Identify the unbalanced half-reaction in which a species is reduced.O Cr,0,(s) → Cro (aq)C(s)CO(g)>Al(s)Al3+ (aq)O 21-(aq)1 (s)so, (aq)H, S(g)Identify the initial and final oxidation states for the element iodine in the equation21 (aq)L (s)>initial oxidation state:

When oxidation state is decreasing, it is called reduction.

Identify the unbalanced half-reaction in which a species is reduced. Cr,0,(s) → Cro (aq) C(s) → CO(g) Al(s) Al³+(aq) > 21-(aq) → L(s) so, (aq) H, S(g) Identify the initial and final oxidation states for the element iodine in the equation 21-(aq) → L (s) initial oxidation state:

Identify the unbalanced half-reaction in which a species is reduced. Cr,0,(s) → Cro (aq) C(s) → CO(g) Al(s) Al³+(aq) > 21-(aq) → L(s) so, (aq) H, S(g) Identify the initial and final oxidation states for the element iodine in the equation 21-(aq) → L (s) initial oxidation state:

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section3.5: Oxidatino-reduction And Electron Transfer

Problem 3.11CE

See similar textbooks

Related questions

Q: Write the balanced the following redox reaction using half-reactions: KMnO4-1(aq) + HCl(aq) +…

A: Oxidation state of S and Mn – S in S = 0 Mn in KMnO4 = +7 S in H2S = -2 Mn in MnCl2 = +2

Q: Given the following skeletal half reaction in basic solution: MnO4 (aq) → MnO2(aq) Fill in the…

Q: For the reaction 2 Cr(s) + 3 Pb²*(aq) - 3 Pb(s) + 2 Cr³*(aq), what is the value of n in the Nernst…

A: Oxidation is removal of electron and increase its oxidation state whereas in reduction reaction…

Q: Write the oxidation and reduction half-reaction representedin each of these redox equations. Write…

A: Given reactions are : a). PbO (s) + NH 3 (g) → N2 (g) + H2O(l) + Pb (s)b). I2 (s) + NaS2O3 (aq) →…

Q: 18. For the following redox reaction, write out the balanced half reactions, the overall balanced…

A: Redox reaction: Redox reaction is a type of chemical reaction in which the oxidation states of atoms…

Q: Write the overall chemical reaction and calculate E for the following reduction and oxidation half-…

Q: Write the balanced equation of the oxidation-reduction reaction in acidic media: Mn+2(aq) + BIO3…

A: oxidation-reduction reactions commonly known as redox reactions ,are reactions that involve the…

Q: Write balanced half-reactions for the following redox reaction: BiO,(aq)+3 H,O()+Zn(s) → Bi (aq)+6OH…

A: Redox reaction is the reaction in which both the oxidation reaction and the reduction reaction takes…

Q: 28. For the following reaction, all of the reactants and products are in their standard…

Q: or the reaction of sodium bromide with chlorine gas to form sodium chloride and bromine, the…

A: To find the correct half-reaction for the reaction of sodium bromide with chlorine gas to produce…

Q: what is the oxidizing agent in the redox reaction represented by the following cell notation? Mg(s)…

A: Given cell notation is : Mg (s) | Mg2+ (aq) || Cu+ (aq) | Cu (s) What is the oxidizing agent in the…

Q: The following reaction is completely carried out in aqueous solution. Is it a redox reaction? Cu +…

A: Please find your solution below : The reaction between Cu and AgNO3 is redox reaction. Oxidation…

Q: 5. Balance the reaction in both in acid solution and in basic solution. Cro. lag) + SO3² (aq) →…

A: The given unbalanced equation : CrO42-(aq) + SO32-(aq) → Cr3+(aq) + SO42-(aq)

Q: 7.14(b) Write the cell reaction and electrode half-reactions and calculate the standard emf of each…

A: A question based on electrochemistry, which is to be accomplished.

Q: Consider this redox reaction. 22 2K2Cr207laq) + 6Cu(s) +28H*(aq) 4Cr (aq) + 6CU2*(aq) + 14H,O(1) +…

A: The species which is oxidized is reducing agent. And the species which is reduced is called reducing…

Q: Calculate the A G° for the following redox reaction Cu(s) + Zn 2*(aq) →Cu2*(aq) + Zn(s) E° = -1.10 V…

Q: Balance the following oxidation-reduction reactions that occur in basic solution: a) NO2- (aq) + Al…

Q: What is the number of electrons transferred in the course of the redox reaction? 2Fe+3 + 3Mg→ 2Fe…

A: GIVEN: Reaction: To Solve: Number of electrons transferred in the course of the redox reaction=?

