Answered: Identify oxidizing agent and reducing…

Identify oxidizing agent and reducing agent in the reactions. Cr3+ +H2O+ 6ClO3 - → Cr2O72- +6ClO2 + 2H+ 3Mg + N2 → Mg3N2

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter19: Transitition Metals, Coordination Chemistry And Metallurgy

Section: Chapter Questions

Problem 19.57QE

See similar textbooks

Related questions

Q: 3. In each of these reactions assign oxidation numbers to all species, and tell which substance is…

Q: Identify oxidizing agent and reducing agent in the reaction 2Na2S2O3 + I2 → Na2S4O6 + 2NaI 2. N2…

A: Oxidizing agent is the species that oxidises other substance and itself reduces Whereas reducing…

Q: 1. What is the oxidation number of each element in the following compounds? a. H2SO3 b. PbSO4 c.…

Q: What is the total number of moles (n) of electrons exchanged between the oxidizing agent and the…

A: Split the overall redox reaction into half-cell reactions in order to determine the number of…

Q: : Circle the oxidizing agents and underline the reducing agents in the following reactions. 1. 2C+…

A: Identify the oxidizing agent and reducing agents in the given reactions.

Q: To do: Identify the oxidizing agent and reducing agent in the reactions. 1. 2Na2S2O3+/2→…

A: Here we have to predict the oxidising agent and reducing agent in the following redox reactions.

Q: 2Cr3+ + 3SO42-+ 5H2O2CrO42- + 3H2SO3+ 4H+ In the above redox reaction, use oxidation numbers to…

Q: Indicate the oxidation numbers for the various atoms in the following unbalanced redox reaction and…

Q: Reactivity factor of reducing agent in the balanced redox equation: H2O + H3AsO3 + I2 ---> H3AsO4 +…

A: Balence redox reaction : H2O+H3AsO3+I2--->H3AsO4+ 2HI

Q: Balance redox reaction: MnCl2(aq)+NaBiO3(s)=BiCl3(aq)+NaMnO4(

A: The balanced equation is given below

Q: determine the reducing agent in the following reaction 2 Na + 2 H2O --> 2 NaOH + H2

A: Interpretation : We have to tell which is reducing agent in the following reaction.

Q: PbO2 + H3AsO3+ 2H+Pb2+ + H3AsO4+ H2O In the above redox reaction, use oxidation numbers to…

A: Oxidation : Oxidation is the loss of electron with increase in oxidation state. Reduction :…

Q: Show complete balancing for the 4 REDOX reactions below. → NO + H3 AsO4 + H20 → Cl'- + H2 AsO4 + S…

Q: Assign oxidation numbers to the elements in the following compounds: 1. NH4HCO3 2. F2 3. Ca3(PO4)2

A: Compound can be defined as a substance that is made from combination of two or more identical or…

Q: Write the balanced redox reaction of this: (Cr2O7)2- (aq) +I- (aq) = Cr3+ (aq) +I2 (aq) , in…

A: The question is based on the concept of redox reactions. we have to write balanced reaction of the…

Q: Which of the following reactions are REDOX? A 2 Na + Cl₂ → 2 NaCl B CH4+2O2 → CO2 + 2H2O C Fe2O3 +3…

A: Oxidation = increase in the oxidation state Reduction = decrease in the oxidation state Redox…

Q: Identify the oxidizing and reducing agents in the following:(a) 5H₂C₂O₄(aq) +2MnO₄⁻(aq)+…

Q: For each reaction below, identify the atom oxidized, the atom reduced, the oxidizing agent, and the…

A: We have a. Mg + HCl →MgCl2 + H2 b. KMnO4 + KNO2 + H2SO4 → MnSO4 + H2O + KNO3 + K2SO4 c. KClO3 +…

Q: CuO + H2 ⇌ Cu + H2O CO2 + H2 ⇌ 2CO + H2O H2 + F2 ⇌ 2 HF Fe + O2 ⇌ Fe2O3 NaOH + HCl �� NaCl + H2O

