K, is 1.67 x 1020 at 25°C for the formation of iron(lI) oxalate complex ion: Fe (aq) + 3 C,0,2(aq) (Fe(C,04)a (aq). If 0.160 M Fe* is initially mixed with 1.00 M oxalate ion, what is the concentration of Fe3* ion at equilibrium? O 1.04 x 1021 M O 0.0100 M O 6.81 x 10-21 M O 1.47 x 1020 M

K, is 1.67 x 1020 at 25°C for the formation of iron(lI) oxalate complex ion: Fe (aq) + 3 C,0,2(aq) (Fe(C,04)a (aq). If 0.160 M Fe* is initially mixed with 1.00 M oxalate ion, what is the concentration of Fe3* ion at equilibrium? O 1.04 x 1021 M O 0.0100 M O 6.81 x 10-21 M O 1.47 x 1020 M

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.35PAE: In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial...

See similar textbooks

Related questions

Q: A student ran the following reaction in the laboratory at 530 K: PCI3(g) + Cl2(g) = PCI5(g) When she…

A: Recall the given reaction, PCl3 (g) + Cl2 (g) <-------> PCl5 (g) 7.90 * 10-2 moles of…

Q: A 5.00 g sample of graphite powder (molar mass = 12.01 g/mol) and 0.0100 moles of CO2(g) was placed…

Q: A student ran the following reaction in the laboratory at 643 K: 2HI(g) H2(g) + I2(g) When she…

Q: A student ran the following reaction in the laboratory at 389 K: CHa(9) + CCa(9) = 2CH,Cl(9) When…

Q: The equilibrium constant, K, for the following reaction is 1.80 x 10-2 at 698 K. 2HI(g) H2(g) +…

A: We are authorised to solve only one question at a time. Please post rest of the questions…

Q: A student ran the following reaction in the laboratory at 617 K: Co(g) + Cl2(g) = cocl2(g) When she…

Q: A student ran the following reaction in the laboratory at 434 K: PCl5(g) PCl3(g) + Cl2(g) When she…

A: Given equation: PCl5 (g) ⇌ PCl3 (g) + Cl2 (g) The initial number of moles of PCl5(g) = 1.75 moles…

Q: The equilibrium constant for the reaction NO(g) + NO2(g) ⇆ N2O3(g) is Kp…

Q: A student ran the following reaction in the laboratory at 586 K: CO(g) + Cl2(g) COCI,(g) When she…

A: Molarity = number of moles/ volume in Litre Molarity of CO = 0.376/1 = 0.376M Molarity of Cl2 =…

Q: The equilibrium constant, K, for the following reaction is 1.29x102 at 600 K. CoCi,(9) co(9) +…

A: Representations of equilibrium constant Kc:- Kc = [CO(g)][Cl2(g)] ÷ [COCl2(g)]

Q: Write the equilibrium expression for the reaction Zn(6) + Cu2+, Cus) + Zn?+, (aq) (aq) O K =…

A: Step 1 The general chemical equation is given as; Equilibrium expression is given by K, which is…

Q: A student ran the following reaction in the laboratory at 715 K: N2(9) + 3H2(g) = 2NH3(9) When she…

A: When there is equilibrium reaction at certain point of time rate of forward reaction equal to rate…

Q: A student ran the following reaction in the laboratory at 731 K: H2(g) + I2(g) = 2HI(g) When she…

A: Kc is the reaction quotient at equilibrium

Q: A student ran the following reaction in the laboratory at 247 K: 2NOBr(g)2NO(g) + Bry(g) When she…

A: For 1 L solution molarity is equal to moles. Using ICE table , we can find out Kc

Q: A student ran the following reaction in the laboratory at 507 K: PCI,(g) + Cly(g) PC(g) When she…

A: Given: Initial moles of PCl3 = 0.172 mol Initial moles of Cl2 = 0.208 mol volume of container = 1.0…

Q: A student ran the following reaction in the laboratory at 567 K: CO(g) + Cl2(g) COCl2(g) When she…

A: Given data: Initial moles of CO (g) = 0.540 moles, Initial moles of Cl2 (g) = 0.551 moles, Volume =…

Q: Consider the reversible dissolution of lead(II) chloride. PbCl2 (s) Pb²* (aq) + 2 Cl¯ (aq) Suppose…