Q: 6. Based on a series of experiments, a third year chemistry student observes the following…

A: Introduction: We have to prepare table of half-reactions and based on the observations we have to…

Q: For the given unbalanced half-reactions, identify the one in which a species is reduced. O Fe2+(aq)…

A: Note: As per our guidelines, we are supposed to answer only one question when multiple questions are…

Q: 2 Magnesium and lead have similar first and second ionization energies, yet their reactivity with…

A: Only part (a) is mentioned to be solve. For the other parts to be solved available data is not…

Q: Balance the following reaction in basic solution. What are the coefficients in front of H 2O and OH…

A: Balanced chemical equation are said to those equations which have same number of atoms that are…

Q: For the reaction 2 Cr(s) + 3 Pb²⁺(aq) ⟶ 3 Pb(s) + 2 Cr³⁺(aq), what is the value of n in the Nernst…

A: Ans is the n= 6

Q: (27) What is the value of the equilibrium constant (Kea) when the following redox reaction takes…

Q: Watch batteries are Silver-Zinc button cells. The reactions taking place in such cells are a pair of…

A: The Reaction be: Zn(s) + Ag2O(s) -----------------------> ZnO(s)+ Ag(s)

Q: (27) What is the value of the equilibrium constant (Kea) when the following redox reaction takes…

A: As per our guidelines, we are supposed to answer only one question. Kindly repost other question as…

Q: Identify the unbalanced half-reaction in which a species is reduced. C(s) → CO(g) Al(s) Al3+(aq)…

Q: 14.56 Complete and balance the following oxidation-reduction reactions, assuming they occur in basic…

Q: 3. Write the half-reactions (labelled as oxidation or reduction) for the following equation: Zns) +…

A: Oxidation Reaction :- When an element releases electrons and it's oxidation number increases, this…

Q: Add the appropriate chemicals so that the following redox equations are balanced. Add H2O if needed.…

Q: 7. Identify the reducing agent in the following chemical reaction. 5Fe2 (aq) + MnO, (aq) + 8H* (aq)…

Q: complete and blance the following oxidation-reduction reactions, which give the highest…

Q: Balance the following REDOX reaction in BASIC SOLUTION. Zn + (NO2)- = NH3 + Zn ((OH)4)-2

A: The balanced chemical reaction is the representation of the substances along with their chemical…

Q: Write balanced half-reactions for the following redox reaction: 2 Co,(9)+12H*(aq)+12 C1¯(aq) →…

A: For reduction half : 2Cl- ------> Cl2 + 2e- or 12Cl- ------> 6Cl2 + 12e-

Q: Half Reaction A: 2H+ + 2e- ---> H2 (at standard conditions, pH 0 ) Half Reaction B: S + 2H+ + 2e-…

Q: - Determine whether each redox reaction occurs spontaneously in the forward direction. a) Ni (s) +…

A: If the overall cell potential comes out to be positive then that means the reaction is spontaneous…

Q: + 1.14 V TI Pt Cr3+ (1 M) Cr2+ (1 M) T13+ (1 M) T13+ (aq) + 3e-→ TI (s) Cr2+ (aq) → Cr3+ (aq) + What…

A: From the above electrochemical cell it has been observed that the electrons are being transferred…

Q: 1. Write oxidation and reduction half-reactions for the unbalanced net redox equations. Show that…

A: A complete redox reaction is obtained from the addition of oxidation and reduction half reactions.

Q: Solve the both attached questions

A: An oxidation-reduction reaction is also referred to as a redox reaction and is a reaction in which…

Q: Write balance redox reactions, for the following short hand notations: (a) Cu(s) | Cu²“(aq) ||…

A: The electrode which has less negative reduction potential will act as a cathode and will undergo…

Q: Determine whether or not each redox reaction occurs spontaneously in the forward direction. a. Ni(s)…

A: Since you have posted a question with multiple subparts, we will solve the first three subparts for…

Q: a

A: Redox reaction is a chemical reaction in which both oxidation and reduction takes place…

Q: Write balanced half-reactions for the following redox reaction: 3 Cl,(0)+2 Cr*(aq)+14 OH (aq) → 6 C1…

A: Here we are required to balance the half cell reaction for the given redox reaction.

