Answered: How many moles of C are formed upon…

How many moles of C are formed upon complete reaction of 2 moles of B according to the generic chemical reaction: A+2B-->C

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section: Chapter Questions

Problem 110QRT

See similar textbooks

Related questions

Q: According to the following reaction, how many grams of ethane (C₂H6) will be formed upon the…

Q: Consider the reaction between HCl and O2 4HCl+O2------>2H2O+2Cl2 calculate the theoretical yield…

A: Balanced chemical equation: 4HCl + O2 ------> 2H2O + 2Cl2 From the above equation:…

Q: ow many moles of ammonia would be required to react exactly with 0.366 moles of copper(II) oxide in…

A: Given : 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3 H₂O(g)

Q: 3H2 + N2 --> 2NH3 If you were to have 10moles of H2 and 4moles of N2, how many moles of NH3 could…

A: Firstly, find the limiting reagent in the given reaction & use stoichiometric calculation for to…

Q: What relationship can be used to find the mass of H2O that can be produced from complete reaction of…

Q: How many moles of nitric acid, HNO₃, are needed to react with 2.56 moles of Cu in the following…

A: The answer of following question is given below.

Q: 4HCl+O2---->2H2O+2Cl2 calculate the theoretical yield of H2O when 64 grams of HCl react with 19…

A: Stoichiometry of reaction :- 4HCl…

Q: How many moles of ethane (C2H6) are reacted if 0.554 mol of carbon dioxide are produced? 2 C2H6(g) +…

A: Applying concept of limiting reagent and mole concept.

Q: How many moles of C are formed upon complete reaction of 2 mol of B according to the generic…

A: By the help of stoichiometric coefficient we can find the amount of unknown substance by the help of…

Q: How many moles ofcarbon dioxideare produced from 4.0 moles of C3H8

A: chemical reation with oxygen to produce CO2 C3H8(g) + 5 O2(g) → 3 CO2 (g) + 4H2O(g)

Q: Consider the generic chemical equation: 2 A + 4 B --------> 3 C. 1. What type of reaction the…

A: 1. This reaction represent combination reaction as we can see A and B combine to give C.…

Q: A) According to the following reaction, how many grams of carbon tetrachloride are required for the…

A: Please note- As per our company guidelines we are supposed to answer only one question. Kindly…

Q: For the reaction shown, calculate how many moles of NH3 form when each amount of reactant completely…

A: For the reaction 3N2H4(l)→4NH3(g)+N2(g)According to Balance Chemical Equation∵3mol of…

Q: 0.180 mol N20.180 mol N2 and 0.573 mol H20.573 mol H2 are present initially. After complete…

A: Given, Moles of N2 = 0.180 mol Moles of H2 = 0.573 mol Moles of NH3 produced = ?

Q: Fe2O3 + 3 C →→ 2 Fe + 3 CO How many moles of Fe2O3 are required to react with 9.1 mol of C?…

Q: According to the following reaction, how many moles of ammonia will be formed upon the complete…

A: Given reaction, NH4Cl(aq) -----> NH3(g) + HCl(aq) Given that, 0.985 moles ammonium chloride

Q: (e) number of Carbon atoms in 40.0 g of C¿H, O (f) number of O atoms in 6.25 x 10-3 mol Al(NO3)3 6.…

A: (e.) Mass of C2H6O = 40.0 g Molar mass of C2H6O = 46.07 g/mol So, number of moles = mass / molar…

Q: C3Hg(g)+___O2(g)-->3CO2(g)+4H2O(l) How many O atoms are present on the right side of the chemical…

A: The given chemical equation is, C3H8 (g) + ___O2(g) → 3CO2(g) + 4 H2O(l)

Q: How many g of H2O can be formed from 6.50 g CH4? CH4 + 2 O2 ----->CO2 + 2 H2O

Q: How many moles of O2 (g) will remain after the reaction .8000 moles of NH3 (g) and .4000 moles of O2…

