Answered: How many moles of NH3 are produced from…

Science

Chemistry

How many moles of NH3 are produced from 5.0 moles N2 and 13 moles of H2 in the following reaction? 3H2+N2->2NH3

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.88E

See similar textbooks

Related questions

Q: How many moles of water are produced from 3 moles of CH4 according to the following reaction…

A: Given reaction, CH4+2O2->CO2+2H2O Given that, no. of moles of CH4= 3 mole

Q: How many moles of NH3 are produced from 13 grams H2?

A: N2 +3H2 →2NH3

Q: How many moles of NH3 are produced from 5.0 moles N2 and 13 moles of H2 in the following reaction?…

A: 8.66 moles of NH3 are produced in the given process.

Q: How many moles of C are formed upon complete reaction of 2 moles of B according to the generic…

A: Formation or decomposition of moles of substance depends on the stoichiometry of the substance.

Q: How many moles of O2 are needed to produce 34.26mol of CO2? C2H8(g)+O2(g)⟶CO2(g)+H2O(g)

Q: If 10.0 grams of carbon dioxide are involved in the Grinard reaction, how many moles of carbon…

Q: How many moles of N2 will be used up when 1.60 moles of H2 are used in the following equation?…

Q: Which reactant is the limiting reagent if 6 mol of H2 and 4 mol of O2 are used? 2H2 + O2 → 2H2O…

A: Given reaction is 2H2 + O2 = 2H2O

Q: According to the following reaction, how many moles of potassium phosphate will be formed upon the…

A: Given, the chemical reaction as follows,3KOH(aq)+H3PO4(aq)→K3PO4(aq)+3H2O(l)we are asked to…

Q: Consider the reaction: 2S+3O2=2SO3 1. How many moles of S is needed to form 2 moles of SO3? 2. How…

A: From the given reaction, it is clear that 2 moles of S reacts with 3 moles of O2 to form 2 moles of…

Q: Calculate the moles of O2 needed to react with 1.50 moles Al in a synthesis reaction

Q: How many moles of water are produced from 1 mole of CH4 according to the following reaction…

A: How many moles of water are produced from 1 mole of CH4 according to the following reaction…

Q: How many carbon monoxide molecules (CO) are needed to react with 50 hydrogen molecules (H2) to…

A: Reaction between CO and H2 molecule that gives CH3OH.

Q: H2SO4 + 2 KOH→ 2H2O + K2SO4; A) Determine the moles of KOH needed to react with 5.5 moles of H2SO4.…

Q: How many moles of HCl can be produced from 0.226 g of SOCl2? SOCl2(ℓ) + H2O(ℓ) → SO2(g) + 2HCl(g)

A: Given, The balanced chemical equation, SOCl2(ℓ) + H2O(ℓ) → SO2(g) + 2HCl(g) Mass of SOCl2 = 0.226 g…

Q: 4Na(s) + O2(g) --> 2Na2O(s) how many grams of O2 are needed in a reaction that produces 75.0g of…

A: The given reaction is, 4Na(s) + O2(g) --> 2Na2O(s) Clearly, from the above…

Q: Aspirin (C9H8O4) is industrially made from salicylic acid (C7H6O3) according reaction below. How…

A: When two reactive compounds are mixed, then they react according to the stoichiometry of the…

Q: How many moles of potassium chloride (KCl) are produced by the decomposition of 13.0 moles of…

A: Given, Chemical Reaction : 2 KClO3 ---> 2 KCl + 3 O2 Moles of KClO3 = 13.0 moles Moles of KCl =…

Q: Calculate the number of moles of GaCl3 produced from 1 moles HCl using the following balanced…

Q: According to the following reaction, how many moles of ethane (C2H6) will be formed upon the…

A: The given reaction is, H2 (g) + C2H4 (g) -----> C2H6 (g) Clearly, from the…

Q: The reaction of 5.07g N2 with 0.722g h2 produces 1.27g NH3. What is the percent yield of this…

A: Yield is calculated by ratio of Autual yield to theoretical yield.

Q: If you have 5 mol H₂ and 2 mol N₂, what is the limiting reagent in the reaction below? 3 H₂(g) + N₂…

A: Limiting reagent ----- > The limiting reagent is the reactant that is completely consumed in a…

Q: Calculate the number of moles of H2 produced from 8.62 moles of Fe by the following reaction. 3 Fe +…

Q: For the reaction shown, calculate how many moles of ammonia gas forms when 5.3 moles of N2H4…

A: The balanced reaction given is 3 N2H4 -----> 4 NH3 + N2

Q: How many moles of oxygen are necessary to react completely with 4.10 moles of propane (C 3 H 8 )

A: We have given that The reaction of propane react with oxygen to give CO2 and H2O The balance…

Q: How many moles of nitric acid HNO3 are needed to react with 2.56 moles of Cu in the following…

A: According to the given reaction: 3Cu+8HNO3 -->3Cu(NO3)2+2NO+H2O 3 moles of Cu reacts with 8 moles…

Q: How many moles of H2 are produced by the reaction of 1.24 moles of H3PO4 in the following reaction.?…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: How many moles of h2 are produced from 0.2000g of Zn? Zn+2HCI--> ZnCl2+H2 Please show how you got…

Q: If 3.0 moles of Na react with 1.0 moles of Cl2, how many moles of the excess reagent remains after…

Q: C,H,0 + 30, → 2C0, + 3H,0 How many of each atom is present in the products? C= H=

