Observation:Reduction half-reaction:Fe (s) + HCI (aq)Oxidation half-reaction:Over-all reaction:Observation:Reduction half-reaction:Zn (s) + HCI (aq)Oxidation half-reaction:Over-all reaction:

Answered: Image /qna-images/answer/375ad71f-bdaa-4c81-ab60-16cfd5ce5cd6.jpg

Answered: Fe (s) + HCI (aq) Zn (s) + HCI (aq)

Science

Chemistry

Fe (s) + HCI (aq) Zn (s) + HCI (aq)

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.108QE: At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction...

See similar textbooks

Related questions

Q: Predict whether a reaction occurs when each of the following pairs of solutionsare mixed. If a…

A: Spectator ion is the ions which are present in reactant as well as in products and does not…

Q: NaOH (aq) Ni(NO3)2 (aq) complete ionic equation: net ionic equation:

Q: Because the oxide ion is basic, metal oxides react readily with acids.(a) Write the net ionic…

A: Ionic equation is an equation in which ions are explicitly shown. Net ionic equation is the chemical…

Q: Write balanced complete ionic and net ionic equation for acid–base reaction. HC2H3O2(aq) + RbOH(aq)…

A: Complete ionic equation One of the ways to represent a reaction is using complete ionic equations.…

Q: Predict whether a reaction occurs, and if so, write balanced total and net ionic equations: (a)…

A: a) Iron(III) chloride(aq) + cesium phosphate(aq) The product formed from the given reactant is:…

Q: What volume of 0.874 M HCI, in milliliters, is required to titrate 1.30 g of NaOH to the equivalence…

A: Number of moles = 1.30 g / 40g mol-1 = 0.0325 mol At equivalence point Moles of HCl = Moles of NaOH

Q: what is the balanced net ionic equation for the reaction between the water insoluble solid Mg(OH2)…

A: The balanced net ionic equation for the reaction between the water insoluble solid Mg(OH)2 (s) and…

Q: The following chemical reaction takes place in aqueous solution: 2AgNO3 (aq) + Na2S (aq) → Ag2S…

Q: A 25.00-ml sample of an unknown HCIO, solution requires ti- tration with 22.62 mL of 0.2000 M NAOH…

A: The molarity of a solution measures the concentration of solution in mol/L. The molarity of an…

Q: Cu(s) + AgNO3(aq) Cu(NO3)2(aq) + [ 2Ag(s) ] what is the - molecular…

A: The reaction given is Cu (s) + AgNO3 (aq) --------> Cu(NO3)2 (aq) + Ag (s) Balancing : Since we…

Q: A volume of 25.00 mL of HCl was titrated with 28.44 mL of 0.1231 M NaOH. Calculate the molarity of…

A: The balanced Chemical equation given for the neutralisation reaction between sodium hydroxide and…

Q: A neutralization reaction can occur between ammonium phosphate and sodium hydroxide. Balance the…

A: In balanced reaction number of each atom on reactant side is equal to number of each atom on product…

Q: Write Molecular and Net Ionic Equation for: HNO3 (aq) + NaCl (aq) -> ?

A: Given, HNO3 (aq) + NaCl (aq) -> ? Balanced molecular equation = ? Net ionic equation = ?…

Q: You are given a solution that may be either NaC1(aq) or NazCO3(aq). Present a scheme to find which…

A: #(a): Both NaCl(aq) and Na2CO3(aq) are soluble in water. NaCl(aq) is a neutral salt with pH of…

Q: The following chemical reaction takes place in aqueous solution: AgF(aq)+NaBr(aq) →AGBR(s)+NaF(aq)…

A: Given molecular equation is AgF(aq) + NaBr(aq) ------> AgBr(s) + NaF(aq) Net ionic equation for…

Q: The following chemical reaction takes place in aqueous solution: FeBr3(aq)+ 3KOH(aq)=Fe(OH)3(s)+…

A: The given equation: FeBr3(aq)+ 3KOH(aq)→Fe(OH)3(s)+ 3KBr(aq) Only the participants in aqueous form…

Q: 2. HCl (aq) + NH3 (aq) → Total Ionic: Net Ionic: This is a reaction between a acid and a base.

A: The given reaction is done between a comparatively strong acid (HCl) and a weak base, ammonia,NH3.…

Q: Write balanced neutralization equations for the following reactions: Ca(OH)2(aq)+ HNO3(aq) −→−…

A: Since in the neutralization reactions, base reacts with acid to form salt and water Hence the…

Q: NaOH(aq) + H2SO4(aq)= balanced eqaution total ionic equation net ionic equation

A: A balanced chemical equation or reaction is the one in which the total number of atoms for each…

Q: These two beakers represent solutions of HCl and NaOH. Draw a third beaker showing the ions that…

A: In the given information, two beakers are shown. In the first beaker HCl, an acid is present and in…

Q: The reaction between calcium carbonate and hydrochloric acid is; CaCO3(s) + 2 HCl (aq)→ CaCl2(aq) +…

Q: The following chemical reaction takes place in aqueous solution: AgF (aq) + NaCl (aq) →…

A: The net ionic equation for this reaction has to be written

Q: what are the spectator ions in the reaction equation between koh(aq) and hno3(aq)

A: we know, the balanced chemical reaction between KOH and HNO3 is KOH(aq) + HNO3(aq) ---->…

Q: Complete and balance the reactions. Write net ionic equations. a. Fe(NO3)3 + NaOH -> b. NiCl2…

A: A chemical equation can be represented by using symbols and formulas of the participating species.…

Q: Provide a correctly balanced equation for the acid/base neutralization reaction below Al(OH)3 (aq) +…

A: Balanced Equation: The type of equation where the number of atoms on the reactant side and product…

Q: The following chemical reaction takes place in aqueous solution: AgF(aq)+Nal(aq) → AgI(s)+NaF(aq)…

A: Given, AgF(aq) + NaI(aq) ---------> AgI(s) + NaF(aq)

Q: Consider a buffer solution that consists of two separate components: the weak acid, HF(aq), and its…

A: Given: A buffer solution of HF and F-.

