How many moles of C are formed upon complete reaction of2mol of Baccording to the generic chemical reaction:A +2 В > СXSTARTING AMOUNTADD FACTORANSWERRESET*( )0.5416.022 x 1023mol Amol Cmol B2.

By the help of stoichiometric coefficient we can find the amount of unknown substance by the help of…

Answered: How many moles of C are formed upon…

How many moles of C are formed upon complete reaction of 2 mol of B according to the generic chemical reaction: A+ 2 B- C

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.39PAE: Methanol, CH3OH, is used in racing cars because it is a clean-burning fuel. It can be made by this...

See similar textbooks

Related questions

Q: Considering the limiting reactant concept, how many moles of C are produced from the reaction of…

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: For the given reaction: C(s) + O2 (g)--> CO2(g) 1 mol 1 mol 1 mol Mass of carbon = 25.3 g…

Q: Indicate how many moles of the second reactant would be required to react with exactly .460 mol of…

Q: 1. The combustion of carbon monoxide gas in oxygen gas is represented by the following balanced…

A: Note : As per guidelines we are supposed to answer first question. please repost the other question…

Q: 1. Plants and animals burnt glucose (C6H1206) inside their cells to release energy. This process is…

A: Given: The number of moles of glucose is 45.90 moles The by-products are carbon dioxide and water

Q: given the equation below calculate the mass of potassium hydroxide (in grams) required to completely…

Q: According to the following reaction, how many moles of aluminum sulfate will be formed upon the…

Q: Consider the balanced reaction given below. How many moles of CO2 would form when 0.628 mol of C4H3…

A: Given :- C4H8 + 6O2 →4CO2 + 4H2O No.of moles of C4H8 = 0.628 mol To calculate :- No.of moles of…

Q: Determine the number of grams of C4H10 that are required to completely react to produce 8.70 mol of…

Q: How many moles of AlCl3 would be produced if 9.00 moles of HCl is reacted according to the following…

Q: 43: Consider the generic chemical equation 2A + 4B -> 3C. What is the limiting reactant when each of…

A: Limiting reagent is the reagent which is present in limited amount in a given reaction. During the…

Q: This reaction shows the complete combustion of octane, C8H18, a component of gasoline. 2 C8H18(l) +…

A: The given balanced chemical reaction is shown below.

Q: What quantity of moles of H,SO. are required to completely react with 7.20 mol of Al according to…

A: Given Number of moles of Al = 7.20 mol 2Al(s) + 3H2SO4(aq)--------> Al2(SO4)3(aq) +3H2(g)

Q: how many moles of nitrogen gas will be formed

A: Given :- number of moles of ammonium nitrite = 0.875 mol To calculate :- number of moles of…

Q: According to the following reaction, how many grams of nitrogen gas will be formed upon the complete…

A: Given :- ammonium nitrite(aq) → nitrogen(g) + water (l) mass of ammonium nitrite = 27.9 g To…

Q: Determine the number of grams of c,H10 that are required to completely react to produce 8.70 mol of…

A: The given chemical equation as follows --- 2 C4H10 (g) + 13 O2 (g) → 8 CO2 (g) + 10 H2O…

Q: Methanol can be formed by the following UNBALANCED equation below. How many grams of methanol can be…

A: According to the mole concept, 1 mole of each substance contains 6.022×1023 atoms or molecules. The…

Q: Consider the following reaction: 2A - B ---3C + D 3.0 mol A and 2.0 mol B react to form 4.0 mol C…

A: from above Balanced equation 2mole of A needs 1 mole of B i.e 3mol of A needs 1.5 mole of B

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: Given information, Mass of carbon (graphite) is 22.6 grams.

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: When an element or compound reacts with oxygen and it leads to the formation of heat and light then…

Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…

A: Given balanced equation: N2(g)+3H2(g)⟶2NH3(g) The initial moles of N2 = 0.180 mol The initial moles…

Q: Determine the number of grams of C-H20 that are required to completely react to produce 8.70 mol of…

A: Given : To determine the no.of grams of C4H10.

Q: How many molecules of O2O2 are produced when 47.1 g47.1 g of KClO3KClO3 decomposes as shown in the…

Q: Consider the following reaction: N2+3 H2 → 2 NH3 How many grams of H, arè needed to completely react…

A: Answer: (D)1.1 g

Q: For the reaction shown, calculate how many moles of NO2 form when each amount of reactant completely…

Q: According to the following reaction, how many grams of carbon dioxide will be formed upon the…

A: The limiting reagents in any reaction contain smaller mass/moles and tend to get wholly consumed by…

Q: Consider the following balanced reaction between hydrogen and nitrogen to form ammonia:…

A: The given balanced reaction equation is, 3H2(g) +N2(g) --> 2NH3(g) From this reaction we see…

Q: Determine the number of grams of C,H10 that are required to completely react to produce 8.70 mol of…

A: Calculation is given as follows

Q: How many g of H2O can be formed from 8.50 g CH4?

