For the electrolytic cell reaction: Cu2+ + 2 Cl- --> Cu+ Cl2 Using the same amount of charge flowing through the cell no. of mols of substance deposited at the cathode < no. of mols of substance deposited at the anode The two quantities cannot be compared due to insufficient information. no. of mols of substance deposited at the cathode = no. of mols of substance deposited at the anode no. of mols of substance deposited at the cathode > no. of mols of substance deposited at the anode

For the electrolytic cell reaction: Cu2+ + 2 Cl- --> Cu+ Cl2 Using the same amount of charge flowing through the cell no. of mols of substance deposited at the cathode < no. of mols of substance deposited at the anode The two quantities cannot be compared due to insufficient information. no. of mols of substance deposited at the cathode = no. of mols of substance deposited at the anode no. of mols of substance deposited at the cathode > no. of mols of substance deposited at the anode

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 84QRT

See similar textbooks

Similar questions

Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
For a certain cell, G=25.0 kJ. Calculate E° if n is (a) 1(b)1(c) 41 Comment on the effect that the number of electrons exchanged has on the voltage of a cell.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Consider a cell reaction at 25°C where n=4 . Fill in the following table.
Consider a cell reaction at 25°C where n=2 . Fill in the following table.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
What is the voltage of a concentration cell of Cl ions where the concentrations are 1.045 and 0.085 M? What the spontaneous reaction?