Q: For each reaction, determine whether it is an example of an oxidation-reduction (redox) reaction or…

Q: 1. Predict in which direction (toward the products side or toward the reactants side) that each of…

A: We know that oxidation refers to the loss of electrons by a chemical species while reduction refers…

Q: Zn + Na2CrO4 + NaOH — NaZnO2 + NaCrO2 + H2O balance The redox reaction and include the…

A: Answer - According to the question - Given reaction - Zn + Na2CrO4 + NaOH — NaZnO2 + NaCrO2 + H2O…

Q: Use oxidation numbers to help balance the following redox reaction in basic solution: ClO3-(aq) +…

A: The given redox reaction is:ClO3- (aq) + N2H4 (aq) → NO (g) + Cl- (aq) Oxidation state of Cl in…

Q: Détermine the oxidation number for the following compound Mg in MgCl2 2+ 1+ 2- 1- 0

Q: Identify the oxidizing and reducing agents in the following unbalanced reactions: a) I2 +…

Q: To do: Identify the oxidizing agent and reducing agent in the reactions. 1. 2Na2S2O3+l2-Na2S4O6+2Nal…

A: Here we have predict the substance which act as oxidizing agent and reducing agent.

Q: Write the oxidation half-reaction and reduction for the following: Mg + H* Kl + Cl2 > Mg2+ + H2 +…

A: Oxidation = It is defined as the increase in the oxidation number. Reduction = It is defined as the…

Q: 6NH3 + ClO3-3N2H4 + Cl-+ 3H2O In the above redox reaction, use oxidation numbers to identify the…

A: The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Q: Reactivity factor of oxidizing agent in the balanced redox equation: 16H+ + 2TcO4¯ + 3Sn2+ --->…

A: Substance which undergoes reduction is known as oxidizing agent. And loss of electrons is called…

Q: 2Ag+ + HNO2+ H2O2Ag + NO3-+ 3H+ In the above redox reaction, use oxidation numbers to identify the…

A: If the oxidation number of a species decreases, it is reduced. If the oxidation number of a species…

Q: What is the oxidation reaction for the following redox reaction: 6Fe2+ + Cr2O72- + 14H+ >>> 2Cr3+ +…

Q: Chemical Equation REDOX Atom Atom Yes/No Oxidized Reduced Reducing Oxidizing Agent Agent +2 -2 +2.5…

A: In a redox reaction, one atom is oxidised and the other one is reduced.

Q: Identify the oxidizing and reducing agents in the following:(a) 8H⁺(aq) +6Cl⁻(aq)+ Sn(s)…

A: Oxidation is the process in which electrons are lost by an element and the oxidation number of the…

Q: 9. MnO4 + SO2 + _H2O SO. + Mn2+ + H* Oxidizing agent: Reducing agent: 10. IO3 + HSO3 I + SO? + H*…

A: Oxidizing agent accepts electrons whereas reducing agent donates electrons.

Q: Match the chemical formula with its associated oxidation number of sulfur (S).…

Q: Circle the oxidizing agents and underline the reducing agents in the following reactions. a. 2C +…

A: We have to tell about the oxidising agent and reducing agent in given reactions.

Q: Identify the oxidizing agent and reducing agent in the reaction. 10 OH- + 2 Cr(OH)3 + 3 Br2 → 2…

A: Given : We have to write the oxidizing and reducing agent.

Q: Identify the strongest oxidizing agent (oxidant) Cl2 (E•red = +1.35827 V) Zn (E °red -0.7618 V) Br2…

Q: To do: Identify the oxidizing agent and reducing agent in the reactions. 1. 2N22S2O3+l2¬Na2S4O6+2NAI…

A: Answer: Reactant that gets oxidized in the chemical reaction and reduces others is called as…

Q: What is the total number of moles (n) of electrons exchanged between the oxidizing agent and the…

A: The half cell reactions are : Oxidation : 6 Fe2+ (aq) → 6 Fe3+ (aq) + 6 e- Reduction : Cr2O72-(aq) +…

Q: For each of the following reactions, list the substance reduced, the substance oxidized, the…

