If the [COCI412 anion has a molar susceptibility of 6.26 X 10-3 (the corrected value (XM')) at 25 °C, Calculate the effective magnetic moment (Heff) for this complex: Select one: a. 3.86 BM b. 15.7 BM C. 6.26 BM d. 18.7 BM

If the [COCI412 anion has a molar susceptibility of 6.26 X 10-3 (the corrected value (XM')) at 25 °C, Calculate the effective magnetic moment (Heff) for this complex: Select one: a. 3.86 BM b. 15.7 BM C. 6.26 BM d. 18.7 BM

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter19: Transitition Metals, Coordination Chemistry And Metallurgy

Section: Chapter Questions

Problem 19.57QE

See similar textbooks

Related questions

Q: Which of the following is the structural formula for phenacetin, which is synthesized by treating 4-…

A: 4-ethoxyaniline when treated with acetic anhydride results in the formation of…

Q: you took 40.7 grams of KCl and dissolved it in 0.375 L of water, what would be the molar…

Q: How many equivalents of base need to be added to fully titrate all acidic protons in…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: How does the coordination geometry of a metal center influence its reactivity in bioinorganic…

A: Introduction: The coordination geometry of a metal center has a profound impact on its reactivity in…

Q: What orbital is described by the following quantum numbers? n = 4 1 = 3 m₁ = 2 a 4p orbital these…

A: To solve this problem we have to know about quantum numbers .

Q: 3. Chloroacetic acid, CICH₂COOH, has a pKa of 2.87. What are [H3O+], pH, [CICH₂COO-], and…

A: “Since you have posted multiple questions, we will provide the solution only to the first question…

Q: Determine the extent of reaction at the gel point when 44.4 g of phthalic anhydride (molecular…

A: we need to calculate the number of moles of phthalic anhydride and glycerol used in the…

Q: 39.0 g sample of a metal is heated to 63.0 °C and then dropped into 125.0 g of water in a…

A: Heat absorbed by the substance = m x Cs x ∆T m = mass of substance Cs = specific heat capacity of…

Q: 9. Provide the structure of the product in the following reaction. НО 0 & ОН H+

A: Carbonyl compound has electrophilic center and alcohol has nucleophilic character. Hence, it can…

Q: give the IUPAC names of the alcohol which on undergoing dehydration yield each of the following…

A: A question based on reactions of alcohol. 3 different alkene product are given whose reactant…

Q: In a steel container of 20.00 L, we have 55.5 g of N₂2(g) (M=28.02 g/mol), 77.7 g of O₂(g) (M=32.00…

A: The total pressure in the container is the sum of partial pressures of N2, O2, and unknown gas.…

Q: Consider the species present in a 1.0×10 M solution of HCIO(aq). Place the species in order of their…

A: Concentration of HCIO =1.0×10-4 M Ka(for HCIO]=2.9×10-8

Q: 479.1 g sample of silicon dioxide undergoes a temperature change of -87.43 K while releasing 29447…

A: Heat absorbed/released, q = mCs∆T m = mass of substance Cs = specific heat capacity of substance ∆T…

Q: Determine the number of bonding electrons and the number of nonbonding electrons in the structure…

A: Lewis Structure represent how the electrons are arranged around the atoms in a molecule.

Q: Which of the following represents the balanced chemical equation for the reaction involving sodium…

A: A balanced chemical equation is a representation of a chemical reaction using chemical formulas and…

Q: Which of the following chemical equations demonstrates the law of conservation of mass? A. BaCl₂ +…

A: Given,The reactions:A. BaCl2 + H2SO4→ BaSO4 + HClB. Cl2 + NaBr →NaCl + Br2C. 2 H2 + N2 → 2 NH3D. 2H2…

Q: How does the electronic structure of transition metal complexes influence their reactivity?

A: The reactivity of transition metal complexes is heavily influenced by their electronic structure,…

Q: What is the order of increasing reactivity in nucleophilic addition of methanol (least to most…

A: Nucleophilic addition to carbonyl compounds depend on two factors: 1. Electronic factors: Higher…

Q: A 25.0 mL of a H2SO4 solution requires 38.2 mL of a 0.163 M NaOH solution for complete…

A: Balanced neutralization reaction is H2SO4 + 2NaOH ------> Na2SO4 + 2H2O

Q: 3. Use the information contained in "Lab Exercise 11.B" on page 506 in the textbook to answer the…

A: Hess law states that the enthalpy change of an overall reaction is the sum of enthalpy changes of…

Q: Assign R or S to each stereocenter in this molecule.

A: According to Cahn-Ingold-Prelog rule- 1) More atomic number having more priority.2) If first atom is…

Q: Reduction, with H₂ gas and a Ni catalyst, of which of the following compounds would produce a…

A: H2 - Ni is a reducing agent.

