In an electrochemical cell, Cus) is placed in the anode half-cell while Ag(s) in the cathode half-cell. The standard potential of the half-reactions are as follows: i. Ag (ag) + e Ag(s) E°red = +0.80 V ii. Cu2+ (aq) + 2e - Ag(s) E°red = +0.34 V (1) What is the standard potential of the cell, E° 'cell? (2) Is the reaction spontaneous or non-spontaneous? O a. (1) E° cel = +0.46 V, (2) spontaneous O D. (1) E° cel = -0.46 V, (2) non-spontaneous O C (1) E° cell = -0.46 V, (2) spontaneous O d (1) E° cell= +0,46 V, (2) non-spontaneous

In an electrochemical cell, Cus) is placed in the anode half-cell while Ag(s) in the cathode half-cell. The standard potential of the half-reactions are as follows: i. Ag (ag) + e Ag(s) E°red = +0.80 V ii. Cu2+ (aq) + 2e - Ag(s) E°red = +0.34 V (1) What is the standard potential of the cell, E° 'cell? (2) Is the reaction spontaneous or non-spontaneous? O a. (1) E° cel = +0.46 V, (2) spontaneous O D. (1) E° cel = -0.46 V, (2) non-spontaneous O C (1) E° cell = -0.46 V, (2) spontaneous O d (1) E° cell= +0,46 V, (2) non-spontaneous

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 115AE: The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making...

See similar textbooks

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.