Q: Balance the following equation, in basic solution, ClO4− (aq) + C6H14O4(aq) → Cl−(aq) + HCO3− (aq)

Q: HNO3 (aq) + KOH (aq) → Total Ionic: Net Ionic: This is a reaction between a acid and a base.

A: The reactants given are 1) HNO3 (aq) which is an acid 2) KOH (aq) which is a base.

Q: Write a net ionic equation to show that hydrofluoric acid , HF , behaves as an acid in water. +…

A: A net ionic equation shows only the chemical species that are involved in a reaction, while a…

Q: Complete and balance acid–base equation HC2H3O2(aq) + Ca(OH)2(aq) -------->

Q: What volume of 0.812 M HCl, in milliliters, is required to titrate 1.45 g of NaOH to the equivalence…

A: Given Reaction NaOH(aq) + HCl(aq) → NaCl(aq) + H2O(l) Molarity of HCl =…

Q: What is the molarity of an HCl solution if 11.0 mL HCI solution is titrated with 27.6 mL of 0.160 M…

A: For the given titration, Molarity of HCl, M1 = ? Volume of HCl taken, V1 = 11 mL Molarity of NaOH,…

Q: Na2CO3, can be titrated with HCl according to the following balanced chemical equation.…

Q: Which of the following solutions would be the best conductor of electricity (i.e. the best…

A: In order to conduct electricity, the solution must contain charged particle or we can say it must…

Q: What is the balanced net ionic equation?

A: Write the balanced molecular equation Split electrolytes to ions to get the total ot complete ionic…

Q: Enter the balanced complete ionic equation for the acid-base reaction HC2H3O2(aq)+LiOH(aq)→…

A: The reactants given are 1) Acid : HC2H3O2 (aq) 2) Base : LiOH (aq) Hence acid will react with base…

Q: I need to find the balanced net ionic equation of both

Q: What is the molarity of an HCl solution if 43.6 mL of a 0.125 M KOH solution are needed to titrate a…

A: The above given equation is wrong : The correct equation for the reaction is : KOH +HCl------>…

Q: P. Complete and balance the following neutralization reaction _H2SO4(aq) + NH,OH(aq)

Q: Complete and balance acid–base equation.HCIO4(aq) + KOH(aq) ------->

A: An acid react with a base to form salt and water. This reaction is known as neutralization reaction…

Q: HCHO2(aq)+KOH(aq)→ ionic equation for the acid base reaction

A: For writting net ionic equation we should keep in mind these points:-1 Write stales of all species…

Q: What is made by adding solutions of Ba( NO3)2(aq) and NH4)2S(aq)?

A: The reaction that occurs by mixing Ba(NO3)2 and (NH4)2S will be a displacement reaction.

Q: Fe(s) + CuSO4(aq) and KCL(aq) + AgNO3(aq) For each one write total and net ionic equations.

A: Process to write Complete and Net ionic equation 1. Write the balance equation 2. Break the…

Q: Acetic Acid (aq) HC2H3O2 NHẠOH (aq) Write a complete reaction, using one of the examples above,…

Q: Predict the products of the neutralization reaction between hydrochloric acid and a sodium hydroxide…

A: The neutralization of acid and base give salt and water.

Q: Complete and balance the following reactions. Also write ionic and net ionic reactions _____…

A: Given: The incomplete reaction: H2SO4 (aq) + NaHCO3 (aq) → We have to complete and balance the…

Q: AgH KCN HBRO, 4(aq)

A: Since you have posted a question with multiple sub-parts, we will solve the first three subparts for…

Question

Observation:
Reduction half-reaction:
Fe (s) + HCI (aq)
Oxidation half-reaction:
Over-all reaction:
Observation:
Reduction half-reaction:
Zn (s) + HCI (aq)
Oxidation half-reaction:
Over-all reaction:

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
In biological systems, acetate ion is converted to ethyl alcohol in a two-step process: CH3COO(aq)+3H+(aq)+2eCH3CHO(aq)+H2OE=0.581V CH3CHO(aq)+2H+(aq)+2eC2H5OH(aq)E=0.197V (E°' is the standard reduction voltage at 25°C and pH of 7.00.) (a) Calculate G°' for each step and for the overall conversion. (b) Calculate E°' for the overall conversion.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
An aqueous copper (II) chloride solution is electrolyzed for a period of 156 minutes. Using a current of 9.00 A. If inert electrodes are used in the process, how many grams of copper were removed from the solution?
The formation of Br2 from Br- was done by electrolyzing 1.0 M KBr solution between two Pt electrodes. Electrolysis was done for 6.00 min using 1.15 A of current. At the cathodic electrode, the half-reaction is 2H+(aq) + 2e- ⭢ H2(g). Calculate the number of moles of Br2 formed in the solution.