A: Here, we shall answer only the first question which allows us to determine the Equilibrium Constant…

Q: A student ran the following reaction in the laboratory at 244 K: 2NOBr(g)2NO(g) + Bry(g) When she…

A: Given: 2NOBr(g) ⇌ 2NO(g) + Br2(g). The…

Q: A student ran the following reaction in the laboratory at 579 K: CO(g) + Cl2(g)=COCl,(g) When she…

A: Concentration of a chemical species (M) in a solution is obtained by dividing the number of moles of…

Q: A student ran the following reaction in the laboratory at 668 K: H2(g) + I2(g) 2HI(g) When she…

A: The concentration of a solution can be defined in terms of molarity as the ratio of the amount of…

Q: A student ran the following reaction in the laboratory at 427 K: PCl5(g) PCl3(g) + Cl2(g) When she…

A: PCl5(g) → PCl3(g) + Cl2(g)Initial 4.21 M 0 0 Initial…

Q: A student ran the following reaction in the laboratory at 1082 K: 2 S03 (g)=2 SO, (g) + 02 (9) When…

Q: A student ran the following reaction in the laboratory at 705 K: H2(g) + I2(g) =2HI(g) When she…

A: Equilibrium constant is the ratio of equilibrium concentration of product to the equilibrium…

Q: A student ran the following reaction in the laboratory at 226 K: 2 NOBR (g) = 2 NO (g) + Br2 (g)…

Q: A student ran the following reaction in the laboratory at 255 K: 2NO(g) + Br2(g) ----> 2NOBr(g)…

Q: Consider the following reaction. CO(g)+2H2(g)⇄CH3OH(g) A mixture of this reaction at a certain…

A: Initial concentration of [CO]= 0.125 M Initial concentration of [H2] = 0.275 M Using ICE table ,

Q: A student ran the following reaction in the laboratory at 380 K: CH (2) + CC1,(g) =2CH,C½(g) When…

Q: A student ran the following reaction in the laboratory at 642 K: 2HI(g) H2(g) + I2(g) When she…

A: Let us first calculate the initial concentration of HI, [HI] =…

Q: A student ran the following reaction in the laboratory at 431 K: PCI5 (g) PCI3 (g) + Cl2 (g) When…

A: Given : Moles of PCl5 = 2.91 moles

Q: The equilibrium constant, K, for the following reaction is 10.5 at 350 К. 2CH2Cl2(g) CH4(g) +…

A: Given that: Reaction = 2CH2Cl2(g) → CH4(g) + CCl4(g) Concentration of three gases is, [CH2Cl2] =…

Q: A student ran the following reaction in the laboratory at 534 K: CoCI2 (g) co (g) + Cl2 (g) When she…

Q: A student ran the following reaction in the laboratory at 244 K: 2NOBr(g) =2NO(g) + Br2(g) When she…

Q: A student ran the following reaction in the laboratory at 566 K: CO(g) + Cl2(g) = COC2(g) When she…

Q: A student ran the following reaction in the laboratory at 742 K: H2(g) + I2(g) = 2HI(g) When she…

A: Equilibrium constant in terms of concentration ( Kc ) is measured when the system attained…

Q: A student ran the following reaction in the laboratory at 639 K: CO(g) + Cl2(g) = COC12(g) When she…

A: Equilibrium constant Kc is calculated below.

Q: A student ran the following reaction in the laboratory at 1116 K: 2502(g) + 02(g) 2503(g) When she…

Q: A student ran the following reaction in the laboratory at 526 K: COCl2(g) CO(g) + Cl2(g) When she…

Q: A student ran the following reaction in the laboratory at 637 K: 2HI(g) H2(g) + I2(g) When she…

Q: A student ran the following reaction in the laboratory at 251 K: 2NO(g) + Brz(9) = 2NOBR(g) When she…

Q: The chemicals A and B react as follows to produce C and D: A + B ↔ C + D K e = [C] [D]…

Q: Part B Consider the reaction, which takes place at a certain elevated temperature CO(g) + NH3(g)=…

A: Equilibrium constant is defined as products concentration divided by reactant concentration to the…

Q: A student ran the following reaction in the laboratory at 281 K: 2 CH2CI2 (g) = CH4 (g) + CCl4 (g)…

Q: A student ran the following reaction in the laboratory at 1171 K: 2SO2(g) + O₂(g) = 2503(9) When she…

A: We have to predict the equilibrium constant.

