If a solution containing 82.787 g of mercury(II) acetate is allowed to react completely with a solution containing 14.334 g of sodium sulfide, how many grams of solid precipitate will form? precipitate: How many grams of the reactant in excess will remain after the reaction? excess reactant:

If a solution containing 82.787 g of mercury(II) acetate is allowed to react completely with a solution containing 14.334 g of sodium sulfide, how many grams of solid precipitate will form? precipitate: How many grams of the reactant in excess will remain after the reaction? excess reactant:

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section: Chapter Questions

Problem 145QRT: When solutions of silver nitrate and sodium carbonate are mixed, solid silver carbonate is formed...

See similar textbooks

Related questions

Q: For the following reaction, 28.9 grams of sulfur dioxide are allowed to react with 6.29 grams of…

Q: If a solution containing 59.943 g of mercury(II) nitrate is allowed to react completely with a…

Q: For the following reaction, 41.9 grams of iron are allowed to react with 16.2 grams of oxygen gas.…

A: Well-balanced chemical equation: 4Fe(s) + 3O2(g)…

Q: For the following reaction, 3.75 grams of carbon disulfide are mixed with excess chlorine gas. The…

Q: For the following reaction, 4.36 grams of butane (C4H10) are allowed to react with 20.5 grams of…

A: Number of moles is calculated by dividing the given mass with molecular mass.

Q: For the following reaction, 21.9 grams of iron are allowed to react with 33.9 grams of chlorine gas.…

A: Given, mass of iron = 51.9 grams mass of chlorine = 33.9 grams

Q: Ammonium chloride(aq)---ammonia(g)+ hydrochloride acid(aq) according to the following reaction,…

A: The balanced chemical equation for the formation of ammonia and hydrochloric acid is…

Q: For the following reaction, 21.2 grams of iron are allowed to react with 44.7 grams of chlorine gas.…

Q: If a solution containing 109.90 g of mercury(II) nitrate is allowed to react completely with a…

A: Here, we have to find the mass of the precipitate that will be formed when 109.90 g of mercury(II)…

Q: For the following reaction, 26.1 grams of carbon monoxide are allowed to react with 12.6 grams of…

Q: For the following reaction, 18.5 grams of chlorine gas are allowed to react with 57.7 grams of…

A: Introduction : We have to calculate mass of sodium chloride ,limiting reagent and excess amount .

Q: If a solution containing 53.99 g of mercury(II) chlorate is allowed to react completely with a…

Q: If a solution containing 111.49 g of silver nitrate is allowed to react completely with a solution…

A: Given that : The mass of silver nitrate = 111.49 g The mass of lithium bromide = 10.39 g The molar…

Q: For the following reaction, 8.39 grams of carbon (graphite) are allowed to react with 12.6 grams of…

A: Given: Mass of Carbon= 8.39 g Mass of Oxygen gas= 12.6 g To calculate: a) Maximum amount of CO2…

Q: For the following reaction, 133 grams of silver nitrate are allowed to react with 19.8 grams of…

A: The reaction given is => Silver nitrate (aq) + Copper (s) ------> Copper (II) nitrate (aq) +…

Q: For the following reaction, 4.42 grams of carbon disulfide are mixed with excess chlorine gas. The…

Q: how many grams of carbon dioxide will be formed upon the complete reaction of 25.2 grams of oxygen…

A: The excess carbon (graphite) reacts with oxygen gas to form carbon dioxide gas. C + O2…

Q: For the following reaction, 66.5 grams of iron(III) oxide are allowed to react with 20.9 grams of…

A: The reaction taking place is - Fe2O3 + 2Al → Al2O3 + 2Fe Given mass of Fe2O3 = 66.5 g Molar mass of…

Q: For the following reaction, 14.7 grams of phosphorus (P4) are allowed to react with 39.7 grams of…

A: Given: mass of P4 = 14.7 g mass of Cl2 = 39.7 g molar mass of P4 = 123.895 g/mol molar mass of Cl2 =…

Q: For the following reaction, 4.06 grams of hydrogen gas are allowed to react with 40.4 grams of…

Q: What is the theoretical yield of water ? grams What is the percent yield of water ? %