Q: Sulfur (2.60 g) was burned in a constant volume calorimeter with excess O₂ (g). The temperature…

A: Given:- Mass of sulfur = 2.60 g Change in temperature = (27.91 - 21.63) C = 6.28 C = 6.28 K…

Q: a) Identify key peaks in the IR spectra of isoborneol and the product. Do not include peaks that you…

A: A question based on IR spectroscopy of organic compounds. 2 IR spectrum are given that are to be…

Q: Consider these reactions: Reaction 1: H2(g) + Cl2(g) 2HCl(9) AH = -184.6 kJ Reaction 2: 20F2(g) →…

Q: the electron in a ground state hydrogen atom absorbs a photon wavelength of 97.20nm. Calculate the…

A: Wavelength of photon absorbed = 97.20 nm

Q: 2,6-dimethyloct-2-ene What is the structural formula for this molecule and IUPAC name?

A: The structure of an organic compound is written in the following steps: Determine the number of…

Q: A molecule of chloroform, CHCI3, has the same shape as a molecule of methane, CH4. However,…

A: The difference in boiling points between methane (CH4) and chloroform (CHCl3) can be explained by…

Q: Consider the following elementary reaction: N₂O(g) →N₂(g) + O(g) Suppose we let k₁ stand for the…

A: The rate constant of the reaction = k1 The rate constant of the reverse reaction = k-1 We have to…

Q: Propose a mechanism for the following acid-catalysed hydrolysis of the epoxide and then assign R and…

A: A question based on reaction mechanism. An epoxide is given whose product on hydrolysis is to be…

Q: 5. Examine the following table and identify which of the substances A to C are ionic, which are…

A: Substance Melting point(∘C) Solubility in water A -178 insoluble B -101 soluble C 730…

Q: When classifying chemical reactions, one can use a couple of key features for the reaction types.…

A: Chemical reactions can be classified into 5 types: Combination reaction- reaction in which 2 or…

Q: -- atm 13, At 25 °C and 1 atm of CO2 pressure, the solubility of CO2 (g) is 149 mg CO2/100 g water.…

A: Given,

Q: What are the key factors that influence the reaction rate and yield of a complex chemical reaction?…

A: The rate and yield of complex chemical reactions are influenced by various factors including…

Q: Designing a galvanic cell from tw... A chemist designs a galvanic cell that uses these two…

A: E°cell = E°cathode - E°anode Reaction with higher Positive value of reduction potential will occur…

Q: Suppose the galvanic cell sketched below is powered by the following reaction: Zn(s)+FeCl₂(aq) →…

A: Galvanic cell is type of cell that converts chemical energy into electrical energy via spontaneous…

Q: Refer to the activity series chart below to answer this question. Choose which chemical reaction…

A: The metal reactivity series lists the metal in order of their reactivity from top to bottom. A…

Q: Measurements show that the energy of a mixture of gaseous reactants increases by 120. kJ during a…

A: From first law of thermodynamics, ∆E = ∆H + W where ∆E = change in energy ∆H = change in enthalpy…

Q: In the field of chemical kinetics, explain the concept of activation energy and its significance in…

A: Introduction: Activation energy is a key concept in chemical kinetics, representing the minimum…

Q: 11. For the reaction sequence below, identify the expected major product(s). 1. МСРВА Г 2. H+ H2O Н…

Q: 1. Draw the structural formula for a-D-Glucopyranosyl-(1-4)-D-mannopyranose, and circle the part of…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: Zinc hydroxide is sparingly soluble. Consider the cell below: 2+ Zn(s) | Zn(OH)2(s) | OH¯ (0.15M)||…

A: Answer:- This question is answered by using the simple concept of electrochemistry which involves…

Q: 10. The reaction of toluene, C7H8, with potassium permanganate, KMnO4, gives less than a 100% yield.…

Q: A molecule has sp³ hybridization with 1 lone pair. The electron pair geometry of this molecule is:…

A: Hybridization is a concept in chemistry that describes the mixing of atomic orbitals to form new…

Q: Suppose the galvanic cell sketched below is powered by the following reaction: Ni(s)+PdSO4(aq)…

Q: A mixture of krypton and oxygen gas is compressed from a volume of 97.0 L to a volume of 90.0 L,…

Q: draw the mechanism for the reaction of alkene with HBr

Q: A sample of zirconium experiences a temperature change of +790.5 K while absorbing 150820 joules of…

A: Temperature change (∆T) = + 790.5 K Heat absorbs (q) = + 150820 J (positive…

Q: Which method could you use to encourage more product, NO2, to form from the reaction below? N₂(g)…

A: According to Le Chatelier's principle, if an equilibrium is disturbed by changing the conditions,…

Q: An EDTA stock solution is prepared in a 1.5E+02 mL volumetric flask. The of the disodium dihydrate…

A: Mass of EDTA = 0.1339 g Molecular weight = 372.24 g/mol Number of moles of EDTA = mass/mol.wt. =…

Concept explainers

UV Visible Spectroscopy

Spectroscopy refers to the absorption or emission of light or other radiations by matter. When a substance or chemical absorbs light or radiation, they reach an excited state followed by de-excitation or emission of the light or radiation forming distinct spectra. UV-visible spectroscopy or ultraviolet-visible refers to the absorption and emission in the ultraviolet and visible regions of the electromagnetic spectrum.