Q: Calculating an equilibrium constant from a heterogeneou... Titanium and chlorine react to form…

A: Given, Mass of Ti = 4.75. Mass of Cl2 = 2.74g. Mass of TiCl4 = 4.12g. The given mass of components…

Q: A student ran the following reaction in the laboratory at 1152 K: 2502(g) + 02(g) = 2503(g) When she…

A: We have to calculate the Kc value.

Q: A student ran the following reaction in the laboratory at 70 K: H2(g) + I2(g) 2HI(g) When she…

Q: The equilibrium constant of the reaction 2C02= 2C0+02 is 1.08. If the concentrations of CO and O2 is…

Q: A student ran the following reaction in the laboratory at 325 K: 2NO(g) + Br2(g) 2NOBr(g) When she…

A: Recall the given reaction, 2 NO (g) + Br2 (g) <------> 2 NOBr (g) 0.102 moles of NO and…

Question

100%

- Part A
K, is 1.67 x 1020 at 25°C for the formation of iron(ll) oxalate complex ion:
Fe (aq) + 3 C,0,(aq) = [Fe(C,04) (aq).
If 0.160 M Fe+ is initially mixed with 1.00 M oxalate ion, what is the concentration of Fe+ ion at equilibrium?
O 1.04 x 1021 M
O 0.0100 M
O 6.81 x 10-21 M
O 1.47 x 1020 M
Submit
Request Answer

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A Boric acid and glycerin form a complex B(OH)3(aq) + glycerin(aq) B(OH)3 glycerin(aq) with an equilibrium constant of 0.90. If the concentration of boric acid is 0.10 M, how much glycerin should be added, per liter, so that 60.% of the boric acid is in the form of the complex?
. The solubility product of iron(III) hydroxide is very small: Ksp=41038at 25 °C. A classical method of analysis for unknown samples containing iron is to add NaOH or NH3. This precipitates Fe(OH)3, which can then be filtered and weighed. To demonstrate that the concentration of iron remaining in solution in such a sample is very small, calculate the solubility of Fe(OH)3in moles per liter and in grams per liter.
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
What is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
. Lead(II) chloride, PbCl2(s), dissolves in water to the extent of approximately 3.6102Mat 20 °C. Calculate Kspfor PbCl2(s), and calculate its solubility in grams per liter.
Use the solubility product constant from Appendix F to determine whether a precipitate will form if 10.0 mL of 1.0 106 M iron(II) chloride is added to 20.0 mL of 3.0 104 M barium hydroxide.
The following question is taken from a Chemistry Advanced Placement Examination and is used with the permission of the Educational Testing Service. Solve the following problem: MgF2(s)Mg2+(aq)+2F(aq) In a saturated solution of MgF2 at 18 C, the concentration of Mg2+ is 1.21103M . The equilibrium is represented by the preceding equation. (a) Write the expression for the solubility-product constant, Ksp, and calculate its value at 18 C. (b) Calculate the equilibrium concentration of Mg2+ in 1.000 L of saturated MgF2 solution at 18 C to which 0.100 mol of solid KF has been added. The KF dissolves completely. Assume the volume change is negligible. (c) Predict whether a precipitate of MgF2 will form when 100.0 mL of a 3.00103 -M solution of Mg(NO3)2 is mixed with 200.0 mL of a .2.00103 -M solution of NaF at 18 C. Show the calculations to support your prediction.. (d) At 27 C the concentration of Mg2+ in a saturated solution of MgF2 is 1.17103M . Is the dissolving of MgF2 in water all endothermic or an exothermic process? Give an explanation to support your conclusion.
. Magnesium fluoride dissolves in water to the extent of 8.0102g/L at 25°C. Calculate the solubility of MgF2(s) in moles per liter, and calculate Kspfor MgF2at 25 °C.
Data for the reaction [Mn(CO)5(CH3CN)]+ + NC5H5 (Mn(CO)5(NC5H5)]+ + CH3CN are given in the table. Calculate Ea from a plot of In k versus 1/T.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?