Half-ReactionF(g) + 2e™ -→2F (aq)O(g) + 2H*(aq) + 2e. -Co (aq) + eCo² (aq)H₂O(aq) + 2H*(aq) + 2eCu²+ (aq) + 2e -Cu(s)AgCl(s) +Ag(s) + Cl(aq)SO (aq) + 4H(aq) + 2e →SO(g) + 2H₂OCu²+ (aq) + eSn (aq) + 2eCu*(aq)Sn³+ (aq)H₂(g)→→→ Pb(s)2H*(aq) + 2ePb²+ (aq) + 2eSn (aq) + 2e-Sn(s)Ni²+ (aq) + 2e-Ni(s)Co²+ (aq) + 2e -Co(s)PbSO (s) + 2e →→→Pb(s) + SO (aq)Cd²+ (aq) + 2e -Cd(s)Fe²(aq) + 2e - Fe(s)Cr" (aq) + 3e -Cr(s)Zn²+ (aq) + 2e -Zn(s)2H₂O + 2€™ →→H₂(g) + 2OH(aq)Mn² (aq) + 2eMn(s)Al (aq) + 3eBe+ (aq) + 2eAl(s)→Be(s)O₂(g) + H₂O2H₂OE(V)+2.87+2.07+1.82+1.77+0.34+0.22+0.20+0.15+0.130.00-0.13-0.14-0.25-0.28-0.31-0.40-0.44-0.74-0.76-0.83-1.18-1.66-1.85 Enter your answer in the provided box.What is the standard emf of a galvanic cell made of a Ni electrode in a 1.0 M Ni(NO3)2 solution and aCr electrode in a 1.0 M Cr(NO3)3 solution at 25°C?EºcellStandard Reduction Potentials at 25°CHalf-ReactionE(V)+2.87F(g) + 2e2F (aq)+2.070,(g) + 2H*(aq) + 2e0(g) + H₂OCo (aq) + e - Co²+ (aq)+1.82+1.77H₂O(aq) + 2H(aq) + 2e → 2H₂OCu (aq) + 2e Cu(s)+0.34AgCl(s) + € -Ag(s) + Cl(aq)+0.22SO (aq) + 4H(aq) + 2e-SO(g) + 2H₂O+0.20Cu²+ (aa) ++0.1511

Answered: Image /qna-images/answer/ad40af83-3cd2-4af9-aaeb-d2259e8c997a.jpg

Half-Reaction F(g) + 2e™ - +2F (aq) O(g) + 2H*(aq) + 2e. Co (aq) + e- H₂O(aq) + 2H*(aq) + 2e Cu²+ (aq) + 2e -Cu(s) AgCl(s) + Ag(s) + Cl(aq) SO (aq) + 4H(aq) + 2eS0g) + 2H₂O Cu²+ (aq) + e- Cu*(aq) Sn** (aq) + 2€ - Sn³+ (aq) 2H*(aq) + 2e H₂(g) Pb²+ (aq) + 2e- →→→ Pb(s) Sn (aq) + 2e -Sn(s) Ni²+ (aq) + 2e -Ni(s) Co³+ (aq) + 2e - Co(s) PbSO (s) + 2e →→→Pb(s) + SO (aq) Cd²+ (aq) + 2e -Cd(s) Fe²(aq) + 2e <-> Fe(s) Cr" (aq) + 3e -Cris) Zn²+ (aq) + 2e -Zn(s) 2H₂O + 2 → H₂(g) + 2OH(aq) Mn³ (aq) + 2e Mn(s) Al (aq) + 3e Be+ (aq) + 2e -0.(g) + H₂O 2H₂O Co³+ (aq) Al(s) →Be(s) E(V) +2.87 +2.07 +1.82 +1.77 +0.34 +0.22 +0.20 +0.15 +0.13 0.00 <-0.13 -0.14 -0.25 -0.28 -0.31 -0.40 -0.44 -0.74 -0.76 -0.83 -1.18 -1.66 -1.85

Half-Reaction F(g) + 2e™ - +2F (aq) O(g) + 2H(aq) + 2e. Co (aq) + e- H₂O(aq) + 2H(aq) + 2e Cu²+ (aq) + 2e -Cu(s) AgCl(s) + Ag(s) + Cl(aq) SO (aq) + 4H(aq) + 2eS0g) + 2H₂O Cu²+ (aq) + e- Cu*(aq) Sn** (aq) + 2€ - Sn³+ (aq) 2H*(aq) + 2e H₂(g) Pb²+ (aq) + 2e- →→→ Pb(s) Sn (aq) + 2e -Sn(s) Ni²+ (aq) + 2e -Ni(s) Co³+ (aq) + 2e - Co(s) PbSO (s) + 2e →→→Pb(s) + SO (aq) Cd²+ (aq) + 2e -Cd(s) Fe²(aq) + 2e <-> Fe(s) Cr" (aq) + 3e -Cris) Zn²+ (aq) + 2e -Zn(s) 2H₂O + 2 → H₂(g) + 2OH(aq) Mn³ (aq) + 2e Mn(s) Al (aq) + 3e Be+ (aq) + 2e -0.(g) + H₂O 2H₂O Co³+ (aq) Al(s) →Be(s) E(V) +2.87 +2.07 +1.82 +1.77 +0.34 +0.22 +0.20 +0.15 +0.13 0.00 <-0.13 -0.14 -0.25 -0.28 -0.31 -0.40 -0.44 -0.74 -0.76 -0.83 -1.18 -1.66 -1.85

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 120AE

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).