Q: Chemistry Is the red part in the green solution a precipitate? If not, what do you call it? It is a…
A: An inorganic complex is a chemical compound that contain metal ion in the complex.
Q: The boiling point of ethanol (C:H&OH) is 78.5°C. What is the boiling point of a solution of 6.4 g of…
A: Elevation in boiling point :- When a non volatile solute is added to pure solvent its boiling point…
Q: In each of the following, enough data are given to calculate the indicated parameter(s).…
A: Answer: According to Beer-Lambert's law A=εbC Here: A=absorbanceε=molar absorptivityb=path…
Q: Which reaction has a positive AS? O Cao (s) + CO2 (g) → CaCO3 (s) O N2 (g) + 3H2 (g)→ 2NH3 (g) O…
A: Which of the following has a positive ∆S ?
Q: 4) Coleulare a) Vec at STP 6) molar volume [Zkaog c) % KClOg ON > 30z+ 2Kci]
A: The thermal decomposition of KClO3 produces oxygen gas along with solid potassium chloride. The…
Q: A statement of the second law of thermodynamics is that a. energy is conserved in a chemical…
A: According to the first law of thermodynamics, the energy of the universe remains constant. For a…
Q: Consider the animation describing opperation of the mercury battery. What is the formula of the…
A: There are multiple sun part in this question. as per our company guidelines we are supposed to…
Q: 19. What is the molarity of a commercial phosphoric acid solution, H3PO4 (MW= 98.0 g/mol) that is…
A:
Q: What is an appropriate stepwise synthesis for 1-pentanol from butanal? NABH4/CH;OH; PB13; Mg/ether;…
A: 1) Last reaction reagent sequence is not correct because no solvent used with NaBH4 and no acidic…
Q: Chemistry Calculate the pH at 10.0 mL intervals (0 to 100 mL) in the titration of 40.0 mL of 0.100…
A: Piperazine is a weak dibasic. It has two nitrogen atoms which can donate electron density to a…
Q: Given the following spectrophotometric data, what is the concentration of the sample? Concentration,…
A: Here we are required to find the concentration of the sample from the absorbance concentration plot
Q: A Predict the main product of the reaction of CH;CH,NH, at pH 5 with compound A.
A:
Q: The value of AH° for the reaction below is - 790 kJ. The enthalpy change accompanying the reaction…
A: Given: ∆Ho=-790 kJ Mass of S = 0.95 g Known: Molar mass of S = 32 g/mol
Q: Protein is least soluble in a solution with pH equal to its isoelectric point (IpH).
A: Proteins are made up of amino acids Amino acids may be negatively charged, positively charged or…
Q: II. Find the percentage composition of the given compounds. a. Mg (OH)2 onto 80.29 = 60 umo $0.8 =…
A:
Q: Which statement is incorrect? Energy is the capacity to do work or to transfer heat. O Kinetic…
A: There are various forms of energy. The law of conservation of energy states that energy is neither…
Q: Chenustry II CHiM4.001 O https://blackboard.liu.edu/webapps/assessment/take/take.jsp?course…
A: Ether can be prepared from reaction between two molecules of alcohol. There is elimination of water…
Q: For the process of a certain liquid vaporizing at 1 atm, A H° vap = 68.5 kJ/mol and A S° vap=74.1…
A: Please note- As per our company guidelines we are supposed to answer only one question. Kindly…
Q: Match the items in the left-hand column to the items in the right-hand column by writing the…
A:
Q: n 2*(aq, 1.0 M), Sn 4*(aq, 1.0 M) || Cu 2*(a . Increasing the size of the cathode. - Increasing the…
A: 1) from the cell notation Overall cell reaction, Sn2+ + Cu2+ ---> Cu + Sn4+ Increasing…
Q: 3. Complete the following chart by naming or sketching the indicated un-branched (straight chain)…
A:
Q: Он о OH O Он о Он о H. ÓH II IV V Which of the following molecules is not a possible product when a…
A: Aldol condensation: The alpha hydrogen of carbonyl compounds is acidic in nature and it is removed…
Q: Calculate the frequency in hertz of electromagnetic radiation that has a wavelength of 640.0 nm. (c…
A:
Q: 3. What substitution products would you expect to obtain from the following reactions? (a) Br (b)…
A: Here we are required to predict the product of the reaction
Q: Aluminum is produced commercially by the electrolysis of Al, O3 in the presence of a molten salt. If…
A: The amount of Al produced can be calculated as follows
Q: What is the most likely product of the following reaction? РСС cis-4-methylcyclohexanol CH2CI2 II OH…
A:
Q: mpressed to 3 cu.m, what is the resulti ssure assuming isothermal condition= a abs? (UP TO THREE…
A: Given, V1 = 8 cu.m V2 = 3 cu.m P1 = 200 kPa
Q: The conventional equilibrium constant expression (Kc) for the system below is: 2IC1(s) F 1,(s) –…
A:
Q: 3. The questions that follow pertain to the following unbalanced reaction: N2O5(g) → NO2(g) + O2(g)…
A: The given (unbalanced) reaction is as follows: N2O5(g) → NO2(g)+O2(g) The balanced reaction is…
Q: Why does the concept of colligative properties apply only to dilute solutions?
A: Solution is made up of two components: solute and solvent. Component which is present in major…
Q: Provide the structure of the main product.
A: In this question we have to tell the main product of the reaction.
Q: 17-20. Uranium-238 decays very slowly, with a half-life of 4.47 billion years. What percentage of a…
A: Answer: 12.5%
Q: Lewis Structure of Elements Draw the Lewis structure of elements and determine the number of…
A:
Q: what is the classification and properties of matter
A: Matter is classified on the basis of their physical and chemical properties. On the basis of…
Q: A) S B) Sn C) Sb D) As
A: As we know,in the periodic table, same group elements show similar properties
Q: 3.3 8 Give the reaction mechanism and name the products for the reaction of 2-bromobutane with a hot…
A:
Q: The correct mathematical expression for finding the molar solubility of SnOH2SnOH2 is
A:
Q: 2. Arrange the following atoms in an increasing order on atomic radii, ionization energy, electron…
A:
Q: For the previous item, provide the IUPAC name of the product after step 2: CI Step 1 Step 2 Step 3 ?…
A:
Q: You are asked to determine the alkali present and the percentage of each in a component of a sample…
A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…
Q: You are asked to determine the alkali present and the percentage of each in a component of a sample…
A:
Q: The reaction 4A1 (s) + 302 (g) → 2 Al203 (s) and therefore AH is is endothermic, negative…
A: Recall the reaction, 4Al(s) + 3O2(s) ----> 2Al2O3(s) ∆H = ? Reaction type= ?
Q: For the reaction 2 NO) N,Ote) (a) At a given temperature, 1 mole of NO, is placed in a 10-1…
A: 2NO2(g) <----> N2O4(g) I 1 mol 0 C -2x +x E 1-2x…
Q: Consider the following equation carefully, and determine the sign of AS for the reaction it…
A: 1) In this reaction, reactant is in solid state so it's entropy is less because less randomness in…
Q: Identify the oxidation numbers to all the elements in each of the compound or ions ( H2SO3 O a. H2…
A:
Q: Given the following spectrophotometric data, what is the most appropriate linear equation to use?…
A: It is an application of Lambert Beer law
Q: Prepare 20 mL of~1 M CaCl2. Because the CaClz solution will be used as an excess reagent to prepare…
A: Density= Mass / Volume So, Mass = Density * Volume Mass of water = 1 g/mL * 20 mL = 20 g Mass of…
Q: What is the expected product of the reaction shown? 1. CH3MgBr 2. H2о OH OH II IV O II O IV
A: Given reaction is : Predict the major product of the reaction = ? Options are :
Q: How does temperature influence the surface tension and viscosity of colloidal solutions and ionic…
A: Surface tension and viscosity are the physical properties of the liquid. Viscosity is the resistance…
Q: In a titration, the initial reading on my burette was 1.50 mL and the final reading was 15:7 mL.…
A: Given, Initial reading = 1.50 mL Final reading = 15.7 mL
- Explain the purpose of Baeyer’s Test?