A: 2HCl (aq) +1/2 O2(g) ----------> H2O (l) + Cl2…

Q: For the following reaction, 3.43 grams of hydrogen gas are allowed to react with 42.4 grams of…

A: Given mass of H2 = 3.43 g mass of I2 = 42.4 g

Q: If a solution containing 61.28 g of lead(II) chlorate is allowed to react completely with a solution…

A: The chemical reaction between lead chlorate and sodium sulfide is shown below;…

Q: If a solution containing 108.65 g of mercury(II) acetate is allowed to react completely with a…

Q: If a solution containing 127.23 g of silver chlorate is allowed to react completely with a solution…

Q: For the following reaction, 12.7 grams of sulfur are allowed to react with 16.8 grams of carbon…

A: Soln

Q: For the following reaction, 4.80 grams of hydrogen gas are allowed to react with 9.37 grams of…

Q: If a solution containing 52.61 g of lead(II) nitrate is allowed to react completely with a solution…

A: The balanced equation is Pb(NO3)2 (aq) + Na2S (aq) --------> PbS (s) + 2 NaNO3 (aq) Net ionic…

Q: If a solution containing 36.48 g of mercury(II) chlorate is allowed to react completely with a…

A: According to the given data, the reaction would look like: Hg(ClO3)2 (aq) + Na2S (aq) → 2 NaClO3(aq)…

Q: If a solution containing 106.19 g of mercury(II) nitrate is allowed to react completely with a…

A: Given,Mass of mercury (II) nitrate = 106.19 gMass of sodium sulphide, = 16.642 gMoles of Hg(NO3)2…

Q: If a solution containing 106.70 g of mercury(II) nitrate is allowed to react completely with a…

Q: For the following reaction, 19.3 grams of iron are allowed to react with 40.7 grams of chlorine gas…

A: Write the balanced equation for the given reaction, 2 Fe(s) + 3 Cl2(g) → 2 FeCl3(s)…

Q: if a solution containing 53.927 g of mercury (II) chlorate is allowed to react completely with a…

Q: For the following reaction, 56.7 grams of iron(III) oxide are allowed to react with 17.8 grams of…

Q: 1. Ammonium sulfate is used as a source of nitrogen in some fertilizers. It reacts with sodium…

Q: If a solution containing 23.09 g of mercury(II) nitrate is allowed to react completely with a…

Q: An aqueous solution containing 9.55 g9.55 g of lead(II) nitrate is added to an aqueous solution…

A: Given that : The mass of lead (II) nitrate = 9.55 g The mass of potassium chloride = 5.77 g The…

Q: For the following reaction, 17.1 grams of iron are allowed to react with 36.2 grams of chlorine gas…

Q: For the following reaction, 28.1 grams of bromine are allowed to react with 17.1 grams of chlorine…

A: We have Br2(g) + Cl2(g)→2BrCl(g) Here 28.1 g of bromine are allowed to react with 17.1 g of…

Q: If a solution containing 38.23 g of lead(II) chlorate is allowed to react completely with a solution…

Q: For the following reaction, 33.5 grams of iron are allowed to react with 18.8 grams of oxygen gas.…

A: 4Fe + 3O2 → 2 Fe2O3Molecular weight of…

Q: For the following reaction, 9.69 grams of carbon monoxide are allowed to react with 9.81 grams of…

A: CO + H2O ---------------> CO2 + H2 M.M of CO = 28g M.M of H2O = 18g

Q: For the following reaction, 9.09 grams of nitrogen monoxide are allowed to react with 7.90 grams of…

A: Given: The reaction is as follows, Nitrogen monoxide(g) + oxygen(g) → nitrogen dioxideg Mass of…

Q: For the following reaction, 8.60 grams of butane (C,H10) are allowed to react with 15.7 grams of…

A: Number of moles is calculated by dividing the given mass with molecular mass.

Q: According to the following reaction, how many grams of calcium sulfate will be formed upon the…

Q: If a solution containing 126.77 g of silver nitrate is allowed to react completely with a solution…

A: Given: Mass of AgNO3 taken = 126.77 g. And the mass of LiI taken = 13.37 g.

