Answered: /hat is the correct IUPAC name of this…

/hat is the correct IUPAC name of this organic compound? D 4-ethyl-6-methyloctane O 2,5-diethylheptane O 3-pentanehexane O (2-methyl)-3-butylhexane O 5-ethyl-3-methyloctane

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter22: Organic Chemistry And Biochemistry

Section: Chapter Questions

Problem 53QE

See similar textbooks

Related questions

Q: Name the following compound according : to the IUPAC rule CH3 CH,. CH,. CH. с. сН. СH, C,H5 CH3…

Q: What is the IUPAC name of the following compound? CH 3 1 CH 3- CH2-CH 2-CH 2- CH- CH 3 O…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: Rules for naming the organic compound is as follows; Select the longest continuous carbon chain.…

Q: Which name is not a valid IUPAC name for an alkane? Multiple Choice O 5-butyl-2-methylnonane O…

Q: Select the correct IUPAC name for each unsaturated hydrocarbon. CH,-CH,-CH=CH-CH, Name: O pentene…

A: Since you have posted a question with multiple sub parts, we will solve first three sub parts for…

Q: What is the IUPAC name for the compound below? A) 4-ethyl-5-ethyl-5-methylheptane B)…

A: IUPAC nomenclature rules for alkanes: Identify the longest continuous carbon chain. Identify the…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: In organic chemistry the name of any organic compound is given by the IUPAC nomenclature. There are…

Q: 1. Draw a structural diagram for each of the following a. 3-ethyl-4-methyl-1-octene b.…

A: a). 3-ethyl-4-methyl-1-octene b). 4-proply-3-methyl-1-heptyne

Q: The IUPAC name for the molecule above is A: 4-ethylhexane B: 1-hexylethane C: 3-propylpentane D:…

A: To write the IUPAC name of the below compound.

Q: What is the IUPAC name of the following compound? O A. 3,4,4-Triethyl-2,2,5-trimethylhexane B.…

A: Please find your solution below : To name any organic compound, first we need to find the longest…

Q: What is the IUPAC name for the compound shown here? A) 3-ethyl-4-methylpentane B)…

A: IUPAC nomenclature is a naming given to chemical compounds based on certain rules that are given by…

Q: Select the correct name for the following compound. CH, H.C-CH-CH;CH;Ċ-CH, CH, CH, O…

A: • The longest carbon chain in the given compound contains six carbon atoms. Therefore, the root…

Q: The IUPAC name of the following organic compound is CI CI 1, 2-dichlorobenzene 1, 3-dichlorobenzene…

A: IUPAC name of the given compound = ?

Q: Which of the following is the correct IUPAC name of the following compound? CH,CH, CH,CH,CH=CH,…

Q: All the following compounds have functional group except O A. 2-methyl-2-butanethiol O B.…

A: The functional group is an atom or a group of atom or we can say molecule present in an organic…

Q: What is the IUPAC name of the following compound? O A. 2-Ethyl-4-methylpentane O B.…

A: Given here a compound and we are asked to write the IUPAC name for the compound

Q: What is the correct IUPAC name for 3-butyl-2-isopropylpentane

A: The IUPAC name for 3-butyl-2-isopropylpentane is:4-ethyl-2,3-dimethyloctane. The structure for the…

Q: How many of the following nam a. 3,4-dimethylpentane b. 3,6,8-trimethyldecane 4-ethyl-6-methyloctane…

A: As per our company guidelines we are supposed to answer only first 3 sub-parts. Kindly post other…

Q: What is the IUPAC name of the following compound? O 3-isopropyl-5-ethylheptane O…

Q: Question 30 of 39 Submit What is the correct IUPAC name for the compound shown here?…

Q: What is the IUPAC (systematic) name of the following molecule: O A. Sec-butylpentane O B.…

Q: Which of the following is the correct IUPAC name of the following structure? O…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Answer the question below: * Give the correct IUPAC name for the compound with the following…

A: In this given structure there is 1 ethyl group and 2 methyl group is attached on the cyclic chain of…

Q: Question 19 of 99 What is the IUPAC name for the compound shown here? A) methylpentyne B)…

A: The total no. of C-atoms present in the given molecule is six. The given organic compound has a…

Q: What is the correct IUPAC name of this organic compound? O 4-methyl-3-ethyl-2-heptene O…

A: Some important rules for IUPAC naming :- Longest chain rule :- Select longest possible continuous…

Q: What is the correct IUPAC name for: CH3 CH3 CH3CH2CHCH2CHCH3 O 1,1,3-trimethylpentane…

Q: Provide the correct name for "3-propylpent-2-ene"

Q: What is the correct IUPAC name for the compound below? A) 2,2,4-trimethylpentane B)…

Q: CH,—сн— сн,— СH,—сн,— сн —с3D с—сн, CH,-CH, ČH,-CH, The IUPAC name for the above condensed…

A: We can name the following compound by considering the rules given below : At first, we need to…

Q: What is the IUPAC name of the following compound? Br CI. CI O…

A: Alcohol and ether are functional isomer to eachother and the general formula is CnH2n+2O .…

Q: What is the IUPAC name for the following compound? O (2R,4R)-2-Bromo-4,5-diethylheptane…

Q: The IUPAC name for the organic compound below is CH3OCH3 Methanal O Dimethanol O Dimethyl Ether O…

Q: What is the IUPAC name for the following compound? 3-Ethyl-2,5-dimethyloctane…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: The correct IUPAC name for 2-ethyl-2,4-dimethylhexane is 3,3,5-trimethylheptane O…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1) Select the longest chain (2) Numbering start from those side…

Q: Which of the following is the IUPAC name for the following compound? O…

Q: Name the following using correct IUPAC nomenclature: A) isopentane B) 2-methylpentane CH3CH2CCH3 C)…

A: The compound given is,

Q: Choose the correct IUPAC name for the following compound Methylhexane 4, 4-dimethylhexane…

Q: What is the correct IUPAC name of this organic compound? O 2-ethyl-3-methylhexane O…

A: The given compound is an alkane. Thus, suffix "-ane" is used for the compound.