A: The balanced reaction taking place is 2 NH3 (g) + 3 O2 (g) + 2 CH4 (g) -------> 2 HCN (g) + 6…

Q: How many moles of ammonia would be required to react exactly with 0.470 moles of copper II oxide in…

A: The balanced reaction taking place is given as, => 2 NH3 (g) + 3 CuO (s) → 3 Cu (s) + N2 (g) + 3…

Q: According to the following reaction, how many grams of dichloromethane (CH2Cl2) will be formed upon…

Q: Octane (C8H18) reacts with O2 to form CO2 + H2O. How much moles of octane do you need to produce…

A: The reaction is an example of combustion reaction as we see oxygen gas as one of the reactant

Q: How many moles of H2O can be formed from 2.26x1023 molecules of NH3 from the following equation?…

A: According to the mole concept, in terms of mass, the amount of substance in moles is equal to the…

Q: 3H2 + N2 --> 2NH3 If you were to have 12moles of H2 and 3moles of N2, what would be the limiting…

A: The balanced reaction taking place is given, => 3 H2 + N2 ------> 2 NH3 Given : Moles of H2…

Q: CH4 + 2O2 --> 2H2O + CO2 How many moles of water (H2O) can be produced from the combustion of 7…

A: here given CH4+2O2→2H2O+CO2 we have to determine how many moles of H2O produce from 7…

Q: C,H,0 + 30, → 2C0, + 3H,0 How many of each atom is present in the products? C= H=

A: The answer to the following question is given as -

Q: In the reaction 3CI2 (g) + 6NaOH(aq) --> 5NaCI(aq) + NaCIO3(aq) + 3H2O(l) How many moles of…

A: The balanced reaction given is 3 CI2 (g) + 6 NaOH (aq) -----> 5 NaCI (aq) + NaCIO3 (aq) + 3 H2O…

Q: How many moles of water are made from complete reaction of 4.3 moles of oxygen gas with hydrogen gas…

A: Given reaction: 2H2 + O2 → 2H2O We have to calculate the number of moles of water that will be…

Q: A hydrocarbon compound (containing only H and C) is completely combusted in excess oxygen gas. If…

Q: Suppose 2.5 g of Compound A and 8.5 g of Compound B are consumed in a reaction that produces only…

A: Given : Mass of A reacting = 2.5 g Mass of B reacting = 8.5 g And there is only 1 product i.e C.

Q: For the reaction 2HCl + Ca(OH)2 ----> CaCl2 + 2H2O how many grams of calcium chloride, CaCl2 are…

Q: Suppose 3.5 g of Compound A and 8.5 g of Compound B are consumed in a reaction that produces only…

A: To solve this problem we will use Law of Conservation of mass . According to this law Mass of…

Q: How many moles of C are formed upon complete reaction of 2 mol of B according to the generic…

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: Use stoichiometry for the calculation of the moles of CO2 from the given equation.

Q: How many moles of C are formed upon complete reaction of 2 mol of B according to the generic…

A: The relation between the reactant and product quantity can be established stoichiometrically

Q: How many moles of H2O can be formed from 3.64x1023 molecules of NH3 from the following equation?…

A: # We the relation between the moles of ammonia and water we can use that to calculate the moles of…

Q: Given 2 CL2 + Ti ---> TiCl4, how many moles of products will be produced from 1,205.3 grams of…

Q: A mixture of CO and H2 gives a theoretical yield of 407g CH3OH. CO(g) + 2H2(g) --> CH3OH (l)…

A: In the given reaction CO reacts with H2 to form methanol (CH3OH). The theoretical yield of the…

Q: According to the following reaction, how many grams of carbon dioxide will be formed upon the…

A: Propane undergoes combustion reactions in a similar fashion to other alkanes. In the presence of…

Q: A hydrocarbon compound (containing only H and C) is completely combusted in excess oxygen gas. If…

A: Given : The compound contains only C and H. Mass of CO2 i.e carbon dioxide produced on combustion =…

