For any of the following that can exist as isomers, state the type of isomerism and draw the structures: (Hint: Note that Zn* has 10 d electrons so they tend to form tetrahedral complexes Pd2+ have 8 d electrons so they tend to form square planar complexes) a. [Zn(en)F2] tal b. [Zn(H2O)(NH)FCI] c. [Pd(CN)2(OH)2]?-

For any of the following that can exist as isomers, state the type of isomerism and draw the structures: (Hint: Note that Zn* has 10 d electrons so they tend to form tetrahedral complexes Pd2+ have 8 d electrons so they tend to form square planar complexes) a. [Zn(en)F2] tal b. [Zn(H2O)(NH)FCI] c. [Pd(CN)2(OH)2]?-

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 28P

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.