answer using…

A:

Q: The pH of an aqueous solution of 0.429 M formic acid, HCOOH is ________. Calculate the pH of a…

A: 1) Given - Concentration of HCOOH = 0.429M Ka of  HCOOH - 1.8×10-4 To calculate = PH of formic acid…

Q: Consider the following data on some weak acids and weak bases: acid base Bo Ka K, name formula name…

A: The given compounds are salts of given weak acids and base.  Weak base have conjugate acid salt and…

Q: Consider the following data on some weak acids and weak bases: acid base K, name formula name…

A: more PH , lesser the acidic value

Q: Consider the following data on some weak acids and weak bases: acid base Ka K, name formula name…

A: Given, 0.1M KCh3CO2 0.1M NaNO2 0.1M NH4Br 0.1M NaCl The pH increasing order is:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.