Question

If the [CoCl4]2 anion has a
molar susceptibility of 6.26 X
10-3 (the corrected value (XM'))
at 25 °C, Calculate the
effective magnetic moment
(Heff) for this complex:
Select one:
a.
3.86 BM
b.
15.7 BM
C.
6.26 BM
d.
18.7 BM

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: effective magnetic moment

VIEW

Step 2: Effective magnetic moment of the given complex

VIEW

Solution

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Explain why the complex [Fe(H2O)6]3+ has Do = 14,000 cm-1, while [Fe(H2O)6]2+ has Do = 9,350 cm-1.
Which of the following statements about 10Dq is false? A. [VCl6]2- has a greater 10Dq than [VCl4] complex.B.[MnF6]2- has a higher 10Dq value than [TcF6]2-.A. [V(H2O)6]3+ has a higher 10Dq value than [V(H2O)6]2+.D. In the [CoX(NH3)5]n+ complex, the color changes from dark violet to yellow when X is replaced by I-, Br-, Cl-, H2O, and NH3, respectively.
metal ion: Sc3+ Co3+ Fe3+ Ga3+ log K1(EDTA): 23.1 41.4 25.5 21.5 i) The high value of log K1(EDTA) for Co(III) is because it is low-spin d6 ii) The low value of log K1(EDTA) for Fe(III) is because it is high-spin d5 iii) The low value of log K1(EDTA) for the Sc(III) complex is becaus it has a d1 electronic configuration iv) The low value of log K1(EDTA) for Ga(III) is because it is a d10 ion Which statements are true? a) all of them b) i), ii) and iv) c) ii) and iv) d) i), iii), and iv)
I'm struggling to understand magnetic moments. If [Mn(NCS)6]4- shiwed a value if 6.06 micro B, I guess that the complex would be low-spin. How would I show this and relate it to an energy level diagram showing the splitting of 3d orbitals? thankyou for any help .
Consider the [Ir2(dimen)4] 2+ complex. Notice that the dimen ligand is asymmetric. There is also a different, symmetric diisocyano ligand referred to as “TM4” (structure shown to the right) that forms the same sort of binuclear complex that dimen does. Answer the following questions with supporting justification: a. How many geometric isomers (ignore any optical ones) of [Ir2(TM4)4] 2+ are there? b. How many geometric isomers (ignore any optical ones) of [Ir2(dimen)4] 2+ are there? c. In the “twisted” deformational isomer, would you expect [Ir2(TM4)4] 2+ or[Ir2(dimen)4] 2+ to be able to rotate polarized light? Justify your answer.
Select and redraw the resonance form that contributes the most to the sigma complex.
Construct an MO correlation diagram for the complex ion[Ni(NH3)6]2+ and populate the orbitals with electrons. Do youexpect p bonding to be important for this complex? Whatfeatures of this diagram correspond to those predicted usingcrystal field theory? What kind of bonding would VB theorypredict for d8 complexes, and how does MO theory accountfor the bonding more accurately, even qualitatively?
Fill in the blanks : (i) When a ligand has a two-complexing or donor group in its structure, it is said to be————— (ii) ___________are compounds whose colour changes when they bind to a metal ion. (ii) If you double the wavelength, you will observe. ________the energy. (iv) In_____________ titration, we monitor changes in absorbance during the titration to find out the equivalence point. (v) Two liquids are_____________ if they form a single phase when they are mixed in any ratio. (vi) The efficiency of Chromatographic Columns can be described by____________Equation.
What is the reason of starting with Co(II) complex instead of Co(III) in experiment of preparation and solution conductivity of [Co(NH3)4CO3] and [Co(NH3)5Cl] Cl2 ?
Provide brief well focused responses to the following questions. a.Why is Δo for the [Cr(CN)6]3- anion very much larger than Δo for [CrCl6]3-? b.Qualitatively compare the expected μeff (298K) values for the octahedral complex anions [CrCl6]3- and [Cr(CN)6]3- . c.The [CoCl4]2- anion is intensely blue colored and [CoCl6]4- is a lightly colored pink. d.Why is the method of descending symmetry needed to derive an mo diagram for acetylene (ethyne), but not needed for diazene((NH)2)? e.Why is IR spectroscopy an ineffective method for vibrational studies of homo-nuclear diatomic molecules in the gas phase ?