If trans-[Cr(en)2(NCS)2]SCN is heated, it forms gaseousethylenediamine and solid [Cr(en)2(NCS)2][Cr(en)(NCS)4].Write a balanced chemical equation for this reaction.What are the oxidation states of the Cr ions in the reactantand in the two complex ions in the product?

Q: (b) What are the effects of r-donor and t-acceptor ligands on the splitting of metal d orbitals in…

A: Answer- When the ligands approach the central metal ion, d- or f-subshell degeneracy is broken due…

Q: a) The terms low spin and high spin apply only to complexes of d-metal ions having certain numbers…

A: Dueto strong field ligand pairing of electron occurs  so it forms low spin  complex. And weak field…

Q: Discuss Nomenclature and Isomerism in Coordination Chemistry?

A: Nomenclature and Isomerism in Coordination Chemistry have to be discussed below.

Q: Two Fe (II) complexes are both low spin but have different ligands. A solution of the other is red.…

A: The stronger the field, the greater the separation (in energy) between the split levels.  Electrons…

Q: Consider an octahedral complex where strong field ligands are bound to a central metal having a d…

A:

Q: A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: Suitably substituted square planar and octahedral complexes can show the cis-trans isomerism.…

Q: The complex [Pt(NH3)2(SCN)2] forms two stereoisomerws whereas the complex [Pt(en)(SCN)2] forms only…

A:

Q: <p>The complexes of Fe^3+ have magnetic properties that depend on whether the ligands are…

A: Iron, Fe has electronic configuration [Ar]4s23d6.  Hence, during the formation of Fe3+ ions, the…

Q: The complex [Mn(H2O)6]2+ has five unpaired electrons, whereas [Mn(CN)6]4- has only one. Using the…

A: According crystal field theory, when transition metals are bonded to any ligand, their d orbitals…

Q: Find a crystal structure for any metal complexes, define the oxidation state of metal, define the…

A:

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: A complex, ML62+, is violet. The same metal forms a complex with another ligand, Q, that creates a…

A: Given: The complex given is  This complex is violet. The metal gets attached to the weak field…

Q: Nickel(II) complexes in which the metal coordination number is 4 can have either square-planar or…

A: In tetrahedral complexes, there exists four ligands. Its coordination number is four. Hybridisation…

Q: Is it possible for a complex of a metal in the transition series to have six unpaired electrons?…

A: Transition metals form stable ions due to its incompletely filled d-orbitals. The d-subshell in…

Q: <p>Many transition metal compounds are colored. How does crystal field theory account for…

A: The color of transition metal compounds is due to the absorbance of visible light. According to the…

Q: How many unpaired electrons are there in a strong field iron(II) octahedral complex? 0 1 2 3

A: Since you have asked multiple type questions, we will solve only first  questions for you. If you…

Q: Determine if each of the following metal complexes is chiral and therefore has an optical isomer:…

A: a.

Q: What is the coordination number of the central metal in [Cr(acac)3] ?  The acac ligand can be…

A: Coordination number of the central metal which is Chromium in [Cr(acac)3]  is 6.

Q: For which of the following cases of octahedral complexes should we consider the possibility of…

A: The complexes in which plane of symmetry is present are supposed to be optically inactive compounds…

Q: Give the formula of each coordination compound. Include square brackets around the coordination…

A: Coordination compounds can be named by using different IUPAC rules ,for metal atoms as well as…

Q: which of these complexes will show geometrical isomerism: a  MA2X2 b  MA2XY c  MABCY d  All of these

A: Geometric isomerism:Two or more compounds with the same formula but are having different…

Q: (a) Predict whether the glycinate ion, H2N-CH COO is a monodentate, bidentate, or tridentate ligand:…

A: a. Bidentate ligands are Lewis bases that donate two pairs of electrons to a metal atom.   It is a…

Q: a. Classify the isomer below and give the name of the isomers. [Cr(CO)6][CoCl6] and [Co(CO6)][CrCl6]…

A: The detailed solution of your question given below-- Since, we know that the concept of isomers in…

Q: why do some d-block elements form colored complexes with various ligands

A: in complexes of the transition metals the D orbitals do not all have the same energy. the pattern of…

Q: Which of the following d electron configurations would have three unpaired electrons in an…

A: In octahedral complex there are two state, t2g and eg. t2g is ground state and eg is excited state…

Q: what is the maximum number if unpaired d electrons that an octahedral transition mental complex can…

A: The question is based on the concept of coordination chemistry. We have to identify maximum unpaired…

Q: Compare the ligand field strengths of CO and Cl, in terms of the types of bonds in which they can be…

A: CO is Sigma donor and pi acceptor ligand while Cl is only Sigma donor ligand .thus there type of…

Q: Werner first published his thoughts concerning the possibiolity of chiral coordination compounds in…

A: Geometrical isomer Geometrical isomer having the same molecular formula and same structure but it…

Q: How many unpaired electrons are there in the complex ion [CO(NO3)5]¯? For this in the nitrate…

A: Given , Initial amount of substance = 60mg  t1/2 = 6 h  Total time = 24 h  N ❓  In question 2  Since…

Q: 8

A:

Q: When silver nitrate is reacted with the molecular base ortho-phenanthroline, colorless crystals form…

A: Coordination number tells the number of atoms or ions, to which the central atom is bonded.…

Q: Would it be better to use octahedral complexes of Cr3+ or Co3+ to determine whether a given ligand…

A: In order to decide the strength of ligands, the following factors have to check; The electronic…

Q: nich is the crystal field energy level diagram for a square pyramidal ML5 complex that contains a…

A:

Q: Which atom is a common linkage site in polydentate ligands?

A: Polydendate ligands are those ligands which have more than 2 donar atoms .

Q: 3. Considering an octahedral complex for the d system,what are the effect of T-donor and t- acceptor…

A: Pi donar Ligands produce lesser splitting energy so high spin will be favored. Pi accepting lingands…

Q: What is the possible number of isomers of the OsO4py complex? A. 4 B. 1 C. 2 D. 5 E. 3

A: NOTE : The correct formula of the complex will be OsO4(py)2 and not OsO4py. Hence I'm considering…

Q: Metal cations often form complex ions in solution or when reacted with suitable ligands. Write a…

A: Given Reactant  Cu2+ ethylenediamine (en) Product  Cu(en)22+ Reaction medium Aqueous  Balanced…

Q: What is required of Lewis bases to act as ligands in coordination compounds?

A: Lewis base is a species which can donate electron pair to a Lewis acid.

Q: Write the formula for a complex formed between Ag+ and NH, with a coordination number of 2. formula:…

A: Here, we have to write the formula of a complex formed between Ag+ and NH3 with a coordination…

Q: What are the electron configurations for an octahedral d7 complex with 1 weak-field and 2…

A: Strong field ligands: Those ligands which cause larger splitting of d orbitals and favour pairing of…

Q: Name the following metal complexes or complex ions: formula name [re(co),]* [cr{OH),(en).]"

A: 1. Tetracarbonyl iron(III)

Q: Metal complexes are metal atoms or ions that is surrounded by several ligands. These metal complexes…

A:

Q: If this is the only place in the visible spectrum where the complex absorbs light, what color would…

A: When a complex absorbs all the visible light except one then the one which is not absorbed by the…

Q: For which member of the following pairs of complexes  would  Δo  be the larger and why: (a)…

A: Δo is the crystal field splitting energy i.e the difference between eg and t2g orbitals.  In…

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.