Help me please!!! Consider the following half-reactions:Half-reactionE° (V)Cl₂(g) + 2e → 2Cl¯(aq) 1.360VNi2+(aq) + 2e™Al³+ (aq) + 3e(1) The weakest oxidizing agent is:→Ni(s) -0.250V→Al(s) -1.660V(2) The strongest reducing agent is:(3) The strongest oxidizing agent is:(4) The weakest reducing agent is:(5) Will Al(s) reduce Cl₂(g) to Cl(aq)?(6) Which species can be oxidized by Ni²+ (aq)?leave box blank.If none,enter formula Consider the following half-reactions:Half-reactionAg+(aq) + e→→→→→→ Ag(s)2H+(aq) + 2e™Mg2+ (aq) + 2e¯(1) The strongest oxidizing agent is:(2) The weakest oxidizing agent is:(3) The weakest reducing agent is:E° (V)0.799VH₂(g) 0.000VMg(s)-2.370V(4) The strongest reducing agent is:(5) Will Mg2+ (aq) oxidize Ag(s) to Ag+ (aq)?(6) Which species can be oxidized by H+ (aq)?If none,leave box blank.enter formula

Answered: Image /qna-images/answer/c9c4bf4f-75bf-46f3-bf76-80437eb3b1e2.jpg

Half-reaction Cl₂(g) + 2e Ni2+(aq) + 2e Al³+ (aq) + 3e™ E° (V) 2Cl(aq) 1.360V (1) The weakest oxidizing agent is: (2) The strongest reducing agent is: (3) The strongest oxidizing agent is: (4) The weakest reducing agent is: Ni(s) -0.250V Al(s) -1.660V (5) Will Al(s) reduce Cl₂(g) to Cl(aq)? (6) Which species can be oxidized by Ni2+ (aq)? If none, leave box blank. enter formula

Half-reaction Cl₂(g) + 2e Ni2+(aq) + 2e Al³+ (aq) + 3e™ E° (V) 2Cl(aq) 1.360V (1) The weakest oxidizing agent is: (2) The strongest reducing agent is: (3) The strongest oxidizing agent is: (4) The weakest reducing agent is: Ni(s) -0.250V Al(s) -1.660V (5) Will Al(s) reduce Cl₂(g) to Cl(aq)? (6) Which species can be oxidized by Ni2+ (aq)? If none, leave box blank. enter formula

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 61E: Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the...

See similar textbooks

Similar questions

Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Use the following half-equations to write three spontaneous reactions. Justify your answers by calculating E° for the cells. 1. MnO4(aq)+8H+(aq)+5eMn2+(aq)+4H2OE=+1.512V 2. O2(g)+4H+(aq)+4e2H2OE=+1.229V 3. Co2+(aq)+2eCo(s)E=0.282V
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
Answer the following questions using data from Table 17-1 (all under standard conditions). a. Is H+(aq) capable of oxidizing Cu(s) to Cu2+(aq)? b. Is Fe3+ (aq) capable of oxidizing I (aq)? c. Is H2(g) capable of reducing Ag+(aq)?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?