A: Given :- mass of CH4 = 8.50 g To calculate :- mass of H2O formed (in grams)

Q: 1. Consider the generic reaction: A + 2B→ C How many moles of C are formed upon the complete…

A: Hello. Since your question has multiple questions, we will solve the first question for you. If you…

Q: number of grams of C₄H₁₀

Q: Mg(s)+2HCl(aq)→MgCl2(aq)+H2(g) If 2.5 g of Mg reacts will excess HCl in the reaction listed…

A: Mg(s)+2HCl(aq)→MgCl2(aq)+H2(g) From the Balanced chemical equation we get that , 1 mol Mg produce…

Q: Given the equation: 4 NH3 + 7 O2 ----> 4 NO2 + 6 H2O (a) How many moles of NH3 must react if 24.8…

A: Moles of ammonia react if 24.8mol water produced is

Q: According to the following reaction, how many grams of carbon dioxide will be formed upon the…

A: Given: The mass of oxygen gas is 21.6 g. The reaction between carbon monoxide and oxygen gas to form…

Q: grams of carbon dioxide

Q: For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O how many moles of sodium sulfate (Na2SO4) are…

A: The balanced reaction taking place is given as, => 2 NaOH + H2SO4 ------> Na2SO4 + 2 H2O

Q: How many moles of H:SO. are required to completely react with 7.20 mol of Al according to the…

A: The SI unit for the amount of substance present in a substance is called the number of moles. 1 atom…

Q: According to the following reaction, how many grams of ammonia will be formed upon the complete…

A: In a chemical reaction, the reactants and the products that react and are produced occur by a…

Q: "In our bodies, sugar is broken down with oxygen to produce water and carbon dioxide." According to…

Q: According to the following reaction, how many grams of carbon dioxide will be formed upon the…

A: Propane undergoes combustion reactions in a similar fashion to other alkanes. In the presence of…

Q: 12. Balanced Chemical Equation Reaction Type: At completion of reactions: Formula of Reactant A…

A: •BALANCED CHEMICAL EQUATION:- 2 Li + Mg(NO3)2 => 2LiNO3 + Mg *Here Li is displacing the Mg…

Q: In the reaction, Fe2O3 (s) + 2Al (s) → 2Fe (l) + Al2O3 (s) a) Which reactant is the limiting…

A: Limiting reagent is the reactant that limits the chemical reaction and determines the amount of the…

Q: From the reaction: H₂ + O₂ ---> H₂O How many grams of water are produced when 3.2 mol of O₂ are…

A: In this question, we will determine the mass of the water in grams unit. First we need to determine…

Q: According to the following reaction, how many grams of sulfur dioxide will be formed upon the…

A: Given- Reaction - S + 2CO = SO2 + 2C 1)Amount of substance of sulfur : Excess 2)Amount of Carbon…

Q: According to the following reaction, how many grams of water are necessary to form 0.295 moles…

A: Given Number of mole of H3PO4 = 0.295 mole Mass of water = ?

Q: According to the balanced reaction below, calculate the moles of NH. that form when 4.2 mol of N2H«…

A: Given reaction is, 3 N2H4(l)-------> 4NH3(g) + N2(g) Moles of N2H4= 4.2 mol

Q: How many moles of C are formed upon complete reaction of 2 mol of B according to the generic…

A: Since for any balanced reaction The relationship between the moles of reactants and products is…

Q: 13. Determine the limiting reactant from the following reaction below if (a) 5 mol of each reactant…

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: Concept introduction: Number of moles of a substance is equal to the ratio of mass to molar mass.…

Q: Methanol can be formed by the following UNBALANCED equation below. How many grams of methanol can be…

A: Given chemical reaction, H2(g) + CO(g) -------> CH3OH(l) The balanced chemical equation, 2H2(g)…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

How many moles of C are formed upon complete reaction of
2
mol of B
according to the generic chemical reaction:
A +
2 В > С
X
STARTING AMOUNT
ADD FACTOR
ANSWER
RESET
*( )
0.5
4
1
6.022 x 1023
mol A
mol C
mol B
2.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
On Easter Sunday, April 3, 1983, nitric acid spilled from a tank car near downtown Denver, Colorado. The spill was neutralized with sodium carbonate: 2HNO3(aq)+Na2CO3(aq)2NaNO3(aq)+H2O(l)+CO2(g) a. Calculate H for this reaction. Approximately 2.0 104 gal nitric acid was spilled. Assume that the acid was an aqueous solution containing 70.0% HNO3 by mass with a density of 1.42 glcm3. What mass of sodium carbonate was required for complete neutralization of the spill, and what quantity of heat was evolved? (Hf for NaNO3(aq) = 467 kJ/mol) b. According to The Denver Post for April 4, 1983, authorities feared that dangerous air pollution might occur during the neutralization. Considering the magnitude of H, what was their major concern?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
Methanol, CH3OH, is used in racing cars because it is a clean-burning fuel. It can be made by this reaction: CO(g)+2H2(g)CH3OH(l) What is the percentage yield if 5.0103gH2 reacts with excess CO to form 3.5104gCH3OH ?
Small quantities of oxygen gas can be generated in the laboratory by the decomposition of hydrogen peroxide. The unbalanced equation for the reaction is H2O2(uz/)-? H2O(/) + O2(g) Calculate the mass of oxygen produced when 10.00 g of hydrogen peroxide decomposes.