For the reaction below, 2A+BA2B if AH=9.8 kJ-mol-1 and AS°= 114 J-mol-1-K-1, what is the value of K at 341 Kelvin? (the answer should be entered with 3 significant figures; do not enter units; give answer in scientific notation--valid notation examples include 1.23e-8 and 1.23e8 and -1.23e-4 and 1.23e0)

For the reaction below, 2A+BA2B if AH=9.8 kJ-mol-1 and AS°= 114 J-mol-1-K-1, what is the value of K at 341 Kelvin? (the answer should be entered with 3 significant figures; do not enter units; give answer in scientific notation--valid notation examples include 1.23e-8 and 1.23e8 and -1.23e-4 and 1.23e0)

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter8: Thermochemistry

Section: Chapter Questions

Problem 90QAP: Consider a metal ion A2+ and its nitrate salt, In an experiment, 35.00 mL of a 0.217 M solution of...

See similar textbooks

Similar questions

Consider a metal ion A2+ and its nitrate salt, In an experiment, 35.00 mL of a 0.217 M solution of A(NO3)2 is made to react with 25.00 mL of 0.195 M NaOH. A precipitate, A(OH)2, forms. Along with the precipitation, the temperature increases from 24.8C to 28.2C. What is H for the precipitation of A(OH)2? The following assumptions can be made. â€¢ The density of the solution is 1.00 g/mL. â€¢ Volumes are additive. â€¢ The specific heat of the solution is 4.18 J/g C.
Consider the decomposition of CaCO3(s) into CaO(s) and Co2(g). What is the equilibrium partial pressure of CO2 at room temperature?
Consider the reaction CO(g)+H2O(g)CO2(g)+H2(g) Use the appropriate tables to calculate (a) G at 552C (b) K at 552C
Indicate whether each statement below is true or false. If a statement is false, rewrite it to produce a closely related statement that is true. For a given reaction, the magnitude of the equilibrium constant is independent of temperature. If there is an increase in entropy and a decrease in enthalpy when reactants in their standard states are converted to products in their standard states, the equilibrium constant for the reaction must be negative. The equilibrium constant for the reverse of a reaction is the reciprocal of the equilibrium constant for the reaction itself. For the reaction H2O2(ℓ) ⇌ H2O(ℓ) + O2(g) the equilibrium constant is one half the magnitude of the equilibrium constant for the reaction 2H2O2(ℓ) ⇌ 2H2O(ℓ) + O2(g)
What determines Ssurr for a process? To calculate Ssurr at constant pressure and temperature, we use the following equation: Ssurr = H/T. Why does a minus sign appear in the equation, and why is Ssurr inversely proportional to temperature?
9.96 Most first aid "cold packs" are based on the endothermic dissolution of ammonium nitrate in water: NH4NO3(s)NH4+(aq)+NO3(aq) H= 25.69 kJ A particular cold pack contains 50.0 g of NH4NO3 and 125.0 g of water. When the pack is squeezed, the NH4NO3dissolves in the water. If the pack and its contents are initially at 24.0°C, what is the lowest temperature that this bag could reach? (Assume that the ammonium nitrate solution has a specific heat of 4.25J g-l K-l, and that the heat capacity of the bag itself is small enough to be neglected.)
At mom temperature, the equilibrium constant (Kw) for the self-ionization of water is 1.001014. Using this information, calculate the standard free energy change for the aqueous reaction of hydrogen ion with hydroxide ion to produce water. (Hint: The reaction is the reverse of the self-ionization reaction.)
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Consider the formation of HI(g) from H2(g) and I2(g). H2(g)+I2(g)2HI(g) For this reaction, K at 333C is 98, while K at 527C is 62.5. Find S for I2(g) at 527C.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?