Q: Nitrogen triiodide is an extremely unstable compound. It is so unstable that touching it with a…

Q: How many moles of NO2 would b produced from 8.0 mol of o2 in the reaction below assuming the…

A: Moles of O2 = 8.0 mol Percent yield = 57 %

Q: How many moles of O2 react with or are produced by 6.75 moles of the first reactant shown in each…

A: Mole of a substance or a mole of a particles is defined as exactly 6×10^23 particles which may be…

Q: How many moles of Al2O3 can be formed from 19.2 g of O2? How many grams of Al2O3 can be formed from…

A: In this questions, first we will determine the moles of Al2O3 and then we will calculate the mass of…

Q: How many moles of C are formed upon completed reaction of 2 mol B according to generic chemical…

A: To solve this problem we have to consider the stoichiometry ratio of the given generic chemical…

Q: MnO2(s) + HCl(aq)→Cl2(g) + MnCl2(aq) + H2O(l) How many moles of HCl are required to produce 15.0 kg…

A: Stoichiometry involves the calculation of concentration of solutions in the given conditions of…

Q: Suppose 5.5 g of Compound A and 3.5 g of Compound B are consumed in a reaction that produces only…

A: Given: The mass of compound A and compound B is 5.5 g and 3.5 g, respectively.

Q: From the reaction: (unbalanced) B2H6 + O2 --> HBO2 + H2O How many moles of water are produced from…

Q: According to the following reaction, how many moles of carbon dioxide will be formed upon the…

A: Concept introduction: Number of moles of a substance is equal to the ratio of mass to molar mass.…

Question

How many moles of C are formed upon complete reaction of 2 moles of B according to the generic chemical reaction: A+2B-->C

Definition Definition Transformation of a chemical species into another chemical species. A chemical reaction consists of breaking existing bonds and forming new ones by changing the position of electrons. These reactions are best explained using a chemical equation.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

For each of the following incomplete and unbalanced equations, indicate how many moles of the second reactant would be required to react completely with 0. 145 mole of the first reactant. msp;BaCl2(aq)+H2SO4(aq) msp;AgNO3(aq)+NaCl(aq) msp;Pb(NO3)2(aq)+Na2CO3(aq) msp;C3H8(g)+O2(g)
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
A mordant is a substance that combines with a dye to produce a stable fixed color in a dyed fabric. Calcium acetate is used as a mordant. It is prepared by the reaction of acetic acid with calcium hydroxide. 2CH3CO2H+Ca(OH)2Ca( CH3 CO2)2+2H2O What mass of Ca(OH)2 is required to react with the acetic acid in 25.0 mL of a solution having a density of 1.065 g/mL and containing 58.0% acetic acid by mass?
When 9.59 g of a certain vanadium oxide is heated in the presence of hydrogen, and a new oxide of vanadium are formed. This new vanadium oxide has a mass of 8.76 g. When the second vanadium oxide undergoes additional heating in the presence Of hydrogen, 5.38 g of vanadium metal forms, a. Determine the empirical formulas for the two vanadium oxides. b. Write balanced equations for the Steps of the reaction. c. Determine the mass of hydrogen needed to complete the steps of this reaction.
Methanol, CH3OH, is used in racing cars because it is a clean-burning fuel. It can be made by this reaction: CO(g)+2H2(g)CH3OH(l) What is the percentage yield if 5.0103gH2 reacts with excess CO to form 3.5104gCH3OH ?
The text explains that one reason why the actual yield for a reaction may be less than the theoretical yield is side reactions. Suggest some other reasons why the percent yield for a reaction might not be 100%.
3.59 The composition of materials such as alloys can be described in terms of mole percentage (mol%), atom percentage (at%), or weight percentage (wt%). Carry out the following conversions among these units. (a) 60 Cu and 40 Al to at%, (b) 25 mol% NiO and 75 mol % MgO to wt%, (C) 40 wt% MgO and 60 wt% Feo to mol %
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)