Q: List each species that is being oxidized and reduced and the reducing and oxidizing agents in the…

A: Redox reactions are the combination of reduction and oxidation reactions. The type of reaction in…

Q: Assign oxidation numbers to the elements in the following compounds: NH4HCO3 F2 Ca3(PO4)2

Q: For each of the following balanced oxidation-reduction reactions, (i) identify the oxidation numbers…

A: The process where the compound loses electrons is called oxidation. The process where the compound…

Q: Identify whether each of the following reaction is a redox reaction. If it is so, by showing the…

A: Both the reactions are redox reactions. In a redox reaction, reduction and oxidation undergo…

Q: Identify oxidizing agent and reducing agent in the reactions. 1. 2Na2S203 + I2 Na2S4O6+ 2Nal 2.…

A: Oxidizing agent and Reducing Agents identification can be done by change in oxidation state of…

Q: Chati kar bhainn steps show karing q6 6. Balance the following redox reaction in acid solution: SO2…

Q: iven the redox reaction: 2 Br (aq) + F2 (g) Br2 (1) + 2F (aq) entify the ff. Number of electrons in…

A: Oxidation is the process that involve loss of electrons and reduction is process that involve gain…

Q: In redox chemistry, the chemical species that is being reduced is called the oxidizing agent,…

A: Given :- 2Al (s) + 3Zn2+ (aq) → 2Al3+ (aq) + 3Zn (s) Zn (s) + 2H3O+ (aq) → Zn2+ (aq) + 2H2O (l) +…

Question

Identify oxidizing agent and reducing agent in the reactions.

Cr3+ +H2O+ 6ClO3 - → Cr2O72- +6ClO2 + 2H+
3Mg + N2 → Mg3N2

4. 2 Cr,* +H,0+ 6CIO, - - Cr,0,2 +6CIO, + 2H+
5. 3Mg + N, – Mg,N,

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
[Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.
Explain the stability of the complexes TiCl62- and [Zn(en)3]2+
When the K[PtCl3(C2H4)] complex obeys the 18 electron rule according to the electron pair donor method, the electron numbers from platinum, three chloro and one ethylene are ....., ...... and ...... respectively. in total ....... electrons are obtained. The effective atomic number of the [Ir(CO)(PPh3)2Cl(NO)]+ complex is ......
[Cr(H₂O)₆]²⁺ is violet. Another CrL₆ complex is green.Can ligand L be CN⁻? Can it be Cl⁻? Explain.
At 580 nm, the wavelength of maximum absorption, the complex Fe(SCN)2+ has a molar absorptivity of 7.00 x 103 M-1 cm-1. Calculate, (a) the absorbance of a 3.50 x 10-5 M solution of the complex at 580 nm in a 1.50 cm cell (b) the absorbance of a solution in a 2.00 cm cell in which the concentration of the complex is half that in (a)
Q3. Calculate the crystal field stabilization energy (in terms of Dq) for the complexes: [Fe(H2O)6]3+,[Fe(CN)6]3-, [Co(NH3)3Cl3]?
Ocatahedral” Cu (II) complexes are often described as having a (4+2)- coordination pattern. Suggest the origin of this description. Then explain the fact that there are two bonds lengths (in pm) for Cu-OH2 , 196 eq and 230 ax
How would you account for the following? (i) Transition metals exhibit variable oxidation states. (ii) Zr (Z = 40) and Hf (Z = 72) have almost identical radii. (iii) Transition metals and their compounds act as catalyst.
Compare the following complexes with respect to their molecular shape and magnetic behaviour : (i) [Cr(NH3)6]3+ (ii) [Fe(CN)6]4- (iii) [NiCl4]2- (At. No. : Cr = 24, Fe = 26, Ni = 28)
a) Draw the lewis structure of the nitrate ion and discuss its potential to serve as an ambidentate ligand. b) Why did Jorgensen and Werner identify the complex cation [Co(NH3)5No3]2+ aws definitely containing five Co3+ - N and one Co3+ - O interactions?