Q: Solve this question

A: It is given that 30.33 g of lead nitrate is reacting with 5.102 g of sodium sulphide, and the mass…

Q: For the following reaction, 9.30 grams of butane (C4H10) are allowed to react with 16.3 grams of…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Question

100%

Pls find the attached question.

If a solution containing 82.787 g of mercury(II) acetate is allowed to react completely with a solution containing 14.334 g
of sodium sulfide, how many grams of solid precipitate will form?
precipitate:
How many grams of the reactant in excess will remain after the reaction?
excess reactant:

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Step 7

Trending now

This is a popular solution!

Step by step

Solved in 7 steps with 11 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Quality Assurance and Calibration Methods

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

4.23 In the reaction of arsenic with bromine, AsBr5 will form only when excess bromine is present. Write a balanced chemical equation for this reaction. Determine the minimum number of motes of bromine that are needed if 9.6 moles of arsenic is present.
Although many sulfate salts are soluble in water, calcium sulfate is not (Table 7. 1). Therefore, a solution of calcium chloride will react with sodium sulfate solution to produce a precipitate of calcium sulfate. The balanced equation is :math>CaCl2(aq)+Na2SO4(aq)CaSO4(s)+2NaCl(aq) a solution containing 5.21 g of calcium chloride is combined with a solution containing 4.95 g of sodium sulfate, which is the limiting reactant? Which reactant is present in excess?
4.17 Phosgene is a highly toxic gas that has been used as a chemical weapon at times in the past. It is now used in the manufacture of polycarbonates, which are used to make phone cases and plastic eyeglass lenses. Phosgene is produced by the reaction, CO+Cl2COCl2 . Given an excess of carbon monoxide, what mass of chlorine gas must be reacted to form 4.5 g of phosgene?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
Methanol, CH3OH, is used in racing cars because it is a clean-burning fuel. It can be made by this reaction: CO(g)+2H2(g)CH3OH(l) What is the percentage yield if 5.0103gH2 reacts with excess CO to form 3.5104gCH3OH ?
Lead(II) carbonate, also called “white lead,” was formerly used as a pigment in white paints. However, because of its toxicity, lead can no longer he used in paints intended for residential homes. Lead(II) carbonate is prepared industrially by reaction of aqueous lead(II) acetate with carbon dioxide gas. The unbalanced equation is :math>Pb(C2H3O2)2(aq)+H2O(l)+CO2(g)PbCO3(s)+HC2H3O2(aq) ppose an aqueous solution containing 1.25 g of lead(II) acetate is treated with 5.95 g of carbon dioxide. Calculate the theoretical yield of lead carbonate.
Barium chloride solutions are used in chemical analysis for the quantitative precipitation of sulfate ion from solution. :math>Ba2+(aq)+SO42(aq)BaSO4(s) ppose a solution is known to contain on the order of 1 50 mg of sulfate ion. What mass of barium chloride should be added to guarantee precipitation of all the sulfate ion?
One mol of ammonia reacts with 1.00 mol of oxygen to form nitrogen oxide and water according to the reaction 4NH3(g)+5O2(g)4NO(g)+6H2O(l)State which statements are true about the reaction and make the false statements true. (a) All the oxygen is consumed. (b) 4.00 mol NO are produced. (c) 1.50 mol H2O are produced. (d) The description of the experiment does not provide enough information to determine percent yield. (e) Three moles of water are produced for every two moles of NO obtained.
4.70 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients. (c) identify the limiting reactant, and explain how the pictures allow you to do so.
Thionyl chloride, SOCl2, is used as a very powerful drying agent in many synthetic chemistry experiments in which the presence of even small amounts of water would be detrimental. The unbalanced chemical equation is :math>SOCl2(l)+H2O(l)SO2(g)+HCl(g) lculate the mass of water consumed by complete reaction of 35.0 g of SOCl2.
When solutions of silver nitrate and sodium carbonate are mixed, solid silver carbonate is formed and sodium nitrate remains in solution. If a solution containing 12.43 g sodium carbonate is mixed with a solution containing 8.37 g silver nitrate, calculate the mass of each of the four substances present after the reaction is complete.