Q: CH3 CH CH2 CH CH3 H3C H2C-CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: 2. What is the correct IUPAC name for 3-butyl-2-isopropylpentane (For Alkene and Alkyne Naming,…

A: According to the IUPAC convention, the basic rules while naming hydrocarbon chains are : i) Firstly,…

Q: which of the following is an isomer of 2- methylpropane? W. 1-propene X. n-propane Y. 1-propyne Z.…

Q: Select the correct IUPAC name for the branched chain alkane. CH3 Br H₂ H₂ H3C-CC-c-c- -CH3 CH3 Br…

Q: What is the correct IUPAC name for the compound above? a. 2,3,4-trimethylhexane b.…

A: Organic compounds are named as per the guidelines proposed by the International Union of Pure and…

Q: Name the following compound: CH3-CH - CH – CH2-CH2-CH3 CH3 CH2 CH3 OA) 4-ethyl-5-methylhexane OB)…

A: We have to predict the IUPAC nomenclature of given compound.

Q: correct IUPAC name of the following compounds (a)4-methylhexane (b)1,5-dimethyl-3-ethylpentane…

A: Lets draw the structures according to the given names .The numbering according to the given name is…

Q: What is the IUPAC name of the compound shown below? 1-methyl-2-butyl ethyne heptyne 2-heptyne butyl…

A: First we will see the IUPAC rules keeping in mind the above structure, 1) The first rule is to…

Q: Answer the question below: * What is the correct IUPAC name for (CH3))2CH(CH2)3CH3? (a) heptane (d)…

Q: What is the name of this molecule? CH3-CH2-C- CH = CH2 O methylpentene O ethyloctene O…

A: Some important rules of IUPAC nomenclature of organic compounds 1. Select longest possible…

Q: What is the IUPAC name of the following compound? O A. 3,4,4-Triethyl-2,2,5-trimethylhexane B.…

Concept explainers

Stereochemistry and Isomerism

Stereochemistry deals with the three-dimensional structure and properties of molecules. It explains the arrangement of atoms and their manipulation within a molecule in a 3D structure. Stereochemistry can be dealt with all types of molecules. Based on the stereochemistry of a molecule, the physical and chemical properties of the molecules vary.

Question

What is the correct IUPAC name of this organic compound?
O 4-ethyl-6-methyloctane
O 2,5-diethylheptane
O 3-pentanehexane
O (2-methyl)-3-butylhexane
O 5-ethyl-3-methyloctane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the IUPAC name for the following compound ? A. 3,7-dichloro-5-ethyl-6-methyloctane B. 2-chloro-3-methyl-4-(2-chlorobutyl)hexane C. 2,6-dichloro-4-ethyl-3-methyloctane D. 3-chloro-5-(2-chloro-1-methylpropyl)heptane E. 2,3,4,6-dichloroethylmethyoctane
What is the correct IUPAC name for the product of propanoic acid+ 3- methyl-1-butanol with H2SO4
What is the IUPAC name of this compound? CL-CH2-CH2-CH2-CH2-CL
Draw the clear structures of organic compounds that have been named according to the IUPAC naming system below. 1- (2-naphthyl)-6-phenyl-2,5-hexanedione 1,1-dimethyl-2-cyclohexenol
What is the IUPAC name of propyl isobutyl ketone? a) 4-octanone b) 2-methyl-4-heptanone c) 3-methyl-4-heptanone d) 2,2-dimethyl-3-hexanone
A correct IUPAC name for the following compound is: 1. 2-isopropyl-1-pentene 2. 2-methyl-3-methylenehexane 3. 2-methyl-3-propyl-3-butene 4. 2-methyl-3-propyl-1-butene 5. 3-methyl-2-propyl-1-butene
Give the IUPAC name for this organic compound: CH3-CH2-CHBr-CH=CH-CHBr-CH3 3,6-dibromo hept-4-ene 2,5-dibromo-4-heptene 2,5-dibromo hept-3-ene 3.6-dibromo-3- heptene
What is the correct IUPAC name for 4-etil-5,5-dimetilpentane?
Select the correct IUPAC name for: a) 5-methyl-5-ethyloctane b) 3-methyl-3-propylheptane d) 4-ethyl-4-methyloctane e) 5-methyl-5-propylheptane
Select the correct IUPAC name for: 5-methyl-5-ethyloctane 3-methyl-3-propylheptane 4-ethyl-4-methyloctane 5-methyl-5-propylheptane
Draw the following organic compounds explicit formulas. a) 2-isobutyl-3-methyl-cyclohexanol b) 2-methoxy-2-methylpropane
Based on the image attached, what is the name of the compound? A. 3-chloro-2-ethylpyrimidine B. 3-chloro-2-ethyl-1,4-diazacyclohexane C. 3-chloro-2-ethylcyclohexan-1,4-diamine D. 2-chloro-3-ethyl-1,4-diazacyclohexane