- Write the chemical equations for the reaction of potassium permanganate with
unsaturated hydrocarbons. What is the name of the precipitate?
Trending now
This is a popular solution!
Step by step
Solved in 2 steps
- sample weight: KOH: 1g KOtBu 1g 1-propanol: 1g 1-butanol 0.742g calculate the thoeretical and percent yields of methylbutenesChoose one of organic compounds (Eg: benzoic acid) that we always found in our daily life. State the source of the chosen compound and and give it's 3 benefits to us.Give the IUPAC name for each of the fi ve constitutional isomers of molecular formula C 6H 14 in Problem 12.40.
- Draw the structure of the following compounds. Use line-angle structural formula. 5-chloro-1-ethylspiro[2.5]octane * 1-bromo-4-ethyl-5-methylcyclohexane * 5-cyclobutyl-2-cyclopropyl-6,8-diethyl-3,7,7-trimethyldecane 3,7-dimethyl-5-propylnonae * 2-bromo-4-methylbicyclo[3.2.1]octane *a. Draw and name all of the isomeric products obtainedfrom the monobromination of propane with Br2/light. If halogenation were a completely randomreaction and had an equal probability of occurring atany of the C—H bonds in a molecule, what percentage of each of these monobromo products would beexpected?b. Answer part (a) using 2-methylpropane as the starting material.The name of the compounds below is: CH3CH2CH2CH2CH2COCH3 Question 8 options: 6-heptanone heptanone 2-heptanone 3-heptanone
- wt of flask = 98.4669 wt of product = 20.7868 wt of flask and product = 119.2537 weight of water collected = 4.4 mL wt of water expected 4.5 mL percent yeild of ester = 71.58% 19.0 mL of 0.25 M n-propanol 18.5 mL propionic acid plz answer questions below1) Name the alkene (1.jpg) 2) Which of the choices below is an alkene? CH3CH3 CH3CH2CHCH2 CH3CH2CH3 CHCH 3) Select among the choices below the one with the most strain energy cyclopentane cycloheptane cyclobutane cyclohexaneChoose from the given choices: A. alkanes B. carboxylic acids C. amines D. phenols E. alkyl halides F. ketones G. aldehydes H. alcohols Will dissolve in water and will dissolve also in sodium bicarbonate with the release of carbon dioxide as biproduct. Will not dissolve in water but will dissolve on both strong base and sodium bicarbonate and no liberation of carbon dioxide 3-4. .Will not dissolve in water and on strong acids and bases. 5. Will dissolve in water and will change the blue litmus into red
- The heats of combustion (−∆H°) of heptane and 3,3-dimethypentane are 4,817 and 4,809 kJ/mol, respectively. Which statement is true? A. Heptane is 8 kJ/mol more stable then 3,3-dimethylpentane. B. 3,3-Dimethylpentane is 8 kJ/mol more stable than heptane C. Stabilities cannot be compared since they are not isomers. D. Stabilities cannot be compared since they give different combustion products.a)when each of the following things are mixed with Alkane (induvidually) what will be the results: lard, mineral oil, olive oil, H2O. b) When each of the following things are mixed with Alkene (induvidually) what will be the results: lard, mineral oil, olive oil, H2O.Arachidonic acid is a naturally occurring C„o polyunsaturated fatty acid. Draw a line-angle formula for arachidonic acid showing the cis configuration about each double bond. CH2(CH2)4(CH=CHCH2)4CH2CH2COOH Arachidonic acid