Q: Balance each redox reaction using the half-reaction method. (a) K(s) + Cr³*(aq) –→ Cr(s) + K*(aq)…

Q: Substances A, B, and C can all act as oxidizing agents. In solution, A is green, B is yellow, and C…

A: Since A, B and C are oxidizing agents, then they must be in the form of X2, example Cl2, Br2 or I2.…

Q: Consider the electrochemical cell diagram shown below. As you observe the reaction in the cell, you…

Q: 44. Classify each of the following half-equations as oxidation or reduction. (a) CH;OH(aq) →CO•(g)…

A: There are two questions are given but I am solving first one according to the guidelines of bartleby…

Q: Balance the following redox reaction by adding the coefficients for each of the species.…

A: Redox reactions are the combination of reduction and oxidation reactions. The type of reaction in…

Q: In redox chemistry, the chemical species that is being reduced is called the oxidizing agent,…

A: Given :- 2Al (s) + 3Zn2+ (aq) → 2Al3+ (aq) + 3Zn (s) Zn (s) + 2H3O+ (aq) → Zn2+ (aq) + 2H2O (l) +…

Q: 1. The following reaction occurs spontaneously. 2 Fe(s) + 3 Cl2(aq)→2 Fe³*(aq) + 6 CF(aq) Write the…

Question

Identify the unbalanced half-reaction in which a species is reduced.
O Cr,0,(s) → Cro (aq)
C(s)
CO(g)
>
Al(s)
Al3+ (aq)
O 21-(aq)
1 (s)
so, (aq)
H, S(g)
Identify the initial and final oxidation states for the element iodine in the equation
21 (aq)
L (s)
>
initial oxidation state:

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The iron content of hemoglobin is determined by destroying the hemoglobin molecule and producing small water-soluble ions and molecules. The iron in the aqueous solution is reduced to iron(II) ion and then titrated against potassium permanganate. In the titration, iron(ll) is oxidized to iron(III) and permanganate is reduced to manganese(II) ion. A 5.00-g sample of hemoglobin requires 32.3 mL of a 0.002100 M solution of potassium permanganate. The reaction with permanganate ion is MnO4(aq)+8H+(aq)+5Fe2+(aq)Mn2+(aq)+5Fe3+(aq)+4H2O What is the mass percent of iron in hemoglobin?
Describe what you expect to happen when the following solutions are electrolyzed: a aqueous Na2SO4; b aqueous KBr. That is, what are the electrode reactions? What is the overall reaction?
For the reaction Cu2+(aq) + Zn(s) → Cu(s) + Zn2+ (aq), why can’t you generate electric current by placing a piece of copper metal and a piece of zinc metal in a solution containing CuCl2(aq) and ZnCl2(aq)?
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
Why is it not possible for hydroxide ion (OH-) to appear in either of the half-reactions or the overall equation when balancing oxidation—reduction reactions in acidic solution?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
(a) Rank the following metals in their ability to function as reducing agents: Hg, Sn, and Pb. (b) Which halogens will oxidize mercury to mercury(II)?
One of the few industrial-scale processes that produce organic compounds electrochemically is used by the Monsanto Company to produce1,4-dicyanobutane. The reduction reaction is 2CH2CHCH+2H++2eNC(CH2)4CN The NC(CH2)4CN is then chemically reduced using hydrogen gas to H2N(CH2)6NH2, which is used in the production of nylon. What current must be used to produce 150.kg NC(CH2)4CN per hour?
An electrolytic cell is set up with Cd(s) in Cd(NO3)2(aq) and Zn(s) in Zn(NO3)2(aq). Initially both electrodesweigh 5.00 g. After running the cell for several hours theelectrode in the left compartment weighs 4.75 g. (a) Which electrode is in the left compartment? (b) Does the mass of the electrode in the right compartmentincrease, decrease, or stay the same? If the masschanges, what is the new mass? (c) Does the volume of the electrode in the right compartment increase, decrease, or stay the same? If the volumechanges, what is the new volume? (The density of Cd is8.65 g/cm3.)
Four metals, A, B, C, and D, exhibit the following properties: (a) Only A and C react with 1.0 M hydrochloric acid to give H2(g). (b) When C is added to solutions of the ions of the other metals, metallic B, D, and A are formed. (c) Metal D reduces Bn+ to give metallic B and Dn+. Based on this information, arrange the four metals in order of increasing ability to act as reducing agents.
A solution of copper(II) sulfate is electrolyzed by passing a current through the solution using inert electrodes. Consequently, there is a decrease in the Cu2+ concentration and an increase in the hydronium ion concentration. Also, one electrode increases in mass and a gas evolves at the other electrode. Write half-reactions that occur at the anode and at the cathode.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.

Recommended textbooks for you

Chemistry: The Molecular Science

Chemistry

ISBN:

9781285199047

Author:

John W. Moore, Conrad L. Stanitski

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry: The Molecular Science

Chemistry

ISBN:

9781285199047

Author:

John W. Moore, Conrad L. Stanitski

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN: