how many chiral carbon in this compound

Q: anomeric carbon.

A: Tetrasaccharide is given

Q: Is 2-methyl-2-butanol chiral

A: Organic nomenclature and chirality

Q: Which of the following compounds would be optically active? For those that are draw the skeletal…

A: Identify which having chiral carbon (optically active) ---

Q: CH3 с.

A:

Q: How many chiral carbon atoms are in this structure? Br ОН HO. CI

A: Only 2 carbons.

Q: How to Naming Stereoisomers ?

A: The compounds which have same molecular formula and similar bond sequence but differ in the…

Q: if a compound has 4 chiral carbons how many isomers can formed. 8. only 2 16 4.

A: NOTE: As nothing is given about the compound except it has 4 chiral carbons. Hence I'm assuming that…

Q: How many chiral carbons are in 2-bromo-2-chloro-3-methylpentane? (a) 0, (b) 1, (c) 2, (d) 3, (e) 4…

A:

Q: The group having the condensed structural formula “CH3CH2CH(CH3)–” is called ___ .

A:

Q: How many chiral carbon? Br 2 3 O 5 4.

A: If a carbon atom in the molecule is attached with four different groups, then the carbon is known as…

Q: Consider the naturally occurring amino acid, alanine, and its enantiomer.

A: Enantiomer:- These are chiral molecules which forms non- superimposable images of each other. Amino…

Q: Draw chiral molecules that meet the following descriptions: (a) A chloroalkane, C5H11C1 (b) An…

A: Str 1, 2 and 4 are chiral but str 2 i.e alkenes can't be chiral.

Q: DIA

A: The carbon which attached with four different type of group or atom are called chiral carbon.

Q: Determine (A.) functional groups presents in the molecules and (B) determine the number of chiral…

A: Given molecule is :  Determine  (A). Functional groups present in the molecule = ?  (B). Number of…

Q: Determine (A.) functional groups presents in the molecules and (B) determine the number of chiral…

A:

Q: What is the mathematical relationship between the number of chiral carbons and the number of optical…

A: Compounds possessing identical molecular formula (same count of H, C, O etc atoms) but having…

Q: What is the VSEPR Shape of sucrose?

A: Hybridization and VSEPR theory explain the molecular geometry and bond angle in a molecule. VSEPR…

Q: How many chiral carbon atoms are there in this molecule? a. 1 b. 2 c. 3 3. 4

A: The chiral carbon atom is that carbon atom which is joined by different four atoms or molecules.So,…

Q: CHO H- HO- H- HO- ČH2OH

A: A carbon is said to be chiral carbon when carbon attached to four different groups or atoms.

Q: Draw the chair structures of: 1. a-D-glucose  2. b-D-galactose

A: The presence of the isomer in which PPL rotates in the right direction is the dextrorotatory isomer…

Q: Why are these two structures enantiomers? They look more like structural isomers to me.

A:

Q: Explain Constitutional Isomers Versus Stereoisomers ?

A: Isomers are those compounds which have the same molecular formula but the arrangement of atoms are…

Q: A carbohydrate that yields many monosaccharides when hydrolyzed is a ________? Disaccharide…

A: Disaccharide on hydrolysis gives 2 monosaccharides, and Polysaccharide on hydrolysis gives many…

Q: Question 6 of 18 Fill in the blanks: Write the letter of the pair of compounds that illustrates the…

A:

Q: Name the organic structure. CH3CH2 CH2CH2 C = C CH3 H.

A: Given : structure of the compound.  To find : name of the organic compound. Solution : As we know…

Q: A,

A:

Q: What is the name of this chiral molecule?

A: The name of the chiral molecule is given below:

Q: how can we change the configuration of a chiral molecule?

A: Any chiral center can have two possible configurations, and these configurations are designated…

Q: How many chiral carbon are there? " H C=0 Н-С— ОН НО — С— Н НО — С— Н Н —С— ОН CH,OH 3 5 2.

A: Given molecule is a aldohexose. It is a carbohydrates.

Q: Glucose is a six-carbon polyhydroxyaldehyde. Determine the structure of the product of the reaction…

A:

Q: CH3 CH3 H-C CH CH3 H3C This compound has how many chiral carbons? 3.

A: Chiral carbon is also called as asymmetric carbon atom. In which all the atom or group attached to…

Q: Define each term related to optical isomerism: enantiomers, chiral, dextrorotatory, levorotatory,…

A: Enantiomers: The isomers which are non-superimpossible mirror images of each other are called…

Q: Label Chiral carbon atoms of Propranolol

A:

Q: compound? H2N OH This compound has one chiral carbon. This compound has no chiral carbon.

A: A chiral center is defined as an atom in a molecule that is bonded to four different chemical group…

Q: The chiral carbon atom is: a. A carbon atom that has a double bond b. A carbon atom that has no…

A: The answer is given as follows  A chiral carbon is that carbon which have four different group,…

Q: How many chiral carbon? CI CI O 2 O 3 5.

A: The number of chiral carbons in given compound has to be given.

Q: Name the organic structure. CH3CH2CH2CH2 C = C CH3

A: Given organic compound is,

Q: H. |1 C=0 H C OH 3 CH2OH Number of chiral carbon atoms: Name of the structure

A: Given that : We have to determine the number of chiral carbon atoms in the following structure and…

Q: How many chiral center(s) is/are present in the structure below: O a. 12 b. 10 O c. 11 O d. 8 ÕH 27…

A:

Q: H.

A:

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: in which ways a chiral molecule is different from achiral molecule?

A: Difference between chiral molecule and achiral molecule,

Q: determine the chiral centers in the "Morphine". and draw the stereoisomer of the morphine.

A: Chiral center is a center in the molecule, which has different substituents attached to it. In case…

Q: COOH H. OH CH3

A: Applying concept of chiral carbon.

Q: The chiral carbon atom is: a. A carbon atom that has a double bond O b. A carbon atom that has no…

A: The valency of carbon atom is four which implies the carbon atom can be attached with four atoms of…

Q: draw structure for 4-bromo-2-pentene where the double bond has a Z geometry and the chiral carbon an…

A:

Q: A H3PO4 B PCC CH₂Cl2 с PPh3 THE

A:

Q: number of chiral carbon atoms in one molecule of the compound: НН ОН ... HOCH S-Ċ-Ċ

A: A catalyst is a species that increase the rate of reaction without getting consumed in a reaction.

Polymers

Polymers are naturally occurring or synthetically produced large molecules or compounds which are made up of series of repeating units called monomers. They are joined together by chemical bonds. The term polymer is coined from Greek roots meaning 'many parts' and are found almost everywhere from the plastics bags to the rubber of our tires to our DNA strands.