A: The answer to the following question is given as -

Q: 6 NaOH + 2AL --> Na3 ALO3+3H2 how may moles of Na3 ALO3 can be formed from 90.0 g of sodium…

A: Given; The reaction is as follows: 6 NaOH + 2Al --> 2Na3 AlO3+3H2. The mass of NaOH = 90.0 g

Q: How many moles of AICI3 are produced from 27.0g of Al and 90.0g of HCI? 2 Al + 6 HCI → 2 AICI3 + 3…

A: Given:

Q: For this reaction, 2 NH3 + CO2 --> H2NCONH2 + H2O how many moles of CO2 are required to produce 3.0…

A: The balanced equation is: 2 NH3 + CO2 --> H2NCONH2 + H2O It is shown that 2 mol of NH3 react…

Q: How many moles of O2 are needed to react completely with 25.0 grams of benzene (C6H6) in the…

A: Given: 2 C6H6+15 O2→12 CO2+6 H2OMass of benzene=25.0 g

Q: How many moles of NH3 will be produced from 1.60 moles of H2 in the following equation? N2 + 3H2…

Q: Based on the reaction shown which statement is true? S + O2 --> SO2 (delta)H = -70.8kcal A)…

A: The balanced chemical equation for the given reaction between the sulfur atom and dioxygen is shown…

Q: How many moles of NO are produced from the reaction of 0.25 moles of NH3? If 17.88moles of O2 react…

Q: How many moles of W are needed to react with 1.0 mol of Ho in the hypothetic chemical reaction? 3W…

Q: Calculate the number of moles of H2 produced from 1.42 moles of Fe by the following reaction. 3 Fe +…

A: The provided reaction is- 3 Fe + 4 H2O ==> Fe3O4 + 4 H2 Provided moles of Fe=1.42 moles Since,…

Q: What is a limiting reagent and how many moles of NO2 form when 5.0 mol NH3 react with 5.0 mol of O2

A: Limiting reagent controls the the reaction because it is used up totally during the reaction and…

Q: NaH2PO4 + 2 NaOH ------------> 2 H2O + Na3PO4 How many moles of NaOH are required to react…

A: Since from the above balanced reaction we can see that the 1 mole of NaH2PO4 is reacting with 2…

Q: According to the following reaction, how many moles of ethane (C2H6) will be formed upon the…

A: Given Number of moles of H2 = 0.851 moles Number of moles of ethane = ? H2(g) + C2H4(g)…

Q: what amount of al2o3 are produced from the reaction of 3.0 mol al with 2.0 mol fe2o3? 2Al + Fe2O3…

A: The reaction is, From the balanced equation, it is clear that 1 mol Fe2O3 reacts with 2 mol Al.…

Q: If 5.6 moles of pentane, C5H12 are reacted with sufficient O2 , how many moles of CO2 are produced?

Q: 2 HC2H3O2 + K2CO3 --> H2O + 2 KC2H3O2 + X If the 108 molecules of HC2H3O2 react with 74 molecules…

A: Given information:Number of molecules of HC2H3O2 = 108 moleculesNumber of molecules of K2CO3 = 74…

Q: In the following reaction, If 9.00 moles of O2 are used, how many moles of H2O is produced ? 2…

Q: Calculate the number of moles of GaCl3 produced from 4.50 moles HCl using the following balanced…

A: Given balanced equation: 2 Ga + 6 HCl → 2 GaCl3 + 3 H2 We have to find the number of moles of GaCl3…

Q: 4 Al(s) + 3Oxygen subscript 2(g) ->2Al(subscript 2) O subscript 3 (s) What is the limiting reagent…

Q: How many moles of O2 are produced if 2.00 moles of KClO3 are decomposed in the following unbalanced…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

How many moles of NH3 are produced from 5.0 moles N2 and 13 moles of H2 in the following reaction? 3H2+N2->2NH3

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1 : Given

VIEW

Step 2 : Calculations

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form carbon tetrafluoride and nitrogen trifluoride. C2N2(g)+7F2(g)2CF4(g)+2NF3(g)(a) How many moles of fluorine react with 1.37 mol of cyanogen? (b) How many moles of CF4 are obtained from 13.75 mol of fluorine? (c) How many moles of cyanogen are required to produce 0.8974 mol of NF3? (d) How many moles of fluorine will yield 4.981 mol of nitrogen trifluoride?
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
if 7.0 moles of pentane C5H12 are reacted with sufficient O2 how many moles of CO2 are produced
How many moles of NH3NH3 can be produced from 16.5 molmol of H2H2 and excess N2N2?
How many moles of O2 are needed to react completely with 25.0 grams of benzene (C6H6) in the following balanced combustion reaction? 2 C6H6 + 15 O2 --> 12 CO2 + 6 H2O
How many moles of H2 are produced by the reaction of 1.24 moles of H3PO4 in the following reaction.? 2Cr + 2H3PO4 ------> 3H2 + 2CrPO4
plant photosynthesis sugars and oxygen from carbon dioxide and water are shown 6co2+6h2o=c6h12o6+o6 calculate %yield of 1.24g of c6h12o6 are produced by reaction of 1.24of cp2. the molar mass is 44.01g and the molar mass of c6h12o6 is 180.2g
The following diagram represents a high-temperaturereaction between CH4 and H2O. Based on this reaction, findhow many moles of each product can be obtained startingwith 4.0 mol CH4. [Section 3.6]
Sulfur trioxide dissolves in water, producing H2SO4. How much sulfuric acid can be produced from 12.7 mL of water and 22.3g of SO3? How much reagent excess is left over?